| Revision as of 12:19, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456785316 of page Fesoterodine for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number'). |
Latest revision as of 06:51, 26 October 2024 edit 76.174.0.57 (talk) Cats. |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 399951746 |
|
| verifiedrevid = 461100276 |
|
|
| image = Fesoterodine.svg |
|
| IUPAC_name = -4-(hydroxymethyl)phenyl] 2-methylpropanoate |
|
|
|
| width = 250 |
|
| image = Fesoterodine.png |
|
|
|
| alt = |
|
|
| image2 = Fesoterodine 3D spacefill.png |
|
|
| width2 = 220 |
|
|
| alt2 = Space-filling model of the fesoterodine molecule |
|
|
| caption = |
|
|
|
|
|
<!--Clinical data--> |
|
<!-- Clinical data --> |
|
| tradename = |
|
| pronounce = |
|
|
| tradename = Fesobig , Toviaz |
|
| Drugs.com = {{drugs.com|monograph|fesoterodine-fumarate}} |
|
| Drugs.com = {{drugs.com|monograph|fesoterodine-fumarate}} |
|
| MedlinePlus = a609021 |
|
| MedlinePlus = a609021 |
|
|
| DailyMedID = Fesoterodine |
|
| licence_EU = Toviaz |
|
|
|
| routes_of_administration = ] |
|
| licence_US = Fesoterodine |
|
|
| pregnancy_US = C |
|
| class = |
|
| legal_status = Rx-only |
|
| ATC_prefix = G04 |
|
|
| ATC_suffix = BD11 |
|
| routes_of_administration = Oral |
|
|
|
| ATC_supplemental = |
|
|
|
|
|
<!-- Legal status --> |
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> |
|
|
| legal_AU_comment = |
|
|
| legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F --> |
|
|
| legal_BR_comment = |
|
|
| legal_CA = Rx-only |
|
|
| legal_CA_comment = <ref>{{cite web | title=Product monograph brand safety updates | website=] | date=6 June 2024 | url=https://www.canada.ca/en/health-canada/services/drugs-health-products/drug-products/drug-product-database/label-safety-assessment-update/product-monograph-brand-safety-updates.html | access-date=8 June 2024}}</ref> |
|
|
| legal_DE = <!-- Anlage I, II, III or Unscheduled --> |
|
|
| legal_DE_comment = |
|
|
| legal_NZ = <!-- Class A, B, C --> |
|
|
| legal_NZ_comment = |
|
|
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C --> |
|
|
| legal_UK_comment = |
|
|
| legal_US = Rx-only |
|
|
| legal_US_comment = |
|
|
| legal_EU = Rx-only |
|
|
| legal_EU_comment = |
|
|
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV --> |
|
|
| legal_UN_comment = |
|
|
| legal_status = <!-- For countries not listed above --> |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!-- Pharmacokinetic data --> |
|
| bioavailability = 52% (active metabolite) |
|
| bioavailability = 52% (active metabolite) |
|
| protein_bound = 50% (active metabolite) |
|
| protein_bound = 50% (active metabolite) |
|
| metabolism = ] (]- and ]-mediated) |
|
| metabolism = ] (]- and ]-mediated) |
|
| elimination_half-life = 7â8 hours (active metabolite) |
|
| elimination_half-life = 7–8 hours (active metabolite) |
|
| excretion = ] (70%) and fecal (7%) |
|
| excretion = ] (70%) and fecal (7%) |
|
|
|
|
|
<!--Identifiers--> |
|
<!-- Identifiers --> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|changed|CAS}} |
|
| CAS_number = <!-- blanked - oldvalue: 286930-03-8 --> |
|
| CAS_number = 286930-02-7 |
|
| CAS_supplemental = |
|
| CAS_supplemental = |
|
| ATC_prefix = G04 |
|
|
| ATC_suffix = BD11 |
|
|
| ATC_supplemental = |
|
|
| PubChem = 6918558 |
|
| PubChem = 6918558 |
|
|
| IUPHAR_ligand = 7473 |
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB06702 |
|
| DrugBank = DB06702 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 5293755 |
|
| ChemSpiderID = 5293755 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 621G617227 |
|
| UNII = 621G617227 |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07226 |
|
| KEGG = D07226 |
|
|
| ChEBI_Ref = |
|
|
| ChEBI = |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 1201764 --> |
|
| ChEMBL = 1201764 |
|
|
| NIAID_ChemDB = |
|
|
| PDB_ligand = |
|
|
| synonyms = |
|
|
|
|
|
<!--Chemical data--> |
|
|
| IUPAC_name = -4-(hydroxymethyl)phenyl] 2-methylpropanoate |
|
| C=26 | H=37 | N=1 | O=3 |
|
| C=26 | H=37 | N=1 | O=3 |
|
|
| SMILES = O=C(Oc1ccc(cc1(c2ccccc2)CCN(C(C)C)C(C)C)CO)C(C)C |
|
| molecular_weight = 411.278 g/mol |
|
|
| smiles = O=C(Oc1ccc(cc1(c2ccccc2)CCN(C(C)C)C(C)C)CO)C(C)C |
|
|
| InChI = 1/C26H37NO3/c1-18(2)26(29)30-25-13-12-21(17-28)16-24(25)23(22-10-8-7-9-11-22)14-15-27(19(3)4)20(5)6/h7-13,16,18-20,23,28H,14-15,17H2,1-6H3/t23-/m1/s1 |
