| Revision as of 17:52, 9 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_P← Previous edit |
Latest revision as of 09:38, 5 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,127 edits removed Category:Fluoroarenes; added Category:4-Fluorophenyl compounds using HotCat |
| (21 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
⚫ |
| verifiedrevid = 443906983 |
| ⚫ |
| UNII = U4K85O58HD |
|
| ⚫ |
| verifiedrevid = 437201134 |
|
|
| IUPAC_name = 4-(4-fluorophenyl)-7-methyl-1-propan-2-ylquinazolin-2-one |
|
| IUPAC_name = 4-(4-fluorophenyl)-7-methyl-1-propan-2-ylquinazolin-2-one |
|
| image = Fluproquazone.svg |
|
| image = Fluproquazone.svg |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 40507-23-1 |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| PubChem = 38503 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 35289 |
|
| ChemSpiderID = 35289 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| InChI = 1/C18H17FN2O/c1-11(2)21-16-10-12(3)4-9-15(16)17(20-18(21)22)13-5-7-14(19)8-6-13/h4-11H,1-3H3 |
|
|
⚫ |
| UNII = U4K85O58HD |
|
| InChIKey = ZWOUXWWGKJBAHQ-UHFFFAOYAQ |
|
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = D04229 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=18 | H=17 | F=1 | N=2 | O=1 |
|
| smiles = Fc3ccc(C/1=N/C(=O)N(c2cc(ccc\12)C)C(C)C)cc3 |
|
| smiles = Fc3ccc(C/1=N/C(=O)N(c2cc(ccc\12)C)C(C)C)cc3 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 14: |
Line 37: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ZWOUXWWGKJBAHQ-UHFFFAOYSA-N |
|
| StdInChIKey = ZWOUXWWGKJBAHQ-UHFFFAOYSA-N |
| ⚫ |
| CAS_number = 40507-23-1 |
|
| ⚫ |
| ATC_prefix = none |
|
|
| ATC_suffix = |
|
|
| ATC_supplemental = |
|
| ⚫ |
| PubChem = 38503 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| ⚫ |
| KEGG = D04229 |
|
| ⚫ |
| C=18 | H=17 | F=1 | N=2 | O=1 |
|
|
| molecular_weight = 296.339 g/mol |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| pregnancy_category = |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''Fluproquazone''' (trade name '''Tormosyl''') is a ] derivative with potent ]<ref>Mohing W, Suckert R, Lataste X. Comparative study of fluproquazone in the management of post-operative pain. ''Arzneimittelforschung''. 1981;31(5a):918-20.</ref><ref>Wheatley D. Analgesic properties of fluproquazone. ''Rheumatology and Rehabilitation''. 1982 May;21(2):98-100.</ref> and ]<ref>Fankhauser S, Laube W, Marti HR, Schultheiss HR, Vogtlin J, von Graffenried B. Antipyretic activity of fluproquazone in man. ''Arzneimittelforschung''. 1981;31(5a):934-5.</ref> effects and also ] action. It has been shown to be effective in a variety of animal species after both ] administration, and has a duration of action of several hours. The compound is many times more potent than ] and clinically generally resembles ] and ] in its pharmacological effects, but with significantly less ] activity.<ref>Gillberg R, Korsan-Bengtsen K, Magnusson B, Nyberg G. Gastrointestinal blood loss, gastroscopy and coagulation factors in normal volunteers during administration of acetylsalicylic acid and fluproquazone. ''Scandinavian Journal of Rheumatology''. 1981;10(4):342-6.</ref> It is mainly used in the treatment of ]<ref>Huskisson EC, Bryans R, Scott J. Fluproquazone for osteoarthritis. ''Rheumatology and Rehabilitation''. 1981 May;20(2):122-4.</ref> and post-operative pain.<ref>Haanaes HR, Benterud UJ, Skoglund LA. RF 46-790 versus paracetamol: effect on post-operative pain. ''International Journal of Clinical Pharmacology, Therapy, and Toxicology''. 1986 Nov;24(11):598-601.</ref> |
|
'''Fluproquazone''' (trade name '''Tormosyl''', '''RF 46-790''' ) was a ] derivative with potent ], ], and ] effects discovered by ].<ref>{{cite journal | vauthors = Haanaes HR, Benterud UJ, Skoglund LA | title = RF 46-790 versus paracetamol: effect on post-operative pain | journal = International Journal of Clinical Pharmacology, Therapy, and Toxicology | volume = 24 | issue = 11 | pages = 598–601 | date = November 1986 | pmid = 3491794 }}</ref><ref name="pmid6973986">{{cite journal | vauthors = Mohing W, Suckert R, Lataste X | title = Comparative study of fluproquazone in the management of post-operative pain | journal = Arzneimittel-Forschung | volume = 31 | issue = 5a | pages = 918–20 | date = 1981 | pmid = 6973986 }}</ref><ref name="pmid7043713">{{cite journal | vauthors = Wheatley D | title = Analgesic properties of fluproquazone | journal = Rheumatology and Rehabilitation | volume = 21 | issue = 2 | pages = 98–100 | date = May 1982 | pmid = 7043713 | doi = 10.1093/rheumatology/21.2.98}}</ref><ref name="pmid6973990">{{cite journal | vauthors = Fankhauser S, Laube W, Marti HR, Schultheiss HR, Vögtlin J, von Graffenried B | title = Antipyretic activity of fluproquazone in man | journal = Arzneimittel-Forschung | volume = 31 | issue = 5a | pages = 934–5 | date = 1981 | pmid = 6973990 }}</ref> It was withdrawn during development due to ].<ref>{{cite book | vauthors = Lewis JH, Stine JG | chapter = Nonsteroidal Antiinflammatory Drugs and Leukotriene Receptor Antagonists | title = Drug-induced Liver Disease | edition = third | veditors = Kaplowitz N, DeLeve LD | publisher = Elsevier Inc | date = 2013 | isbn = 9780123878175 }}</ref>{{rp|370}}<ref>{{cite book | vauthors = Zimmerman HJ | title = Hepatotoxicity: The Adverse Effects of Drugs and Other Chemicals on the Liver | publisher = Lippincott Williams & Wilkins | date = 1999 | isbn = 9780781719520 }}</ref>{{rp|520}} |
|
==Chemistry== |
|
|
] |
|
|
|
|
|
|
Lindler, J.; Mattner, P. G.; Salmond, W. G.; 1973, {{US Patent|3759920}}. |
|
|
== References == |
|
== References == |
|
|
{{Reflist}} |
|
<references /> |
|
|
|
|
|
|
{{NSAIDs}} |
|
{{NSAIDs}} |
|
|
{{Prostanoidergics}} |
|
|
|
|
|
] |
|
] |
| ⚫ |
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
⚫ |
] |
|
|
] |
|
|
|
|
|
{{musculoskeletal-drug-stub}} |