| Revision as of 04:39, 2 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoBot|b← Previous edit |
Latest revision as of 23:57, 26 October 2023 edit undoKimen8 (talk | contribs)Extended confirmed users5,112 edits Changing short description from "Chemical compound" to "NSAID analgesic medication"Tag: Shortdesc helper |
| (31 intermediate revisions by 25 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|NSAID analgesic medication}} |
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 447984387 |
|
| Watchedfields = changed |
|
| ⚫ |
| verifiedrevid = 443845746 |
|
|
| IUPAC_name = 2-(2-hydroxyethoxy)ethyl 2-amino]benzoate |
|
| IUPAC_name = 2-(2-hydroxyethoxy)ethyl 2-amino]benzoate |
|
| image = Etofenamate.png |
|
| image = Etofenamate.png |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|etofenamate}} |
|
| Drugs.com = {{drugs.com|international|etofenamate}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = OTC |
|
| routes_of_administration = |
|
| routes_of_administration = Topical (cream, gel, spray) |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = 98–99% |
|
| metabolism = |
|
| metabolism = |
|
|
| metabolites = ], ] derivatives |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
|
|
| excretion = 35% ], mostly ] |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 30544-47-9 |
|
| CAS_number = 30544-47-9 |
|
| ATC_prefix = M02 |
|
| ATC_prefix = M02 |
| Line 31: |
Line 33: |
|
| PubChem = 35375 |
|
| PubChem = 35375 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = DB08984 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 32560 |
|
| ChemSpiderID = 32560 |
| Line 41: |
Line 43: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=18 | H=18 | F=3 | N=1 | O=4 |
|
| C=18 | H=18 | F=3 | N=1 | O=4 |
|
| molecular_weight = 369.33503 g/mol |
|
|
| smiles = FC(F)(F)c1cc(ccc1)Nc2ccccc2C(=O)OCCOCCO |
|
| smiles = FC(F)(F)c1cc(ccc1)Nc2ccccc2C(=O)OCCOCCO |
|
| InChI = 1/C18H18F3NO4/c19-18(20,21)13-4-3-5-14(12-13)22-16-7-2-1-6-15(16)17(24)26-11-10-25-9-8-23/h1-7,12,22-23H,8-11H2 |
|
|
| InChIKey = XILVEPYQJIOVNB-UHFFFAOYAL |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C18H18F3NO4/c19-18(20,21)13-4-3-5-14(12-13)22-16-7-2-1-6-15(16)17(24)26-11-10-25-9-8-23/h1-7,12,22-23H,8-11H2 |
|
| StdInChI = 1S/C18H18F3NO4/c19-18(20,21)13-4-3-5-14(12-13)22-16-7-2-1-6-15(16)17(24)26-11-10-25-9-8-23/h1-7,12,22-23H,8-11H2 |
| Line 51: |
Line 50: |
|
}} |
|
}} |
|
|
|
|
|
|
'''Etofenamate''' is a ] (NSAID) used for the treatment of joint and muscular ].<ref>{{cite journal | vauthors = Chlud K | title = | language = German | journal = Wiener Medizinische Wochenschrift | volume = 149 | issue = 19–20 | pages = 546–7 | year = 1999 | pmid = 10637963 }}</ref> It is available for topical application as a cream, a gel or as a spray. |
|
'''Etofenamate''' is a drug used for joint and muscular ]. |
|
|
|
|
|
|
Etofenamate is acutely toxic if swallowed; it is also very toxic to aquatic life, with long lasting effects.<ref>{{cite web | work = ] | url = https://pubchem.ncbi.nlm.nih.gov/compound/35375 | title = Etofenamate }}</ref>{{Unreliable medical source|date=February 2019}} |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Anti-inflammatory and antirheumatic products}} |
|
{{Anti-inflammatory and antirheumatic products}} |
|
{{NSAIDs}} |
|
|
{{Topical products for joint and muscular pain}} |
|
{{Topical products for joint and muscular pain}} |
|
|
{{Prostanoidergics}} |
|
|
|
|
|
|
] |
|
|
|
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{musculoskeletal-drug-stub}} |
|
{{musculoskeletal-drug-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|