| Revision as of 07:50, 2 June 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to verified fields - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi← Previous edit |
Latest revision as of 11:40, 23 December 2024 edit undoGraeme Bartlett (talk | contribs)Administrators250,229 edits more ids |
| (46 intermediate revisions by 33 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 407703993 |
|
| verifiedrevid = 432136847 |
|
|ImageFile=Flocoumafen.png |
|
| ImageFile=Flocoumafen.svg |
|
|ImageSize= |
|
| ImageSize= |
|
|IUPACName= 2-hydroxy- 3- methoxy) phenyl]- 1,2,3,4- tetrahydronaphthalen- 1-yl] chromen- 4-one |
|
| IUPACName= 2-Hydroxy-3-methoxy)phenyl]-1,2,3,4-tetrahydronaphthalen-1-yl] chromen-4-one |
|
|OtherNames= |
|
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=90035-08-8 |
|
| CASNo=90035-08-8 |
| ⚫ |
| PubChem=91748 |
|
|
|
| ChEBI = 81894 |
| ⚫ |
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
|
| ChemSpiderID = 10469214 |
|
|
| EC_number = 618-367-6 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 2Z80062XQ4 |
|
⚫ |
| PubChem=54698175 |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C18696 |
|
| KEGG = C18696 |
|
|
| UNNumber = 3027 |
|
| SMILES=C1C(CC2=CC=CC=C2C1C3=C(OC4=CC=CC=C4C3=O)O)C5=CC=C(C=C5)OCC6=CC=C(C=C6)C(F)(F)F |
|
|
|
| SMILES = O=c1oc2ccccc2c(O)c1C1CC(c2ccc(OCc3ccc(C(F)(F)F)cc3)cc2)Cc2ccccc21 |
|
|
| StdInChI = 1S/C33H25F3O4/c34-33(35,36)24-13-9-20(10-14-24)19-39-25-15-11-21(12-16-25)23-17-22-5-1-2-6-26(22)28(18-23)30-31(37)27-7-3-4-8-29(27)40-32(30)38/h1-16,23,28,37H,17-19H2 |
|
|
| StdInChIKey = KKBGNYHHEIAGOH-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=33 | H=25 | F=3 | O=4 |
|
| Formula=C<sub>33</sub>H<sub>25</sub>F<sub>3</sub>O<sub>4</sub> |
|
|
|
| Appearance= |
|
| MolarMass=542.54441 |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Flocoumafen''' is a second generation ] used as a ]. It has a very high toxicity and is restricted to indoor use and sewers (in the UK). This restriction is mainly due to the increased risk to non-target species. Studies have shown that rodents resistant to first generation anticoagulants, can be adequately controlled with Flocoumafen. |
|
'''Flocoumafen''' is a fluorinated, second-generation ] of the ] ] type.<ref name=Watt>{{cite journal | doi = 10.2165/00139709-200524040-00005 | title = Anticoagulant Rodenticides | date = 2005 | last1 = Watt | first1 = Barbara E. | last2 = Proudfoot | first2 = Alex T. | last3 = Bradberry | first3 = Sally M. | last4 = Vale | first4 = J Allister | journal = Toxicological Reviews | volume = 24 | issue = 4 | pages = 259–269 | pmid = 16499407 }}</ref> It is a second generation (i.e., high potency) chemical in this class, used commercially as a ]. It has a very high toxicity and is restricted to indoor use and sewers (in the UK). This restriction is mainly due to the increased risk to non-target species, especially due to its tendency to bio-accumulate in exposed organisms. Studies have shown that rodents resistant to first-generation anticoagulants can be adequately controlled with flocoumafen.<ref name=Watt/> It was synthesized in 1984 by ].<ref name ="NeW"></ref> |
|
|
|
|
|
== Toxicity == |
|
|
In most rodents, the {{LD50}} is 1 mg/kg, but it can vary between species: from 0.12 mg/kg in the ] (''Microtus arvalis'') to more than 10 mg/kg in the ] (''Acomys cahirinus''). For dogs the LD<sub>50</sub> is 0.075-0.25 mg/kg.<ref name ="NeW"/> |
|
|
|
|
|
== Antidote == |
|
|
The ] to flocoumafen is ], which must be administered over a period of several weeks or even months.<ref>{{cite web | url = https://pubchem.ncbi.nlm.nih.gov/compound/Flocoumafen#section=Antidote-and-Emergency-Treatment&fullscreen=true | work = ] | title = Flocoumafen: Antidote and Emergency Treatment }}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
== External links == |
|
|
* |
|
|
|
|
|
{{rodenticides}} |
|
{{rodenticides}} |
|
|
|
|
|
] |
|
] |
| ⚫ |
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
|
|
⚫ |
] |
|
{{ketone-stub}} |
|