Misplaced Pages

Evoxine: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 12:58, 15 February 2011 editEdgar181 (talk | contribs)Extended confirmed users196,325 edits removed Category:Alcohols; added Category:Diols using HotCat← Previous edit Latest revision as of 14:02, 21 January 2024 edit undoMaxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,043 edits Added bibcode. 
(25 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{drugbox {{Chembox
| Watchedfields = changed
| IUPAC_name = 1-(4,8-dimethoxyfuroquinolin-7-yl)oxy-3-methylbutane-2,3-diol
| verifiedrevid = 432325202
| image = Evoxine.png
| ImageFile = Evoxine.svg
| width = 200
| ImageAlt =
| CAS_number = 522-11-2
| IUPACName = (±)-1-(4,8-Dimethoxyfuroquinolin-7-yl)oxy-3-methylbutane-2,3-diol
| ATC_prefix = none
| OtherNames = Haploperine
| ATC_suffix =
|Section1={{Chembox Identifiers
| PubChem = 73416
| CASNo = 522-11-2
| DrugBank =
| PubChem = 73416
| C=11|H=12|O=2
| ChEMBL = 1416006
| molecular_weight = 347.362 g/mol
| smiles = CC(C)(C(COC1=C(C2=C(C=C1)C(=C3C=COC3=N2)OC)OC)O)O | SMILES = CC(C)(C(COC1=C(C2=C(C=C1)C(=C3C=COC3=N2)OC)OC)O)O
| ChemSpiderID = 66130
| bioavailability =
| InChI = 1/C18H21NO6/c1-18(2,21)13(20)9-25-12-6-5-10-14(16(12)23-4)19-17-11(7-8-24-17)15(10)22-3/h5-8,13,20-21H,9H2,1-4H3
| protein_bound =
| InChIKey = FGANMDNHTVJAHL-UHFFFAOYAV
| metabolism =
| StdInChI = 1S/C18H21NO6/c1-18(2,21)13(20)9-25-12-6-5-10-14(16(12)23-4)19-17-11(7-8-24-17)15(10)22-3/h5-8,13,20-21H,9H2,1-4H3
| elimination_half-life =
| StdInChIKey = FGANMDNHTVJAHL-UHFFFAOYSA-N}}
| excretion =
|Section2={{Chembox Properties
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| C=18 | H=21 | N=1 | O=6
| pregnancy_US = <!-- A / B / C / D / X -->
| Appearance =
| pregnancy_category=
| Density =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| MeltingPt =
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| BoilingPt =
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| Solubility = }}
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
|Section3={{Chembox Hazards
| legal_status = Legal
| MainHazards =
| routes_of_administration =
| FlashPt =
| AutoignitionPt = }}
|Section5={{Chembox Pharmacology
| ATCCode_prefix = none

| AdminRoutes =
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| Pregnancy_category =
| Pregnancy_AU =
}}
}} }}


'''Evoxine''' ('''Haploperine''') is an ] with ] and ] effects. It is found naturally in a variety of Australian and African plants including '']''<ref>{{cite journal | doi = 10.1071/CH9540087 | last1 = Eastwood | first1 = FW | last2 = Hughes | first2 = GK | last3 = Ritchie | first3 = E. | year = 1954 | title = Alkaloids of the Australian Rutaceae: Evodia xanthoxyloides F.Muell. IV. The structures of Evoxine and Evoxoidine | url = | journal = Australian Journal of Chemistry | volume = 7 | issue = 1| pages = 87–98 }}</ref> and '']''.<ref>{{cite journal | last1 = Waffo | first1 = AF | last2 = Coombes | first2 = PH | last3 = Crouch | first3 = NR | last4 = Mulholland | first4 = DA | last5 = El Amin | first5 = SM | last6 = Smith | first6 = PJ | title = Acridone and furoquinoline alkaloids from Teclea gerrardii (Rutaceae: Toddalioideae) of southern Africa. | journal = Phytochemistry | volume = 68 | issue = 5 | pages = 663–7 | year = 2007 | pmid = 17174364 | doi = 10.1016/j.phytochem.2006.10.011 }}</ref> '''Evoxine''' ('''haploperine''') is a ] with ] and ] effects. It is found naturally in a variety of Australian and African plants including '']''<ref>{{cite journal | doi = 10.1071/CH9540087 | last1 = Eastwood | first1 = FW | last2 = Hughes | first2 = GK | last3 = Ritchie | first3 = E. | year = 1954 | title = Alkaloids of the Australian Rutaceae: Evodia xanthoxyloides F.Muell. IV. The structures of Evoxine and Evoxoidine | journal = Australian Journal of Chemistry | volume = 7 | issue = 1| pages = 87–98 }}</ref> and '']''.<ref>{{cite journal | last1 = Waffo | first1 = AF | last2 = Coombes | first2 = PH | last3 = Crouch | first3 = NR | last4 = Mulholland | first4 = DA | last5 = El Amin | first5 = SM | last6 = Smith | first6 = PJ | title = Acridone and furoquinoline alkaloids from Teclea gerrardii (Rutaceae: Toddalioideae) of southern Africa. | journal = Phytochemistry | volume = 68 | issue = 5 | pages = 663–7 | year = 2007 | pmid = 17174364 | doi = 10.1016/j.phytochem.2006.10.011 | bibcode = 2007PChem..68..663K }}</ref>


==References== ==References==
Line 36: Line 55:
] ]
] ]
] ]
] ]
] ]
]