| Revision as of 12:16, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 455553152 of page Fentin_acetate for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo'). |
Latest revision as of 14:41, 16 September 2024 edit Frietjes (talk | contribs)Autopatrolled, Extended confirmed users, Template editors1,001,353 editsNo edit summary |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 444590138 |
|
| verifiedrevid = 461100007 |
|
|Reference=<ref> at ]</ref> |
|
|Reference=<ref> at ]</ref> |
|
|ImageFile=Ph3SnOAc.png |
|
|ImageFile=Ph3SnOAc.svg |
|
|ImageSize=130px |
|
|ImageSize=130px |
|
|
|ImageAlt = Skeletal formula of fentin acetate |
|
|
|ImageFile1= |
|
|
|ImageSize1=185 |
|
|
|ImageAlt1 = |
|
|IUPACName= (acetoxy)(triphenyl)stannane |
|
|IUPACName= (acetoxy)(triphenyl)stannane |
|
|OtherNames=Phentin acetate; Triphenyltin acetate; Triphenylstannyl acetate; Acetic acid tri(phenyl)stannyl ester |
|
|OtherNames=Phentin acetate; Triphenyltin acetate; Triphenylstannyl acetate; Acetic acid tri(phenyl)stannyl ester, Brestan |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo=900-95-8 |
|
⚫ |
| CASNo2_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo2 = 76-87-9 |
|
⚫ |
| CASNo2_Comment = (fentin hydroxide) <!-- This is CAS verified --> |
|
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 81918 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEMBL = 474376 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 8085060 |
|
| ChemSpiderID = 8085060 |
|
|
| EINECS = 212-984-0 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = C18728 |
|
⚫ |
| PubChem=16682804 |
|
|
| UNII = 70M92GQA9T |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII2 = KKL46V5313 |
|
|
| UNII2_Comment = (fentin hydroxide) |
|
|
| UNII2_Ref = {{fdacite|correct|FDA}} |
|
| InChI = 1/3C6H5.C2H4O2.Sn/c3*1-2-4-6-5-3-1;1-2(3)4;/h3*1-5H;1H3,(H,3,4);/q;;;;+1/p-1/rC18H15Sn.C2H4O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2(3)4/h1-15H;1H3,(H,3,4)/q+1;/p-1 |
|
| InChI = 1/3C6H5.C2H4O2.Sn/c3*1-2-4-6-5-3-1;1-2(3)4;/h3*1-5H;1H3,(H,3,4);/q;;;;+1/p-1/rC18H15Sn.C2H4O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2(3)4/h1-15H;1H3,(H,3,4)/q+1;/p-1 |
|
| InChIKey = WDQNIWFZKXZFAY-FRUPRYIZAN |
|
| InChIKey = WDQNIWFZKXZFAY-FRUPRYIZAN |
| Line 16: |
Line 38: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WDQNIWFZKXZFAY-UHFFFAOYSA-M |
|
| StdInChIKey = WDQNIWFZKXZFAY-UHFFFAOYSA-M |
|
⚫ |
| SMILES = C(=O)C.c3c((c1ccccc1)c2ccccc2)cccc3 |
| ⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo = <!-- blanked - oldvalue: 900-95-8 --> |
|
| ⚫ |
| CASOther = <br/> 76-87-9 (fentin hydroxide) <!-- This is CAS verified --> |
|
| ⚫ |
| ChEMBL = 474376 |
|
| ⚫ |
| PubChem=16682804 |
|
| ⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| ⚫ |
| KEGG = C18728 |
|
| ⚫ |
| SMILES = C(=O)C.c3c((c1ccccc1)c2ccccc2)cccc3 |
|
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=20|H=18|O=2|Sn=1 |
|
| C=20|H=18|O=2|Sn=1 |
|
| MolarMass=409.07 g/mol |
|
| MolarMass=409.07 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= 122-124 °C |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards=Very toxic ('''T+''')<br>Dangerous for the environment ('''N''') |
|
| MainHazards=Very toxic <br>Dangerous for the environment |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt= |
|
| Autoignition= |
|
|
| RPhrases = {{R24/25}} {{R26}} {{R37/38}} {{R40}} {{R41}} {{R48/23}} {{R50/53}} {{R63}} |
|
| GHSPictograms = {{GHS05}}{{GHS06}}{{GHS08}}{{GHS09}} |
|
|
| GHSSignalWord = Warning |
|
| SPhrases = {{S26}} {{S28}} {{S36/37/39}} {{S45}} {{S60}} {{S61}} |
|
|
|
| HPhrases = {{H-phrases|301|311|315|318|330|335|351|372|361d|410}} |
| ⚫ |
}} |
|
|
|
| PPhrases = {{P-phrases|201|202|260|264|270|271|273|280|284|301+310|302+352|304+340|305+351+338|308+313|310|320|330|332+313|361|363|391|403+233|405|501}} |
|
|
| LD50 = 21 mg/kg (guinea pig, oral)<br/>30 mg/kg (rabbit, oral)<br/>81 mg/kg (mouse, oral)<br/>125 mg/kg (rat, oral)<ref>{{IDLH|tin-org|Tin (organic compounds, as Sn)}}</ref> |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Fentin acetate''' is an ] with the formula (C<sub>6</sub>H<sub>5</sub>)<sub>3</sub>SnO<sub>2</sub>CCH<sub>3</sub>. It is a colourless solid that was previously used as a ].<ref>G. G. Graf "Tin, Tin Alloys, and Tin Compounds" in ''Ullmann's Encyclopedia of Industrial Chemistry'', 2005, Wiley-VCH.{{doi|10.1002/14356007.a27_049}}</ref><ref>. PubChem. National Library of Medicine. NIH. Accessed 13 July 2023.</ref> |
|
|
|
|
|
==Structure== |
|
|
Most carboxylates of triphenyltin adopt polymeric structures with five-coordinate Sn centers.<ref>{{cite journal |doi=10.1016/0022-328X(89)85138-1|title=Variable-temperature tin-119m Mössbauer spectroscopic and x-ray crystallographic study of triphenyltin(IV) chloroacetate, [(C6H5)3SnOC(O)CH2Cl], and a redetermination of d[ln f(T)]/DT for triphenyltin(IV) acetate|year=1989|last1=Weng Ng|first1=Seik|last2=Lan Chin|first2=Kwai|last3=Wei|first3=Chen|last4=Kumar Das|first4=V.G.|last5=Butcher|first5=Ray J.|journal=Journal of Organometallic Chemistry|volume=376|issue=2–3|pages=277–281}}</ref> |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
==External links== |
|
|
* {{PPDB|311}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |