| Revision as of 16:35, 18 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 03:53, 19 August 2022 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,990 editsm Added UNII |
| (16 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 383271784 |
|
| verifiedrevid = 424708869 |
|
|ImageFile=Fumarylacetoacetic acid.svg |
|
| ImageFile=Fumarylacetoacetic acid.svg |
|
|ImageSize= |
|
| ImageSize= |
|
|IUPACName=(''E'')-4,6-dioxooct-2-enedioic acid |
|
| PIN=(2''E'')-4,6-Dioxooct-2-enedioic acid |
|
|OtherNames= |
|
| OtherNames= |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=28613-33-4 |
|
| CASNo=28613-33-4 |
| ⚫ |
| PubChem=5280398 |
|
|
|
| CASNo1_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| SMILES=C(C(=O)CC(=O)O)C(=O)C=CC(=O)O |
|
|
|
| CASNo1 = 5698-51-1 |
| ⚫ |
| MeSHName=Fumarylacetoacetate |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = FM3BV7K438 |
|
⚫ |
| PubChem=5280398 |
|
|
| ChemSpiderID = 4444081 |
|
⚫ |
| SMILES = O=C(\C=C\C(=O)O)CC(=O)CC(=O)O |
|
|
| InChI = 1/C8H8O6/c9-5(1-2-7(11)12)3-6(10)4-8(13)14/h1-2H,3-4H2,(H,11,12)(H,13,14)/b2-1+ |
|
|
| InChIKey = GACSIVHAIFQKTC-OWOJBTEDBU |
|
|
| StdInChI = 1S/C8H8O6/c9-5(1-2-7(11)12)3-6(10)4-8(13)14/h1-2H,3-4H2,(H,11,12)(H,13,14)/b2-1+ |
|
|
| StdInChIKey = GACSIVHAIFQKTC-OWOJBTEDSA-N |
|
⚫ |
| MeSHName=Fumarylacetoacetate |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=8 | H=8 | O=6 |
|
| Formula=C<sub>8</sub>H<sub>8</sub>O<sub>6</sub> |
|
|
|
| Appearance= |
|
| MolarMass=200.146 g/mol |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
'''Fumarylacetoacetate''' is an intermediate in the metabolism of ]. |
|
|
|
'''Fumarylacetoacetic acid''' ('''fumarylacetoacetate''') is an intermediate in the metabolism of ]. It is formed through the conversion of ] into fumarylacetoacetate by the enzyme ].<ref>{{cite journal | journal = Biochem. J. | year = 1951 | volume = 49 | pages = 686–693 | title = The oxidation in liver of l-tyrosine to acetoacetate through p-hydroxyphenylpyruvate and homogentisic acid | author = W. E. Knox and M. LeMay-Knox | issue = 5 | doi = 10.1042/bj0490686 | pmid = 14886367 | pmc = 1197578 | url = http://www.biochemj.org/bj/049/bj0490686.htm}}</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
|
* ] |
|
* ] |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
{{alkene-stub}} |
|
|
|
|
{{biochem-stub}} |
|
{{biochem-stub}} |
|
|
|
|
] |
|