| Revision as of 01:44, 10 April 2011 editGrutness (talk | contribs)Autopatrolled, Administrators316,473 editsmNo edit summary← Previous edit |
Latest revision as of 23:03, 19 February 2024 edit undoCitation bot (talk | contribs)Bots5,429,599 edits Added s2cid. | Use this bot. Report bugs. | Suggested by Abductive | Category:Terpeno-phenolic compounds | #UCB_Category 11/19 |
| (13 intermediate revisions by 9 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 399951476 |
|
| verifiedrevid = 423264786 |
|
|ImageFile=Ferujol.png |
|
| ImageFile=Ferujol.png |
|
|ImageSize=200px |
|
| ImageSize=200px |
|
|IUPACName= 8-{oxy}-7-hydroxy-2H-chromen-2-one |
|
| PIN= 8-{oxy}-7-hydroxy-2''H''-1-benzopyran-2-one |
|
|OtherNames= |
|
| OtherNames= |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4940313 |
|
| ChemSpiderID = 4940313 |
|
| InChI = 1/C19H24O4/c1-13(2)5-4-6-14(3)11-12-22-19-16(20)9-7-15-8-10-17(21)23-18(15)19/h7-11,13,20H,4-6,12H2,1-3H3/b14-11+ |
|
| InChI = 1/C19H24O4/c1-13(2)5-4-6-14(3)11-12-22-19-16(20)9-7-15-8-10-17(21)23-18(15)19/h7-11,13,20H,4-6,12H2,1-3H3/b14-11+ |
| Line 15: |
Line 15: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ATKUFZHTQAERBN-SDNWHVSQSA-N |
|
| StdInChIKey = ATKUFZHTQAERBN-SDNWHVSQSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=98299-78-6 |
|
| CASNo=98299-78-6 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem=6435569 |
|
|
|
| UNII = SGK3OX19I8 |
| ⚫ |
| SMILES = O=C/2Oc1c(OC\C=C(/C)CCCC(C)C)c(O)ccc1\C=C\2 |
|
|
⚫ |
| PubChem=6435569 |
|
⚫ |
| SMILES = O=C/2Oc1c(OC\C=C(/C)CCCC(C)C)c(O)ccc1\C=C\2 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=19 | H=24 | O=4 |
|
| Formula = C<sub>19</sub>H<sub>24</sub>O<sub>4</sub> |
|
|
⚫ |
| Appearance = |
|
| MolarMass = 316.39 g/mol |
|
|
|
| Density= |
|
| ExactMass = 316.167459 u |
|
|
|
| MeltingPt= |
| ⚫ |
| Appearance = |
|
|
| Density= |
|
| BoilingPt= |
|
| MeltingPt= |
|
| Solubility= |
|
| BoilingPt= |
|
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Ferujol''' is a compound in the ] family, isolated from '']'' and reported to have contraceptive activity when given to female rats 1-5 days after coitus.<ref name = singh> Singh MM, Gupta DN, Wadhwa V, Jain GK, Khanna NM, Kamboj VP. (1985) Contraceptive efficacy and hormonal profile of ferujol: a new coumarin from Ferula jaeschkeana. ''Planta medica'' 1985 (3):268-270 </ref> |
|
'''Ferujol''' is a compound in the ] family, isolated from '']''. |
|
|
|
|
|
It is reported to have contraceptive activity when given to female rats 1–5 days after coitus.<ref name = singh>{{cite journal | doi = 10.1055/s-2007-969478 | pmid = 3839926 | title = Contraceptive Efficacy and Hormonal Profile of Ferujol: A New Coumarin from ''Ferula'' jaeschkeana1 | journal = Planta Medica | volume = 51 | issue = 3 | pages = 268–270 | year = 1985 | last1 = Singh | first1 = M. | last2 = Gupta | first2 = D. | last3 = Wadhwa | first3 = V. | last4 = Jain | first4 = G. | last5 = Khanna | first5 = N. | last6 = Kamboj | first6 = V. | s2cid = 260284567 }}</ref> |
|
|
|
|
|
== References == |
|
== References == |
| Line 43: |
Line 46: |
|
{{coumarin}} |
|
{{coumarin}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{aromatic-stub}} |