Revision as of 09:59, 10 April 2011 editGrutness (talk | contribs)Autopatrolled, Administrators316,605 editsmNo edit summary← Previous edit |
Latest revision as of 03:57, 31 March 2024 edit undoDavisA23 (talk | contribs)Extended confirmed users1,279 edits forgot to add parameters for date and category in last edit, added hereTag: Visual edit |
(13 intermediate revisions by 11 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound found in certain plant genera}} |
|
{{chembox |
|
|
|
{{Expand language|langcode=sr|langcode2=sh|date=March 2024|topic=sci}}{{chembox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 401252938 |
|
| verifiedrevid = 423309228 |
|
| Name = Eusiderin |
|
| Name = Eusiderin |
|
| ImageFile = Eusiderin.PNG |
|
| ImageFile = Eusiderin.svg |
|
| ImageSize = 200px |
|
|
| ImageName = Chemical structure of eusiderin |
|
| ImageName = Chemical structure of eusiderin |
|
| ImageAlt = Chemical structure of eusiderin |
|
| ImageAlt = Chemical structure of eusiderin |
|
|
| PIN = (2''R'',3''R'')-5-Methoxy-3-methyl-7-(prop-2-en-1-yl)-2-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1,4-benzodioxine |
|
| IUPACName = |
|
|
| OtherNames = <!-- <br> --> |
|
| OtherNames = <!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = 127420-50-2 |
|
| CASNo = 127420-50-2 |
|
| CASNo_Ref = |
|
| CASNo_Ref = {{cascite|correct|??}}= |
|
| CASOther = |
|
| CASNoOther = |
|
| PubChem = |
|
| PubChem = 11395057 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| SMILES = |
|
|
| InChI = |
|
| ChemSpiderID = 9569958 |
|
|
| SMILES = O1c3c(O(1c2cc(OC)c(OC)c(OC)c2)C)c(OC)cc(c3)C\C=C |
|
|
| InChI = 1/C22H26O6/c1-7-8-14-9-16(23-3)22-19(10-14)28-20(13(2)27-22)15-11-17(24-4)21(26-6)18(12-15)25-5/h7,9-13,20H,1,8H2,2-6H3/t13-,20+/m1/s1 |
|
|
| InChIKey = BVNKWNRETUIZFZ-XCLFUZPHBF |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C22H26O6/c1-7-8-14-9-16(23-3)22-19(10-14)28-20(13(2)27-22)15-11-17(24-4)21(26-6)18(12-15)25-5/h7,9-13,20H,1,8H2,2-6H3/t13-,20+/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = BVNKWNRETUIZFZ-XCLFUZPHSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>22</sub>H<sub>26</sub>O<sub>6</sub> |
|
| Formula = C<sub>22</sub>H<sub>26</sub>O<sub>6</sub> |
|
| MolarMass = 386.42 g/mol |
|
| MolarMass = 386.42 g/mol |
|
| ExactMass = 386.17294 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
Line 36: |
Line 43: |
|
{{lignan}} |
|
{{lignan}} |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
|
|
{{aromatic-stub}} |