| Revision as of 19:55, 23 February 2011 editChemNerd (talk | contribs)Extended confirmed users17,568 editsNo edit summary← Previous edit |
Latest revision as of 19:03, 23 September 2024 edit undoGralliyvoy (talk | contribs)194 editsNo edit summaryTag: Visual edit |
| (17 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
|
{{Distinguish|Epiestriol}} |
|
{{chembox |
|
{{chembox |
|
|
| verifiedrevid = 415563626 |
|
| ImageFile = Episterol.svg |
|
| ImageFile = Episterol.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
|
| ImageFile1 = Episterol molecule ball.png |
|
|
| ImageSize1 = 260 |
|
|
| ImageAlt1 = Ball-and-stick model of episterol |
|
| IUPACName = (3''S'',5''S'',10''S'',13''R'',14''R'',17''R'')-10, |
|
| IUPACName = (3''S'',5''S'',10''S'',13''R'',14''R'',17''R'')-10, |
|
13-dimethyl-17--2,3,4,5,6,9,11, |
|
13-dimethyl-17--2,3,4,5,6,9,11, |
|
12,14,15,16,17-dodecahydro-1H-cyclopentaphenanthren-3-ol |
|
12,14,15,16,17-dodecahydro-1H-cyclopentaphenanthren-3-ol |
|
|
| SystematicName = (3β,5α)-Ergosta-7,24(28)-dien-3-ol |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = 57-87-4 |
|
| CASNo = 474-68-0 |
|
| PubChem = 47205103 |
|
| CASNo_Ref = {{cascite|correct|PubChem}} |
|
|
| Beilstein = 2421473 |
| ⚫ |
| SMILES = CC(C)C(=C)CC(C)1CC2C3=CC4C(O)CC4(C)C3CC12C |
|
|
|
| PubChem = 5283662 |
| ⚫ |
| InChI=InChI=1/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h10,18,20-22,24-26,29H,3,7-9,11-17H2,1-2,4-6H3/t20-,21+,22+,24-,25+,26?,27+,28-/m1/s1 |
|
|
| MeSHName = Episterol |
|
| ChemSpiderID = 4446754 |
|
|
| KEGG = C15777 |
|
⚫ |
| SMILES = C(CCC(=C)C(C)C)1CC21(CC3C2=CC43(CC(C4)O)C)C |
|
⚫ |
| InChI = 1/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h10,18,20-22,24-26,29H,3,7-9,11-17H2,1-2,4-6H3/t20-,21+,22+,24-,25+,26+,27+,28-/m1/s1 |
|
|
| InChIKey = BTCAEOLDEYPGGE-JVAZTMFWBW |
|
|
| StdInChI = 1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h10,18,20-22,24-26,29H,3,7-9,11-17H2,1-2,4-6H3/t20-,21+,22+,24-,25+,26+,27+,28-/m1/s1 |
|
|
| StdInChIKey = BTCAEOLDEYPGGE-JVAZTMFWSA-N |
|
|
| ChEBI = 23929 |
|
|
| MeSHName = Episterol |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>28</sub>H<sub>46</sub>O |
|
| Formula = C<sub>28</sub>H<sub>46</sub>O |
|
| MolarMass = 398.66 g/mol |
|
| MolarMass = 398.66 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| Solubility = |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| AutoignitionPt = |
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Episterol''' is a ] involved in the ] of steroids. Episterol is converted from 24-methylenelophenol. Episterol is converted to ] by the ] ]. Episterol is also known to be a precursor to ]. |
|
'''Episterol''' is a ] involved in the ] of steroids. Episterol is synthesized from ]. Episterol is converted to ] by ], the ] in the yeast.<ref name ="Osumi et al., 1979">{{cite journal |author1=Osumi Takashi |author2=Nishino Tokuzo |author3=Katsuki Hirohiko |date=1979 |title=Studies on the delta 5-desaturation in ergosterol biosynthesis in yeast |journal=The Journal of Biochemistry |volume=85 |issue=3 |pages=819–826 |pmid=34600 }}</ref> Episterol is also known to be a precursor to ]. |
|
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
==External links== |
|
==External links== |
|
* |
|
* |
|
|
* |
|
|
|
|
|
{{Cholesterol and steroid intermediates}} |
|
⚫ |
{{steroid-stub}} |
|
] |
|
] |
|
|
|
| ⚫ |
{{steroid-stub}} |
|