|
|
| InChIKey = DCCSDBARQIPTGU-HSZRJFAPBK |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C26H37NO3/c1-18(2)26(29)30-25-13-12-21(17-28)16-24(25)23(22-10-8-7-9-11-22)14-15-27(19(3)4)20(5)6/h7-13,16,18-20,23,28H,14-15,17H2,1-6H3/t23-/m1/s1 |
|
| StdInChI = 1S/C26H37NO3/c1-18(2)26(29)30-25-13-12-21(17-28)16-24(25)23(22-10-8-7-9-11-22)14-15-27(19(3)4)20(5)6/h7-13,16,18-20,23,28H,14-15,17H2,1-6H3/t23-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = DCCSDBARQIPTGU-HSZRJFAPSA-N |
|
| StdInChIKey = DCCSDBARQIPTGU-HSZRJFAPSA-N |
|
|
| density = |
|
|
| density_notes = |
|
|
| melting_point = |
|
|
| melting_high = |
|
|
| melting_notes = |
|
|
| boiling_point = |
|
|
| boiling_notes = |
|
|
| solubility = |
|
|
| sol_units = |
|
|
| specific_rotation = |
|
}} |
|
}} |
|
|
|
|
|
'''Fesoterodine''' (], used as the ] under the brand name '''Toviaz''') is an ] drug developed by ] to treat ] (OAB).<ref>{{cite web| url=http://www.medicalnewstoday.com/articles/41688.php| title=Fesoterodine, New Drug Candidate For Treatment For Overactive Bladder – Pfizer To Acquire Exclusive Worldwide Rights| date=17 April 2006| publisher=]| access-date=2 November 2007| archive-date=16 May 2011| archive-url=https://web.archive.org/web/20110516020517/http://www.medicalnewstoday.com/articles/41688.php| url-status=dead}}</ref> It was approved by the ] in April 2007,<ref>{{cite web |url= http://www.emea.europa.eu/humandocs/Humans/EPAR/toviaz/toviaz.htm |title=Toviaz: European Public Assessment Report, Revision 3 - Published 02/06/08 |date=2 June 2008 |publisher=] |url-status=dead |archive-url=https://web.archive.org/web/20080401005811/http://www.emea.europa.eu/humandocs/Humans/EPAR/toviaz/toviaz.htm |archive-date=2008-04-01 }}</ref> the US ] on October 31, 2008 <ref>{{cite press release |
|
|
| title = Pfizer's Toviaz (fesoterodine fumarate) Receives FDA Approval for the Treatment of Overactive Bladder |
|
|
| publisher = Pfizer Inc. |
|
|
| date = 2008-10-31 |
|
|
| url = https://www.drugs.com/newdrugs/pfizer-s-toviaz-fesoterodine-fumarate-receives-fda-approval-overactive-bladder-1167.html |
|
|
| access-date = 2008-11-06 |
|
|
| archive-date = 2018-09-20 |
|
|
| archive-url = https://web.archive.org/web/20180920075736/https://www.drugs.com/newdrugs/pfizer-s-toviaz-fesoterodine-fumarate-receives-fda-approval-overactive-bladder-1167.html |
|
|
| url-status = live |
|
|
}}</ref> and ] on February 9, 2012.<ref>{{Cite web |url=http://www.hc-sc.gc.ca/dhp-mps/prodpharma/sbd-smd/drug-med/nd_ad_2012_toviaz_142326-eng.php |title=Notice of Decision for TOVIAZ |access-date=2012-04-20 |archive-url=https://web.archive.org/web/20120423124138/http://www.hc-sc.gc.ca/dhp-mps/prodpharma/sbd-smd/drug-med/nd_ad_2012_toviaz_142326-eng.php |archive-date=2012-04-23 |url-status=dead }}</ref> |
|
|
|
|
|
Fesoterodine is a ]. It is broken down into its active metabolite, ], by plasma ]s. |
|
|
|
|
|
==Efficacy== |
|
|
Fesoterodine has the advantage of allowing more flexible dosage than other ].<ref name="Vella2011">{{cite journal | vauthors = Vella M, Cardozo L | title = Review of fesoterodine | journal = Expert Opinion on Drug Safety | volume = 10 | issue = 5 | pages = 805–8 | date = September 2011 | pmid = 21639817 | doi = 10.1517/14740338.2011.591377 | s2cid = 9653506 }}</ref> Its tolerability and side effects are similar to other muscarinic antagonists and as a new drug seems unlikely to make great changes in practices of treatment for overactive bladder.<ref name="Vella2011"/> |
|
|
|
|
|
A Japanese study from 2017, showed that urgency and urge incontinence are improved after 3 days administration of the drug, with full efficacy able to be judged after 7 days administration. Overactive bladder was found to be resolved in 88% of patients after seven days usage. <ref> "{{cite journal | vauthors = Sato N, Fuji K, Ogawa Y | doi = 10.15369/sujms.29.201| title = Transactions of The Showa University Society: The 335th Meeting| journal = The Showa University Journal of Medical Sciences| volume = 29| issue = 2| pages = 201–217 |
|
|
| year = 2017 |issn=2185-0968| doi-access = free}}</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Urologicals}} |
|
|
{{Muscarinic acetylcholine receptor modulators}} |
|
|
{{Portal bar | Medicine}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{genito-urinary-drug-stub}} |