| Revision as of 21:07, 9 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to watched fields - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|← Previous edit |
Latest revision as of 22:29, 9 May 2024 edit undoCitation bot (talk | contribs)Bots5,429,412 edits Added bibcode. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | #UCB_webform 2913/3458 |
| (29 intermediate revisions by 21 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 416759724 |
|
| verifiedrevid = 443937196 |
|
| ImageFileR1 = EtAsCl2.png |
|
| ImageFileR1 = EtAsCl2.png |
|
| ImageSizeR1 = 100px |
|
|
| ImageFileL1 = Ethyldichloroarsine 3D.png |
|
| ImageFileL1 = Ethyldichloroarsine 3D.png |
|
⚫ |
| PIN = Ethylarsonous dichloride |
|
| ImageSizel1 = 240px |
|
|
⚫ |
| OtherNames = ED<br>Dichloroethylarsane; DICK |
| ⚫ |
| IUPACName = Ethylarsonous dichloride |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| OtherNames = ED<br>Dichloroethylarsane |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
| CASNo = 598-14-1 |
|
| CASNo = 598-14-1 |
|
| PubChem = |
|
| PubChem = 11711 |
|
| SMILES = }} |
|
| ChemSpiderID = 11219 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| EC_number = 209-919-3 |
|
|
| RTECS = CH3500000 |
|
|
| UNNumber = 1892 |
|
|
| UNII = 4Z7627500U |
|
|
| StdInChI=1S/C2H5AsCl2/c1-2-3(4)5/h2H2,1H3 |
|
|
| StdInChIKey = LQSFEOMOHFPNEB-UHFFFAOYSA-N |
|
|
| SMILES = CC(Cl)Cl |
|
|
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
| Formula = C<sub>2</sub>H<sub>5</sub>AsCl<sub>2</sub> |
|
| Formula = C<sub>2</sub>H<sub>5</sub>AsCl<sub>2</sub> |
|
| MolarMass = 174.8893 g/mol |
|
| MolarMass = 174.8893 g/mol |
|
| Appearance = |
|
| Appearance = Colorless, mobile liquid |
|
| Density = |
|
| Density = 1.742 @ 14 °C |
|
| MeltingPt = |
|
| MeltingPtC = -65 |
|
|
| BoilingPtC = 156 |
|
| BoilingPt = 75.6°C 168°F |
|
|
|
| BoilingPt_notes = (decomposes) |
|
| Solubility = }} |
|
|
|
| Solubility = Soluble in alcohol, benzene, ether, and water}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = ], ] |
|
| MainHazards = ], ] |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = |
|
|
}} |
|
}} |
|
}} |
|
'''Ethyldichloroarsine''', sometimes abbreviated "ED", is an ] with the formula CH<sub>3</sub>CH<sub>2</sub>AsCl<sub>2</sub>. This colourless volatile liquid is a highly toxic ] or ] that was used in ].<ref name=northshore>http://www.northshore.org/healthresources/encyclopedia/bioterrorism/ch018200.aspx</ref> The molecule is pyramidal with the Cl-As-Cl and C-As-Cl angles approaching 90° (see image). It is closely related to ], which was also used in warfare. |
|
'''Ethyldichloroarsine''', sometimes abbreviated as "'''ED'''" and "'''CY'''" and also known as '''ethyl Dick''',<ref>{{cite journal | vauthors = Wood JR | title = Chemical Warfare-A Chemical and Toxicological Review | journal = American Journal of Public Health and the Nation's Health | volume = 34 | issue = 5 | pages = 455–60 | date = May 1944 | pmid = 18015982 | pmc = 1625133 | doi = 10.2105/AJPH.34.5.455 }}</ref> is an ] with the formula CH<sub>3</sub>CH<sub>2</sub>AsCl<sub>2</sub>. This colourless volatile liquid is a highly toxic obsolete ] or ] that was used during World War I in ].<ref name=northshore>{{cite web | title = Methyldichloroarsine | url = http://www.northshore.org/healthresources/encyclopedia/bioterrorism/ch018200.aspx | archive-url = https://web.archive.org/web/20110307031414/http://www.northshore.org/healthresources/encyclopedia/bioterrorism/ch018200.aspx | archive-date=March 7, 2011 | publisher = NorthShore University HealthSystem }}</ref> The molecule is pyramidal with the Cl-As-Cl and C-As-Cl angles approaching 90° (see image). Ethyldichloroarsine has high chronic toxicity, similar to ].<ref name="pmid27098411">{{cite journal | vauthors = Okumura A, Takada Y, Watanabe S, Hashimoto H, Ezawa N, Seto Y, Takayama Y, Sekioka R, Yamaguchi S, Kishi S, Satoh T, Kondo T, Nagashima H, Nagoya T | display-authors = 6 | title = In-Line Reactions and Ionizations of Vaporized Diphenylchloroarsine and Diphenylcyanoarsine in Atmospheric Pressure Chemical Ionization Mass Spectrometry | journal = Journal of the American Society for Mass Spectrometry | volume = 27 | issue = 7 | pages = 1219–26 | date = July 2016 | pmid = 27098411 | doi = 10.1007/s13361-016-1394-0 | bibcode = 2016JASMS..27.1219O }}</ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{Chemical warfare}} |
|
{{Chemical warfare}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|