| Revision as of 22:29, 11 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drug← Previous edit |
Latest revision as of 02:16, 3 December 2023 edit undoCitation bot (talk | contribs)Bots5,429,573 edits Alter: journal, pages. Add: doi-access. Formatted dashes. | Use this bot. Report bugs. | #UCB_CommandLine |
| (25 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{refimprove|date=May 2021}} |
|
|
{{expand Italian|topic=|otherarticle=Fenoverina|date=May 2014}} |
|
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 444343977 |
|
⚫ |
| IUPAC_name = 2-dioxol-5-ylmethyl)piperazin-1-yl]-1-(10''H''-phenothiazin-10-yl)ethanone |
|
⚫ |
| image = Fenoverine.svg |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|fenoverine}} |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
⚫ |
| protein_bound = |
|
|
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 37561-27-6 |
|
⚫ |
| ATC_prefix = A03 |
|
⚫ |
| ATC_suffix = AX05 |
|
⚫ |
| PubChem = 72098 |
|
|
| ChEMBL = 1512949 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = N274ZQ6PZJ |
|
| UNII = N274ZQ6PZJ |
| ⚫ |
| verifiedrevid = 437188857 |
|
| ⚫ |
| IUPAC_name = 2-dioxol-5-ylmethyl)piperazin-1-yl]-1-(10''H''-phenothiazin-10-yl)ethanone |
|
| ⚫ |
| image = Fenoverine.svg |
|
| ⚫ |
| CAS_number = 37561-27-6 |
|
| ⚫ |
| ATC_prefix = A03 |
|
| ⚫ |
| ATC_suffix = AX05 |
|
| ⚫ |
| PubChem = 72098 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07095 |
|
| KEGG = D07095 |
|
|
|
| ⚫ |
| chemical_formula = |
|
|
|
<!--Chemical data--> |
|
| C=26 | H=15 | N=3 | O=3 | S=1 |
|
|
⚫ |
| chemical_formula = |
|
| molecular_weight = 459.56 g/mol |
|
|
| smiles = C1CN(CCN1CC2=CC3=C(C=C2)OCO3)CC(=O)N4C5=CC=CC=C5SC6=CC=CC=C64 |
|
| C=26 | H=15 | N=3 | O=3 | S=1 |
|
|
| smiles = C1CN(CCN1CC2=CC3=C(C=C2)OCO3)CC(=O)N4C5=CC=CC=C5SC6=CC=CC=C64 |
|
| bioavailability = |
|
| ChemSpiderID = 65083 |
|
|
| StdInChI = 1S/C26H25N3O3S/c30-26(29-20-5-1-3-7-24(20)33-25-8-4-2-6-21(25)29)17-28-13-11-27(12-14-28)16-19-9-10-22-23(15-19)32-18-31-22/h1-10,15H,11-14,16-18H2 |
| ⚫ |
| protein_bound = |
|
|
| metabolism = |
|
| StdInChIKey = UBAJTZKNDCEGKL-UHFFFAOYSA-N |
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
'''Fenoverine''' (]) is an ] drug. |
|
|
|
|
|
|
|
'''Fenoverine''' (]) is an ] drug,<ref name="pmid22672854">{{cite journal | vauthors = Martínez-Vázquez MA, Vázquez-Elizondo G, González-González JA, Gutiérrez-Udave R, Maldonado-Garza HJ, Bosques-Padilla FJ | title = Effect of antispasmodic agents, alone or in combination, in the treatment of Irritable Bowel Syndrome: systematic review and meta-analysis | journal = Revista de Gastroenterologia de Mexico | volume = 77 | issue = 2 | pages = 82–90 | date = 2012 | pmid = 22672854 | doi = 10.1016/j.rgmx.2012.04.002 | doi-access = free }}</ref> which acts by inhibiting calcium channels<ref name="Chariot_1995">{{cite journal | vauthors = Chariot P, Ratiney R, Le Maguet F, Fourestié V, Astier A, Gherardi R| title = Fenoverine-induced rhabdomyolysis | journal = Hum Exp Toxicol | volume = 14 | issue = 8 | pages = 654–656| date = August 1995 | doi =10.1177/096032719501400805 |pmid = 7576832}}</ref> . In the case of Fenoverine, the relaxation occurs in abdominal / intestinal smooth muscles, while in case of antianginal drugs, the relaxation occurs in coronary vessels. Notably ''Fenoverine does not act as an antianginal agent''. |
|
|
==Toxicity== |
|
|
Fenoverine is known to cause ].<ref name="Chariot_1995"/><ref name="Cho_2020">{{cite journal | vauthors = Cho J, Na J, Bae E, Lee TW, Jang HN, Cho HS, Chang SH, Park DJ| title = The incidence, risk factors, and clinical outcomes of rhabdomyolysis associated with fenoverine prescription: a retrospective study in South Korea (1999-2014) | journal = BMC Pharmacol Toxicol | volume = 21 | issue = 1 | pages = 30| date = April 2020 | doi =10.1186/s40360-020-00408-3 |pmid = 32334639 | pmc=7183697 | doi-access = free }}</ref> |
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Drugs for functional gastrointestinal disorders}} |
|
{{Drugs for functional gastrointestinal disorders}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |