| Revision as of 21:40, 27 August 2011 editAmirobot (talk | contribs)56,602 editsm r2.7.1) (robot Adding: cs:Etofenprox← Previous edit |
Latest revision as of 23:01, 2 September 2024 edit undoNosferattus (talk | contribs)Extended confirmed users4,183 edits →General uses: broad-spectrum insecticide |
| (63 intermediate revisions by 31 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 443747521 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| ImageFile = Ethofenprox.png |
|
|
⚫ |
| verifiedrevid = 447039021 |
|
⚫ |
| ImageFile = Etofenprox.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
|
| ImageAlt = Skeletal formula |
|
| IUPACName = 1-ethoxy-4-methoxy)propan-2-yl]benzene |
|
|
|
| ImageFile1 = Etofenprox-3D-balls.png |
| ⚫ |
| OtherNames = Ethofenprox |
|
|
|
| ImageSize1 = 200px |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| ImageAlt1 = Ball-and-stick model |
|
|
| PIN = 1-{methyl}-3-phenoxybenzene |
|
⚫ |
| OtherNames = Ethofenprox, MTI-500, Trebon, Zenivex |
|
⚫ |
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 64377 |
|
| ChemSpiderID = 64377 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2105573 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 0LD7P9153C |
|
| UNII = 0LD7P9153C |
| Line 25: |
Line 33: |
|
| SMILES = O(c1ccccc1)c2cc(ccc2)COCC(c3ccc(OCC)cc3)(C)C |
|
| SMILES = O(c1ccccc1)c2cc(ccc2)COCC(c3ccc(OCC)cc3)(C)C |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=25|H=28|O=3 |
|
| Formula = C<sub>25</sub>H<sub>28</sub>O<sub>3</sub> |
|
|
|
| Appearance = White (pure) or amber (man.) |
|
| MolarMass = 376.488 |
|
|
|
| Density = 1.172 g/cm<sup>3</sup> at 20.7 °C |
|
| Appearance = |
|
|
| Density = |
|
| MeltingPtC = 37.4 |
|
|
| BoilingPt = Degradation at about 200 °C |
|
| MeltingPt = |
|
|
| BoilingPt = |
|
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = > |
|
| Autoignition = }} |
|
| FlashPtC = 110 |
|
|
| AutoignitionPt = |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Etofenprox''' is a ] derivative which is used as an ].<ref> {{cite book | last1 = Becker | first1 = Norbert | last2 = Petric | first2 = Dusan | last3 = Zgomba | first3 = Marija | last4 = Boase | first4 = Clive | title = Mosquitoes and Their Control | publisher = Springer | year = 2010 | pages = 463 | url = http://books.google.com/books?id=JIfgVr1f4IQC&dq | accessdate = 2011-04-13 | isbn = 978-3540928737}}</ref> |
|
'''Etofenprox''' is a ] derivative which is used as an ].<ref>{{cite book | last1 = Becker | first1 = Norbert | last2 = Petric | first2 = Dusan | last3 = Zgomba | first3 = Marija | last4 = Boase | first4 = Clive | title = Mosquitoes and Their Control | publisher = Springer | year = 2010 | pages = 463 | url = https://books.google.com/books?id=JIfgVr1f4IQC | access-date = 2011-04-13 | isbn = 978-3-540-92873-7}}</ref> Mitsui Chemicals Agro Inc. is the main manufacturer of the chemical. It is also used as an ingredient in flea medication for cats and dogs. |
|
|
|
|
|
==General uses== |
|
|
Etofenprox is a broad-spectrum insecticide which disturbs insect nervous systems following direct contact or ingestion, and which is active against a broad spectrum of pests. It is used in agriculture, horticulture, viticulture, forestry, ] and public health against many insect pests, for instance ], ], ], ], ], and ]. In agriculture, etofenprox is used on a broad range of crops such as rice, fruits, vegetables, corn, soybeans, and tea. It is poorly absorbed by roots and little translocation occurs within plants.<ref name="WHO">{{cite web |title=WHO Specifications and Evaluations for Public Health Pesticides: Etofenprox |url=http://www.who.int/whopes/quality/en/Etofenprox_eval_WHO_july_2007.pdf |publisher=World Health Organization |access-date=6 September 2023 |date=2007}}</ref> |
