Revision as of 09:34, 2 December 2010 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi← Previous edit |
Latest revision as of 13:05, 16 February 2023 edit undoShinkolobwe (talk | contribs)Extended confirmed users, Pending changes reviewers18,778 edits →References: New section: == See also == |
(12 intermediate revisions by 11 users not shown) |
Line 1: |
Line 1: |
|
|
{{distinguish|Fluorene|Fluorenone|Fluorine}} |
|
:''Not to be confused with ], ], or ].'' |
|
|
{{Chembox |
|
{{Chembox |
|
| verifiedrevid = 400094341 |
|
| verifiedrevid = 400095481 |
|
| ImageFile = Fluorone.png |
|
| ImageFile = Fluorone.png |
|
|
| ImageAlt = Skeletal formula |
|
| ImageSize = 200px |
|
|
|
| ImageFile1 = Fluorone-3D-balls.png |
⚫ |
| IUPACName = Xanthen-3-one |
|
|
|
| ImageAlt1 = Ball-and-stick model |
|
⚫ |
| PIN = 3''H''-Xanthen-3-one |
|
| OtherNames = 3-Isoxanthone; 3-Oxo-3''H''-xanthene |
|
| OtherNames = 3-Isoxanthone; 3-Oxo-3''H''-xanthene |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 9507995 |
|
| ChemSpiderID = 9507995 |
|
| InChI = 1/C13H8O2/c14-11-6-5-10-7-9-3-1-2-4-12(9)15-13(10)8-11/h1-8H |
|
| InChI = 1/C13H8O2/c14-11-6-5-10-7-9-3-1-2-4-12(9)15-13(10)8-11/h1-8H |
Line 15: |
Line 17: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = FRIPRWYKBIOZJU-UHFFFAOYSA-N |
|
| StdInChIKey = FRIPRWYKBIOZJU-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 494-41-7 |
|
| CASNo = 494-41-7 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| PubChem = 11333049 |
|
|
|
| UNII = 7X94VF2YWN |
|
| SMILES = O=C/2/C=C\C1=C\c3c(O/C1=C\2)cccc3 |
|
|
⚫ |
| PubChem = 11333049 |
⚫ |
}} |
|
|
|
| SMILES = O=C1C=CC2=Cc3ccccc3OC2=C1 |
⚫ |
| Section2 = {{Chembox Properties |
|
|
⚫ |
}} |
|
| C=13 | H=8 | O=2 |
|
|
⚫ |
|Section2={{Chembox Properties |
|
| Appearance = |
|
|
| Density = |
|
| C=13 | H=8 | O=2 |
|
| MeltingPt = |
|
| Appearance = |
|
| BoilingPt = |
|
| Density = |
|
| Solubility = }} |
|
| MeltingPt = |
|
|
| BoilingPt = |
⚫ |
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
| Solubility = |
|
|
}} |
⚫ |
| FlashPt = |
|
|
⚫ |
|Section3={{Chembox Hazards |
|
| Autoignition = }} |
|
|
|
| MainHazards = |
|
⚫ |
| FlashPt = |
|
|
| AutoignitionPt = |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Fluorone''' is a ] chemical compound. It forms the core structure for various chemicals, most notably fluorone ]s,<ref>{{cite journal | doi = 10.1021/jo00042a020 | author = Shi, Jianmin; Zhang, Xianping; Neckers, Douglas C | title = Xanthenes: fluorone derivatives | journal = ] | year = 1992 | volume = 57 | issue = 16 | pages = 4418–4421}}</ref> including ]. It is an ] of ], sometimes referred to as an isoxanthone. |
|
'''Fluorone''' is a ] chemical compound. It forms the core structure for various chemicals, most notably fluorone ]s,<ref>{{cite journal | doi = 10.1021/jo00042a020 |author1=Shi, Jianmin |author2=Zhang, Xianping |author3=Neckers, Douglas C | title = Xanthenes: fluorone derivatives | journal = ] | year = 1992 | volume = 57 | issue = 16 | pages = 4418–4421}}</ref> including ], ] and ]. It is an ] of ], sometimes referred to as an isoxanthone. |
|
|
|
|
|
]]]{{clear-left}} |
|
]]]{{clear left}} |
|
|
|
|
|
==References== |
|
== See also == |
|
|
* ] |
|
{{reflist}} |
|
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
] |
Line 43: |
Line 53: |
|
|
|
|
|
{{Heterocyclic-stub}} |
|
{{Heterocyclic-stub}} |
|
|
|
|
] |
|
|
] |
|