| Revision as of 14:02, 27 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 07:53, 24 September 2021 edit undoCitation bot (talk | contribs)Bots5,429,563 edits Add: s2cid. | Use this bot. Report bugs. | Suggested by Abductive | #UCB_toolbar |
| (22 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 381035730 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=FG 7142.png |
|
|
⚫ |
| verifiedrevid = 426209057 |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile = FG-7142.svg |
| ⚫ |
|IUPACName=N-methyl-9H-pyridoindole-3-carboxamide |
|
|
⚫ |
| ImageSize = 200px |
| ⚫ |
|OtherNames= |
|
|
⚫ |
| PIN = ''N''-Methyl-5''H''-pyridoindole-2-carboxamide |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| OtherNames = ZK-31906 |
| ⚫ |
| CASNo=78538-74-6 |
|
|
|
|
| ⚫ |
| PubChem=4375 |
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
| ⚫ |
| SMILES=CNC(=O)C1=NC=C2C(=C1)C3=CC=CC=C3N2 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = 78538-74-6 |
|
⚫ |
| PubChem = 4375 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4222 |
|
|
| MeSHName = C526324 |
|
⚫ |
| SMILES = CNC(=O)C1=NC=C2C(=C1)C3=CC=CC=C3N2 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C13H11N3O/c1-14-13(17)11-6-9-8-4-2-3-5-10(8)16-12(9)7-15-11/h2-7,16H,1H3,(H,14,17) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = QMCOPDWHWYSJSA-UHFFFAOYSA-N |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 60PO70N1BP |
|
}} |
|
}} |
|
|
|
|
|Section2= {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula=C<sub>13</sub>H<sub>11</sub>N<sub>3</sub>O |
|
| Formula = C<sub>13</sub>H<sub>11</sub>N<sub>3</sub>O |
|
| MolarMass=225.24594 |
|
| MolarMass = 225.24594 |
|
| Appearance= |
|
|
|
| Appearance = |
|
| Density= |
|
|
|
| Density = |
|
| MeltingPt= |
|
|
|
| MeltingPt = |
|
| BoilingPt= |
|
|
|
| BoilingPt = |
|
| Solubility= |
|
|
|
| Solubility = |
|
}} |
|
}} |
|
|
|
|
|Section3= {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards= |
|
|
|
| MainHazards = |
|
| FlashPt= |
|
|
|
| FlashPt = |
|
| Autoignition= |
|
|
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''FG-7142''' ('''ZK-31906''') is a drug which acts as a partial ] of the ].<ref name="pmid17503486">{{cite journal |author=Stevenson CW, Halliday DM, Marsden CA, Mason R |title=Systemic administration of the benzodiazepine receptor partial inverse agonist FG-7142 disrupts corticolimbic network interactions |journal=Synapse |volume=61 |issue=8 |pages=646–63 |year=2007 |pmid=17503486 |doi=10.1002/syn.20414}}</ref> It has ],<ref>Cottone P, Sabino V, Steardo L, Zorrilla EP. FG 7142 specifically reduces meal size and the rate and regularity of sustained feeding in female rats: evidence that benzodiazepine inverse agonists reduce food palatability. ''Neuropsychopharmacology''. 2007 May;32(5):1069-81. PMID 17077811</ref> ] and pro-] effects.<ref>Evans AK, Lowry CA. Pharmacology of the beta-carboline FG-7,142, a partial inverse agonist at the benzodiazepine allosteric site of the GABA A receptor: neurochemical, neurophysiological, and behavioral effects. ''CNS Drug Reviews''. 2007 Winter;13(4):475-501. PMID 18078430</ref> It also increases release of ] and ],<ref>Claustre Y, Rouquier L, Desvignes C, Leonetti M, Montégut J, Aubin N, Allouard N, Bougault I, Oury-Donat F, Steinberg R. Effects of the vasopressin (V1b) receptor antagonist, SSR149415, and the corticotropin-releasing factor 1 receptor antagonist, SSR125543, on FG 7142-induced increase in acetylcholine and norepinephrine release in the rat. ''Neuroscience''. 2006 Sep 1;141(3):1481-8. PMID 16781820</ref> and improves memory retention in animal studies.<ref>McNally GP, Augustyn KA, Richardson R. GABA(A) receptors determine the temporal dynamics of memory retention. ''Learning and Memory''. 2008 Feb 19;15(3):106-11. PMID 18285469</ref> |
|
'''FG-7142''' ('''ZK-31906''') is a drug which acts as a partial ] at the ] ] site of the ].<ref name="pmid17503486">{{cite journal |vauthors=Stevenson CW, Halliday DM, Marsden CA, Mason R |title=Systemic administration of the benzodiazepine receptor partial inverse agonist FG-7142 disrupts corticolimbic network interactions |journal=Synapse |volume=61 |issue=8 |pages=646–63 |year=2007 |pmid=17503486 |doi=10.1002/syn.20414|citeseerx=10.1.1.323.5370 |s2cid=13415418 }}</ref> It has ],<ref>{{cite journal | vauthors = Cottone P, Sabino V, Steardo L, Zorrilla EP | date = May 2007 | title = FG 7142 specifically reduces meal size and the rate and regularity of sustained feeding in female rats: evidence that benzodiazepine inverse agonists reduce food palatability | journal = Neuropsychopharmacology | volume = 32 | issue = 5| pages = 1069–81 | pmid = 17077811 | doi = 10.1038/sj.npp.1301229 | doi-access = free }}</ref> ] and pro-] effects.<ref>{{cite journal | vauthors = Evans AK, Lowry CA | date = Winter 2007 | title = Pharmacology of the β-carboline FG-7142, a partial inverse agonist at the benzodiazepine allosteric site of the GABA<sub>A</sub> receptor: neurochemical, neurophysiological, and behavioral effects | journal = CNS Drug Reviews | volume = 13 | issue = 4 | pages = 475–501 | pmid = 18078430 | doi = 10.1111/j.1527-3458.2007.00025.x | doi-access = free | pmc = 6494137 }}</ref> It also increases release of ] and ],<ref>{{cite journal | vauthors = Claustre Y, Rouquier L, Desvignes C, Leonetti M, Montégut J, Aubin N, Allouard N, Bougault I, Oury-Donat F, Steinberg R | year = 2006 | title = Effects of the vasopressin (V1b) receptor antagonist, SSR149415, and the corticotropin-releasing factor 1 receptor antagonist, SSR125543, on FG 7142-induced increase in acetylcholine and norepinephrine release in the rat | journal = Neuroscience | volume = 141 | issue = 3| pages = 1481–8 | pmid = 16781820 | doi = 10.1016/j.neuroscience.2006.05.006 | s2cid = 24944657 }}</ref> and improves memory retention in animal studies.<ref>{{cite journal | vauthors = McNally GP, Augustyn KA, Richardson R | year = 2008 | title = GABA<sub>A</sub> receptors determine the temporal dynamics of memory retention | journal = Learning and Memory | volume = 15 | issue = 3 | pages = 106–11 | pmid = 18285469 | doi = 10.1101/lm.806008 | doi-access = free | pmc = 2275652 }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist|2}} |
|
{{reflist|30em}} |
|
|
|
|
|
{{GABAergics}} |
|
|
{{Convulsants}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
⚫ |
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
| ⚫ |
] |
|
|
|
|
|
|
{{biochem-stub}} |
|
{{biochem-stub}} |