| Revision as of 23:46, 8 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drug← Previous edit |
Latest revision as of 07:07, 15 April 2024 edit undoحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits removed Category:Benzene derivatives; added Category:Phenyl compounds using HotCat |
| (28 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{context|date=May 2014}} |
|
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 443773826 |
|
⚫ |
| IUPAC_name = 1-piperidine |
|
⚫ |
| image = Fenpiprane.png |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
|
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 3540-95-2 |
|
⚫ |
| ATC_prefix = A03 |
|
⚫ |
| ATC_suffix = AX01 |
|
⚫ |
| PubChem = 197785 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = S2FVB1RL5X |
|
| UNII = S2FVB1RL5X |
| ⚫ |
| verifiedrevid = 437198716 |
|
| ⚫ |
| IUPAC_name = 1-piperidine |
|
| ⚫ |
| image = Fenpiprane.png |
|
| ⚫ |
| CAS_number = 3540-95-2 |
|
| ⚫ |
| ATC_prefix = A03 |
|
| ⚫ |
| ATC_suffix = AX01 |
|
| ⚫ |
| PubChem = 197785 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07091 |
|
| KEGG = D07091 |
|
|
| ChEMBL = 49943 |
|
| C=20|H=25|N=1 |
|
|
|
| ChemSpiderID = 171191 |
|
| molecular_weight = 279.42 g/mol |
|
|
|
|
| ⚫ |
| bioavailability = |
|
|
|
<!--Chemical data--> |
| ⚫ |
| protein_bound = |
|
|
| metabolism = |
|
| C=20 | H=25 | N=1 |
|
|
| smiles = C1CCN(CC1)CCC(C2=CC=CC=C2)C3=CC=CC=C3 |
| ⚫ |
| elimination_half-life = |
|
|
|
| StdInChI = 1S/C20H25N/c1-4-10-18(11-5-1)20(19-12-6-2-7-13-19)14-17-21-15-8-3-9-16-21/h1-2,4-7,10-13,20H,3,8-9,14-17H2 |
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Fenpiprane''' is a drug used for ]s.<ref>{{cite journal | vauthors = Whitfield KL, Shulman RJ | title = Treatment options for functional gastrointestinal disorders: from empiric to complementary approaches | journal = Pediatric Annals | volume = 38 | issue = 5 | pages = 288-90, 292-4 | date = May 2009 | pmid = 19476303 | pmc = 2830707 }}</ref><ref>{{cite journal | vauthors = Black CJ, Drossman DA, Talley NJ, Ruddy J, Ford AC | title = Functional gastrointestinal disorders: advances in understanding and management | journal = Lancet | volume = 396 | issue = 10263 | pages = 1664–1674 | date = November 2020 | pmid = 33049221 | doi = 10.1016/S0140-6736(20)32115-2 | s2cid = 222253972 | url = https://eprints.whiterose.ac.uk/166984/3/THELANCET-D-20-00966R3%20CLEAN.pdf }}</ref><ref>{{cite journal | vauthors = Olden KW | title = The use of antidepressants in functional gastrointestinal disorders: new uses for old drugs | journal = CNS Spectrums | volume = 10 | issue = 11 | pages = 891–896 | date = November 2005 | pmid = 16273017 | doi = 10.1017/s1092852900019866 | s2cid = 416219 }}</ref> |
|
'''Fenpiprane''' is a drug used for ]s. |
|
|
|
|
|
|
|
== References == |
|
|
|
|
|
|
] |
|
⚫ |
] |
|
|
] |
|
⚫ |
<references />{{gastrointestinal-drug-stub}} |
|
{{Drugs for functional gastrointestinal disorders}} |
|
{{Drugs for functional gastrointestinal disorders}} |
|
|
|
| ⚫ |
] |
|
|
|
|
|
|
|
| ⚫ |
{{gastrointestinal-drug-stub}} |
|