| Revision as of 02:58, 5 January 2011 editPashihiko (talk | contribs)Extended confirmed users3,559 editsNo edit summary← Previous edit |
Latest revision as of 04:43, 25 March 2024 edit undoDMacks (talk | contribs)Edit filter managers, Autopatrolled, Administrators186,448 edits auto mw |
| (28 intermediate revisions by 21 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| IUPAC_name = (''S'')-''N''-<nowiki>phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|
|
|
| verifiedrevid = 406013269 |
| ⚫ |
| image = Eperezolid.png |
|
|
⚫ |
| IUPAC_name = (''S'')-''N''-{{!((}}3-phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| ⚫ |
| CAS_number = 165800-04-4 |
|
|
⚫ |
| image = Eperezolid.png |
| ⚫ |
| ATC_prefix = none |
|
|
|
| alt = Skeletal formula of eperezolid |
| ⚫ |
| ATC_suffix = |
|
|
|
| width = 260 |
| ⚫ |
| PubChem = 73214 |
|
|
|
| image2 = Eperezolid 3D spacefill.png |
| ⚫ |
| DrugBank = |
|
|
|
| alt2 = Space-filling model of the eperezolid molecule |
| ⚫ |
| KEGG = D04017 |
|
|
|
|
| ⚫ |
| C = 18 | H = 23 | F = 1 | N = 4 | O = 5 |
|
|
|
<!--Clinical data--> |
|
| molecular_weight = 394.40 |
|
|
|
| tradename = |
| ⚫ |
| smiles = CC(=O)NC1CN(C(=O)O1)C2=CC(=C(C=C2)N3CCN(CC3)C(=O)CO)F |
|
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| ⚫ |
| bioavailability = |
|
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
| ⚫ |
| protein_bound = |
|
|
| metabolism = |
|
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
|
<!--Identifiers--> |
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| pregnancy_category= |
|
|
⚫ |
| CAS_number = 165800-04-4 |
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
⚫ |
| ATC_prefix = none |
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
⚫ |
| ATC_suffix = |
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
⚫ |
| PubChem = 73214 |
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| ⚫ |
| legal_status = |
|
|
⚫ |
| DrugBank = |
| ⚫ |
| routes_of_administration = |
|
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = C460ZSU1OW |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = D04017 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 47955 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 65969 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=18 | H=23 | F=1 | N=4 | O=5 |
|
⚫ |
| smiles = CC(=O)NC1CN(C(=O)O1)C2=CC(=C(C=C2)N3CCN(CC3)C(=O)CO)F |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C18H23FN4O5/c1-12(25)20-9-14-10-23(18(27)28-14)13-2-3-16(15(19)8-13)21-4-6-22(7-5-21)17(26)11-24/h2-3,8,14,24H,4-7,9-11H2,1H3,(H,20,25)/t14-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = SIMWTRCFFSTNMG-AWEZNQCLSA-N |
|
|
|
|
}} |
|
}} |
|
|
|
|
|
'''Eperezolid''' is an ] ]. |
|
'''Eperezolid''' is an ] ].{{cn|date=March 2023}} |
|
|
|
|
|
|
==Synthesis== |
|
|
] |
|
|
|
|
|
== See also == |
|
|
*] |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
{{Protein synthesis inhibitor antibiotics}} |
|
{{Protein synthesis inhibitor antibiotics}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{antibiotic-stub}} |
|
{{antibiotic-stub}} |
|
|
|
|
] |
|