|
|
|
|
|
In the ] sector, etofenprox is used for ] either by direct application in infested areas or indirectly by impregnating fabrics, such as ]. Etofenprox is used at low volumes to control adult ]es, non-biting ]s, and biting and non-biting flies. Etofenprox is used undiluted for ] aerosol applications or diluted with a diluent such as ] for direct applications, for the control of pest species in or near residential, industrial, commercial, urban, recreational areas, woodlands, golf courses, and other areas where these pests are a problem. |
|
|
|
|
|
==Hazards to humans and domestic animals== |
|
|
Etofenprox is harmful if swallowed and causes moderate eye irritation. Contact with eyes, skin or clothing should be avoided. Repeated exposure to etofenprox can cause skin irritation.<ref name=EPA>{{cite web | publisher = US Environmental Protection Agency | url = http://www.epa.gov/pesticides/chem_search/ppls/002724-00791-20131118.pdf | title = US EPA, Pesticide Product Label, RF2146 RTU, 11/18/2013 | access-date = 2014-05-21 | archive-url=https://web.archive.org/web/20240303015043/https://www.epa.gov/pesticides/chem_search/ppls/002724-00791-20131118.pdf | archive-date=2024-03-03}}</ref> {{LD50}}s are >2000 mg/kg (acute oral, rat), >2000 mg/kg (acute dermal, rat), and >5.88 mg/L (acute inhalation, rat). In rabbits, it is not a skin irritant or eye irritant. It did not cause skin sensitization in guinea pig (intradermal and topical).<ref>World Health Organization </ref> |
|
|
|
|
|
==Environmental hazards== |
|
|
This pesticide is toxic to aquatic organisms, including fish and aquatic invertebrates. Runoff from treated areas or deposition into bodies of water may be hazardous to fish and other aquatic organisms. Etofenprox is highly toxic to bees exposed to direct treatment on blooming crops or weeds. Applications should be timed to provide the maximum possible interval between treatment and the next period of bee activity.<ref name=EPA/> |
|
|
|
|
|
==Environmental persistence== |
|
|
Etofenprox is decomposed in soil by anaerobic and aerobic microorganisms. In sterilized soil, little degradation took place in a 56-day test.<ref>Aerobic versus Anaerobic Microbial Degradation of Etofenprox in a California rice field soil, Department of Environmental Toxicology, College of Agriculture and Environmental Sciences, University of California</ref> The principle metabolites do not accumulate and degrade to {{CO2}}. Etofenprox's half-life in aerobic soil is between 7 and 25 days.<ref name="europa">{{cite web |title=Assessment Report: Etofenprox |url=https://echa.europa.eu/documents/10162/d7d669de-323f-d841-db98-a79c04435a7e |publisher=European Chemicals Agency |access-date=15 September 2023 |date=September 2013}}</ref> One study showed it to have a half-life of 3 weeks on bean leaves.<ref name="fao1993">{{cite web |title=Etofenprox (185) |url=https://www.fao.org/fileadmin/user_upload/IPM_Pesticide/JMPR/Evaluations/1993/efenpox.pdf |publisher=Food and Agriculture Organization of the United Nations |access-date=15 September 2023 |date=1993 |archive-url=https://web.archive.org/web/20230727220846/https://www.fao.org/fileadmin/user_upload/IPM_Pesticide/JMPR/Evaluations/1993/efenpox.pdf |archive-date=27 July 2023}}</ref> |
|
|
Another study showed it to have a half-life of 1 week on rice plants.<ref name="fao1993"/> |
|
|
|
|
|
==Physical and chemical hazards== |
|
|
Etofenprox is combustible and should not be used or stored near heat or open flame.<ref name=EPA/> |
|
|
|
|
|
==References== |
|
==References== |
| Line 47: |
Line 74: |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|