| Revision as of 06:28, 12 April 2011 editGrutness (talk | contribs)Autopatrolled, Administrators316,498 editsmNo edit summary← Previous edit |
Latest revision as of 12:02, 1 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move semisystematic name |
| (17 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 401013871 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 423641969 |
|
| Name = Europetin |
|
| Name = Europetin |
|
| ImageFile = Europetin.PNG |
|
| ImageFile = Europetin.svg |
|
| ImageSize = 200px |
|
|
| ImageName = Chemical structure of europetin |
|
| ImageName = Chemical structure of europetin |
|
| IUPACName = 3,5-dihydroxy-7-methoxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
|
| IUPACName = 3,5,3′,4′,5′-Pentahydroxy-7-methoxyflavone |
|
|
| SystematicName = 3,5-Dihydroxy-7-methoxy-2-(3,4,5-trihydroxyphenyl)-4''H''-1-benzopyran-4-one |
|
| OtherNames = 7-methylmyricetin<!-- <br> --> |
|
|
|
| OtherNames = 7-Methylmyricetin |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 16280-27-6 |
|
| CASNo = 16280-27-6 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| CASNo_Ref = |
|
|
| CASOther = |
|
| UNII = PC84K5ZS4X |
|
|
| CASNoOther = |
|
| PubChem = 44259636 |
|
| PubChem = 44259636 |
|
|
| ChEBI = 145786 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 24845329 |
|
| SMILES = COC1=CC(=C2C(=C1)OC(=C(C2=O)O)C3=CC(=C(C(=C3)O)O)O)O |
|
| SMILES = COC1=CC(=C2C(=C1)OC(=C(C2=O)O)C3=CC(=C(C(=C3)O)O)O)O |
|
|
| InChI = 1S/C16H12O8/c1-23-7-4-8(17)12-11(5-7)24-16(15(22)14(12)21)6-2-9(18)13(20)10(19)3-6/h2-5,17-20,22H,1H3 |
|
| InChI = |
|
|
|
| InChIKey = BDZXSHDKBKYQKJ-UHFFFAOYSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=16 | H=12 | O=8 |
|
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>8</sub> |
|
|
| MolarMass = 332.26 g/mol |
|
|
| ExactMass = 332.053217 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Europetin''' is an ]. It can be found in '']''<ref></ref>. |
|
|
|
|
|
|
|
'''Europetin''' is an ]. It can be found in '']''<ref></ref> and it can be prepared synthetically.<ref>{{Cite journal | author = Sarma, P.N., Srimannarayana, G. & Subba Rao, N.V. | title = Synthesis of naturally occurring partial methyl ethers of myricetin | journal = Proc. Indian Acad. Sci. | volume = 80 | pages = 168–173 | date = 1974 | issue = 4 | doi = 10.1007/BF03046674 | s2cid = 92325935 }}</ref> |
| ⚫ |
==References== |
|
|
|
|
|
⚫ |
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{flavonol}} |
|
{{flavonol}} |
|
|
|
|
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
|
|
|
|
{{natural-phenol-stub}} |
|
{{aromatic-stub}} |