| Revision as of 15:05, 17 August 2011 editLamro (talk | contribs)Autopatrolled, Extended confirmed users84,272 edits links← Previous edit |
Latest revision as of 10:30, 23 December 2024 edit undoCitation bot (talk | contribs)Bots5,431,856 edits Add: issue, pmid. | Use this bot. Report bugs. | Suggested by Graeme Bartlett | #UCB_toolbar |
| (21 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 396472465 |
|
| verifiedrevid = 445345071 |
|
| Name = Flavan-4-ol |
|
| Name = Flavan-4-ol |
|
| ImageFile = Flavan-4-ol.PNG |
|
| ImageFile = Flavan-4-ol.svg |
|
⚫ |
| ImageName = Chemical structure of flavan-4-ol |
|
| ImageSize = 200px |
|
|
|
| ImageFile2 = Flavan-4-ol 3D BS.png |
| ⚫ |
| ImageName = Chemical structure of flavan-4-ol |
|
|
|
| ImageName2 = Chemical structure of flavan-4-ol in ball-and-stick model |
|
| IUPACName = 2-phenylchroman-4-ol |
|
| IUPACName = Flavan-4-ol |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| SystematicName = 2-Phenyl-3,4-dihydro-2''H''-1-benzopyran-4-ol |
| ⚫ |
| CASNo = |
|
|
|
| OtherNames = 2-Phenylchroman-4-ol |
| ⚫ |
| PubChem = 439712 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
| SMILES = |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = 487-25-2 |
|
|
| ChemSpiderID = 222586 |
|
⚫ |
| PubChem = 253959 |
|
|
| StdInChI=1S/C15H14O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-9,13,15-16H,10H2 |
|
|
| StdInChIKey = YTMFRMLVZQOBDR-UHFFFAOYSA-N |
|
|
| SMILES = C1C(C2=CC=CC=C2OC1C3=CC=CC=C3)O |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=15 | H=14 | O=2 |
|
| Formula = C<sub>15</sub>H<sub>14</sub>O<sub>2</sub> |
|
|
⚫ |
| Density = <!-- g/cm<sup>3</sup> --> |
|
| MolarMass = 226.27 g/mol |
|
|
⚫ |
| MeltingPt = <!-- °C --> |
|
| ExactMass = 226.09938 u |
|
|
⚫ |
| BoilingPt = |
| ⚫ |
| Density = <!-- g/cm<sup>3</sup> --> |
|
| ⚫ |
| MeltingPt = <!-- °C --> |
|
| ⚫ |
| BoilingPt = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
The '''flavan-4-ols''' (3-deoxyflavonoids) are ]-derived ]s and a family of flavonoids. Flavan-4-ols are colorless precursor compounds that polymerize to form red ] pigments<ref>Styles and Ceska, 1977</ref>. They can be found in the sorghum<ref>. Glycosides (abacopterins ], ], ] and ] together with ] and ]) can be isolated from a ] extract of the rhizomes of '']''<ref>Flavan-4-ol Glycosides from the Rhizomes of Abacopteris penangiana. Zhao Zhongxiang, Ruan Jinlan, Jin Jing, Zou Jian, Zhou Daonian, Fang Wei and Zeng Fanbo, J. Nat. Prod., 2006, 69 (2), pp 265–268 {{DOI|10.1021/np050191p}}</ref>. |
|
The '''flavan-4-ols''' (3-deoxyflavonoids) are ]-derived ]s and a family of flavonoids. Flavan-4-ols are colorless precursor compounds that polymerize to form red ] pigments.<ref>Styles, E. D., & Ceska, O. (1977). The genetic control of flavonoid synthesis in maize. Canadian Journal of Genetics and Cytology, 19(2), 289–302. {{doi|10.1139/g77-032}}</ref> They can be found in the sorghum.<ref>{{cite journal|doi=10.1021/jf00006a035 | volume=39 | issue=6 | title=Flavan-4-ol concentration in leaf tissues of grain mold susceptible and resistant sorghum plants at different stages of leaf development | year=1991 | journal=Journal of Agricultural and Food Chemistry | pages=1163–1165 | last1 = Jambunathan | first1 = Ramamurthi | last2 = Kherdekar | first2 = Milind S.| url=http://oar.icrisat.org/2826/1/JA_1079.pdf }}</ref> Glycosides (abacopterins ], ], ] and ] together with ] and ]) can be isolated from a ] extract of the rhizomes of '']''.<ref>{{cite journal | doi = 10.1021/np050191p | volume=69 | issue=2 | title=Flavan-4-ol Glycosides from the Rhizomes of Abacopteris p enangiana | year=2006 | journal=Journal of Natural Products | pages=265–268 | last1 = Zhao | first1 = Zhongxiang| pmid=16499328 }}</ref> |
|
|
|
|
|
==Known flavan-4-ols== |
|
==Known flavan-4-ols== |
| Line 28: |
Line 33: |
|
|
|
|
|
==Metabolism== |
|
==Metabolism== |
|
] is an enzyme that uses (2S)-flavan-4-ol and NADP<sup>+</sup> to produce (2S)-], NADPH, and H<sup>+</sup>. |
|
] is an enzyme that uses (2''S'')-flavan-4-ol and NADP<sup>+</sup> to produce (2''S'')-], NADPH, and H<sup>+</sup>. |
|
|
|
|
|
==Spectral datas== |
|
==Spectral data== |
|
These compounds have absorption maxima of 564 nm<ref>. |
|
These compounds have absorption maxima of 564 nm.<ref>{{cite journal | doi = 10.1534/genetics.108.097170 | title = Progressive Loss of DNA Methylation Releases Epigenetic Gene Silencing from a Tandemly Repeated Maize Myb Gene | journal = Genetics | volume = 181 | pages = 81–91 | year = 2009 | last1 = Sekhon | first1 = Rajandeep S. | last2 = Chopra | first2 = Surinder | issue = 1 | pmid = 19001287 | pmc = 2621191 }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 39: |
Line 44: |
|
{{flavan-4ol}} |
|
{{flavan-4ol}} |
|
|
|
|
|
] |
|
] |
|
] |
|
|
|
|
|
{{Natural-phenol-stub}} |
|