| Revision as of 18:40, 17 May 2013 editCyberbot I (talk | contribs)Bots, Template editors1,719,918 editsm Updating Admin Stats (beta framework) | Latest revision as of 17:34, 7 September 2024 edit JWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Chloroarenes; added Category:4-Chlorophenyl compounds using HotCat | ||
| Line 1: | Line 1: | ||
| {{chembox | |||
| {{Adminstats/Core | |||
| | Watchedfields = changed | |||
| |edits=29911 | |||
| | verifiedrevid = 555550102 | |||
| |ed=34249 | |||
| |created=0 | |||
| | ImageFile = ] | |||
| |deleted=4448 | |||
| | ImageSize = 250px | |||
| |restored=60 | |||
| | ImageFile1 = Fenvalerate-3D-spacefill.png | |||
| |blocked=882 | |||
| | ImageSize1 = 250 | |||
| |protected=321 | |||
| | ImageAlt1 = Fenvalerate molecule | |||
| |unprotected=6 | |||
| | IUPACName = (''RS'')-''alpha''-Cyano-3-phenoxybenzyl (RS)-2-(4-chlorophenyl)-3-methylbutyrate | |||
| |rights=0 | |||
| | OtherNames = | |||
| |reblock=50 | |||
| |Section1={{Chembox Identifiers | |||
| |unblock=9 | |||
| | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| |modify=4 | |||
| | ChemSpiderID = 3230 | |||
| |rename=0 | |||
| | UNII_Ref = {{fdacite|correct|FDA}} | |||
| |import=0 | |||
| | UNII = Z6MXZ39302 | |||
| |style={{{style|}}}}} | |||
| | InChI = 1/C25H22ClNO3/c1-17(2)24(18-11-13-20(26)14-12-18)25(28)30-23(16-27)19-7-6-10-22(15-19)29-21-8-4-3-5-9-21/h3-15,17,23-24H,1-2H3 | |||
| | InChIKey = NYPJDWWKZLNGGM-UHFFFAOYAU | |||
| | ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| | ChEMBL = 492491 | |||
| | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| | StdInChI = 1S/C25H22ClNO3/c1-17(2)24(18-11-13-20(26)14-12-18)25(28)30-23(16-27)19-7-6-10-22(15-19)29-21-8-4-3-5-9-21/h3-15,17,23-24H,1-2H3 | |||
| | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| | StdInChIKey = NYPJDWWKZLNGGM-UHFFFAOYSA-N | |||
| | CASNo_Ref = {{cascite|correct|CAS}} | |||
| | CASNo =51630-58-1 | |||
| | PubChem = 3347 | |||
| | ChEBI_Ref = {{ebicite|correct|EBI}} | |||
| | ChEBI = 5014 | |||
| | SMILES = Clc1ccc(cc1)C(C(=O)OC(C#N)c3cccc(Oc2ccccc2)c3)C(C)C | |||
| | RTECS = CY 1576350 | |||
| | KEGG_Ref = {{keggcite|correct|kegg}} | |||
| | KEGG = C10988 | |||
| }} | |||
| |Section2={{Chembox Properties | |||
| | C=25 | H=22 | Cl=1 | N=1 | O=3 | |||
| | Appearance = Yellow-brown viscous liquid | |||
| | Density = 1.175 g/cm<sup>3</sup> | |||
| | MeltingPt = | |||
| | BoilingPt = | |||
| | Solubility = 2 μg/L | |||
| }} | |||
| |Section6={{Chembox Pharmacology | |||
| | ATCvet = yes | |||
| | ATCCode_prefix = P53 | |||
| | ATCCode_suffix = AC14 | |||
| | ATC_Supplemental = {{ATCvet|P53|AX02}} | |||
| }} | |||
| |Section7={{Chembox Hazards | |||
| | MainHazards = | |||
| | FlashPt = | |||
| | AutoignitionPt = | |||
| }} | |||
| }} | |||
| '''Fenvalerate ''' is a synthetic ] ]. It is a ] of four optical ]s which have different insecticidal activities. The 2-S ''alpha'' (or SS) configuration, known as ], is the most insecticidally active isomer. Fenvalerate consists of about 23% of this isomer. | |||
| Fenvalerate is an insecticide of moderate ] toxicity. In laboratory animals, central nervous system toxicity is observed following acute or short-term exposure. Fenvalerate has applications against a wide range of pests including some of the more destructive such as the '']''.<ref>{{Cite journal|last=Wang|first=Kai-Yun|last2=Zhang|first2=Yong|last3=Wang|first3=Hong-Yan|last4=Xia|first4=Xiao-Ming|last5=Liu|first5=Tong-Xian|date=2010-01-01|title=Influence of three diets on susceptibility of selected insecticides and activities of detoxification esterases of Helicoverpa assulta (Lepidoptera: Noctuidae)|journal=Pesticide Biochemistry and Physiology|volume=96|issue=1|pages=51–55|doi=10.1016/j.pestbp.2009.09.003}}</ref> Residue levels are minimized by low application rates. Fenvalerate is most toxic to bees and fish. It is found in some emulsifiable concentrates, ULV, wettable powders, slow release formulations, insecticidal fogs, and granules. It is most commonly used to control insects in food, feed, and cotton products, and for the control of flies and ticks in barns and stables. Fenvalerate does not affect plants, but is active for an extended period of time. | |||
| Fenvalerate may irritate the skin and eyes on contact, and is also harmful if swallowed. | |||
| == References == | |||
| <references /> | |||
| ==External links== | |||
| * | |||
| * | |||
| * {{PPDB|314}} | |||
| * | |||
| {{insecticides}} | |||
| ] | |||
| ] | |||
| ] | |||
| ] | |||
| ] | |||
| ] | |||