| Revision as of 21:34, 8 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEBI').← Previous edit |
Latest revision as of 00:01, 27 October 2023 edit undoKimen8 (talk | contribs)Extended confirmed users5,112 edits Changing short description from "Chemical compound" to "Topical NSAID medication"Tag: Shortdesc helper |
| (37 intermediate revisions by 26 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Topical NSAID medication}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
| Verifiedfields = changed |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 443752362 |
| ⚫ |
| UNII = 94WNJ5U8L7 |
|
|
⚫ |
| IUPAC_name = biphenyl-4-ylacetic acid |
| ⚫ |
| verifiedrevid = 415333733 |
|
|
⚫ |
| image = Felbinac.svg |
| ⚫ |
| IUPAC_name = biphenyl-4-ylacetic acid |
|
|
|
|
| ⚫ |
| image = Felbinac.svg |
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|felbinac}} |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = P |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = Topical |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 5728-52-9 |
|
⚫ |
| ATC_prefix = M02 |
|
⚫ |
| ATC_suffix = AA08 |
|
⚫ |
| PubChem = 3332 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = DB07477 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 3215 |
|
| ChemSpiderID = 3215 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| InChI = 1/C14H12O2/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2,(H,15,16) |
|
|
⚫ |
| UNII = 94WNJ5U8L7 |
|
| InChIKey = QRZAKQDHEVVFRX-UHFFFAOYAC |
|
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
| ⚫ |
| smiles = O=C(O)Cc1ccc(cc1)c2ccccc2 |
|
|
⚫ |
| KEGG = D01675 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEBI = 31597 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 413965 |
|
| ChEMBL = 413965 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=14 | H=12 | O=2 |
|
⚫ |
| smiles = O=C(O)Cc1ccc(cc1)c2ccccc2 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C14H12O2/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2,(H,15,16) |
|
| StdInChI = 1S/C14H12O2/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2,(H,15,16) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = QRZAKQDHEVVFRX-UHFFFAOYSA-N |
|
| StdInChIKey = QRZAKQDHEVVFRX-UHFFFAOYSA-N |
| ⚫ |
| CAS_number = 5728-52-9 |
|
| ⚫ |
| ATC_prefix = M02 |
|
| ⚫ |
| ATC_suffix = AA08 |
|
| ⚫ |
| ChEBI = 31597 |
|
| ⚫ |
| PubChem = 3332 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = DB07477 |
|
| ⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| ⚫ |
| KEGG = D01675 |
|
| ⚫ |
| C=14|H=12|O=2 |
|
|
| molecular_weight = 212.244 g/mol |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| ⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = P |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = Topical |
|
|
}} |
|
}} |
| ⚫ |
'''Felbinac''' (]) (or '''biphenylylacetic acid''') is a ] medicine, belonging to the family of medicines known as ] (NSAIDs) of the arylpropionic acid class, which is used to treat muscle inflammation and ]. It is an active metabolite of ].<ref name="KTWE1980">{{cite journal | author=Kohler C, Tolman E, Wooding W, Ellenbogen L. | title=A review of the effects of fenbufen and a metabolite, biphenylacetic acid, on platelet biochemistry and function | journal=Arzneimittelforschung | volume=30 | issue=4A | pages=702–707 | year=1980 | pmid=6254545}}</ref> |
|
|
|
|
|
|
⚫ |
'''Felbinac''' (], or '''biphenylylacetic acid''') is a ] medicine,<ref>''The Merck Index'', 12th Edition. 3989</ref> belonging to the family of medicines known as ]s (NSAIDs) of the arylacetic acid (not arylpropionic acid) class, which is used to treat muscle inflammation and ].<ref>Description of Felbinac on Tiscali </ref> It is an active metabolite of ].<ref name="KTWE1980">{{cite journal |vauthors=Kohler C, Tolman E, Wooding W, Ellenbogen L | title=A review of the effects of fenbufen and a metabolite, biphenylacetic acid, on platelet biochemistry and function | journal=Arzneimittelforschung | volume=30 | issue=4A | pages=702–707 | year=1980 | pmid=6254545}}</ref> |
|
== Footnotes == |
|
| ⚫ |
{{Reflist}} |
|
|
|
|
|
|
== References == |
|
==Related compounds== |
|
|
The α-methyl acid of felbinac is called ] and is used to prepare ]. The α-ethyl acid is called ] which is used to make ]. |
|
{{refbegin}} |
|
|
* The Merck Index, 12th Edition. 3989 |
|
|
* Description of Felbinac on Tiscali |
|
|
{{refend}} |
|
|
|
|
|
|
|
==See also== |
|
{{med-stub}} |
|
|
|
*] |
|
|
|
|
|
== References == |
|
⚫ |
{{Reflist}} |
|
|
|
|
|
{{NSAIDs}} |
|
{{NSAIDs}} |
|
{{Topical products for joint and muscular pain}} |
|
{{Topical products for joint and muscular pain}} |
|
|
{{Prostanoidergics}} |
|
|
|
|
⚫ |
] |
|
|
|
|
| ⚫ |
] |
|
|
|
|
|
|
|
{{musculoskeletal-drug-stub}} |
|
] |
|