| Revision as of 03:18, 11 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_P← Previous edit |
Latest revision as of 15:53, 9 December 2024 edit undoCitation bot (talk | contribs)Bots5,429,395 edits Added bibcode. | Use this bot. Report bugs. | Suggested by Dominic3203 | Linked from User:Marbletan/sandbox | #UCB_webform_linked 154/2664 |
| (16 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|NSAID analgesic drug}} |
|
{{drugbox |
|
|
|
{{Drugbox |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| Watchedfields = changed |
| ⚫ |
| UNII = 7BVX6J0CGR |
|
|
| verifiedrevid = 437279023 |
|
| verifiedrevid = 444188860 |
|
| IUPAC_name = 4-(3-methylbut-2-enyl)-1,2-di(phenyl)pyrazolidine-3,5-dione |
|
| IUPAC_name = 4-(3-methylbut-2-enyl)-1,2-di(phenyl)pyrazolidine-3,5-dione |
|
| image = feprazone.png |
|
| image = feprazone.png |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|feprazone}} |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CAS_number = 30748-29-9 |
|
⚫ |
| ATC_prefix = M02 |
|
⚫ |
| ATC_suffix = AA16 |
|
⚫ |
| PubChem = 35455 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 32612 |
|
| ChemSpiderID = 32612 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| InChI = 1/C20H20N2O2/c1-15(2)13-14-18-19(23)21(16-9-5-3-6-10-16)22(20(18)24)17-11-7-4-8-12-17/h3-13,18H,14H2,1-2H3 |
|
|
⚫ |
| UNII = 7BVX6J0CGR |
|
| InChIKey = RBBWCVQDXDFISW-UHFFFAOYAV |
|
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = D01305 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=20 | H=20 | N=2 | O=2 |
|
| smiles = O=C2N(c1ccccc1)N(C(=O)C2C\C=C(/C)C)c3ccccc3 |
|
| smiles = O=C2N(c1ccccc1)N(C(=O)C2C\C=C(/C)C)c3ccccc3 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 14: |
Line 48: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = RBBWCVQDXDFISW-UHFFFAOYSA-N |
|
| StdInChIKey = RBBWCVQDXDFISW-UHFFFAOYSA-N |
| ⚫ |
| CAS_number = |
|
| ⚫ |
| ATC_prefix = M02 |
|
| ⚫ |
| ATC_suffix = AA16 |
|
| ⚫ |
| PubChem = 35455 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| ⚫ |
| KEGG = D01305 |
|
| ⚫ |
| C=20|H=20|N=2|O=2 |
|
|
| molecular_weight = 320.385 g/mol |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| ⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Feprazone''' (or '''prenazone''') is a drug used for joint and muscular ].<ref>{{cite journal | vauthors = Koyama T, Izawa Y, Wada H, Makita T, Hashimoto Y, Enomoto M | title = Toxicological aspects of feprazone, a new nonsteroidal anti-inflammatory drug | journal = Toxicology and Applied Pharmacology | volume = 64 | issue = 2 | pages = 255–70 | date = June 1982 | pmid = 7123554 | doi = 10.1016/0041-008X(82)90222-8 | bibcode = 1982ToxAP..64..255K }}</ref> |
|
'''Feprazone''' (or '''prenazone''') is a drug used for joint and muscular ]. |
|
|
|
|
|
|
It is an analog of ] but instead of a ''n''-butyl group it is ]. |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Anti-inflammatory and antirheumatic products}} |
|
{{Anti-inflammatory and antirheumatic products}} |
|
{{Topical products for joint and muscular pain}} |
|
{{Topical products for joint and muscular pain}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{musculoskeletal-drug-stub}} |
|
{{musculoskeletal-drug-stub}} |
|
|
|
|
] |
|