| Revision as of 15:32, 18 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 09:27, 25 June 2022 edit undoBrownHairedGirl (talk | contribs)Autopatrolled, Extended confirmed users, File movers, Pending changes reviewers, Rollbackers2,942,733 edits Cleanup 1 reference: convert <ref>URL {{webarchive}}</ref> to <ref>{{cite web}}</ref>. NB: title etc is missing, and will display error msgTag: AWB |
| (11 intermediate revisions by 9 users not shown) |
| Line 1: |
Line 1: |
|
{{Unreferenced|date=July 2009}} |
|
|
|
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 398134427 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Gallacetophenone.gif |
|
|
⚫ |
| verifiedrevid = 424700194 |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile=Gallacetophenone.svg |
|
|IUPACName=1-(2,3,4-trihydroxyphenyl)ethanone |
|
|
⚫ |
| ImageSize=200px |
| ⚫ |
|OtherNames=Alizarin Yellow C; Galloacetophenone; 2',3',4'-Trihydroxyacetophenone |
|
|
|
| PIN = 1-(2,3,4-Trihydroxyphenyl)ethan-1-one |
|
⚫ |
| OtherNames = 1-(2,3,4-Trihydroxyphenyl)ethanone<br />Alizarin Yellow C<br />Galloacetophenone<br />2',3',4'-Trihydroxyacetophenone |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=528-21-2 |
|
| CASNo=528-21-2 |
| ⚫ |
| PubChem=10706 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| SMILES=CC(=O)C1=C(C(=C(C=C1)O)O)O |
|
|
|
| UNII = C70E921C4P |
|
⚫ |
| PubChem = 10706 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 10256 |
|
|
| SMILES = O=C(c1c(O)c(O)c(O)cc1)C |
|
|
| InChI = 1/C8H8O4/c1-4(9)5-2-3-6(10)8(12)7(5)11/h2-3,10-12H,1H3 |
|
|
| InChIKey = XIROXSOOOAZHLL-UHFFFAOYAA |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C8H8O4/c1-4(9)5-2-3-6(10)8(12)7(5)11/h2-3,10-12H,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = XIROXSOOOAZHLL-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=8 | H=8 | O=4 |
|
| Formula=C<sub>8</sub>H<sub>8</sub>O<sub>4</sub> |
|
|
|
| Appearance= |
|
| MolarMass=168.15 g/mol |
|
|
| Appearance= |
|
| Density= |
|
|
| MeltingPtC=171 to 172 |
|
| Density= |
|
|
|
| BoilingPt= |
|
| MeltingPt=171-172 C |
|
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Gallacetophenone''' is the ] derivative of ]. It is from pyrogallol using ] and ]. |
|
'''Gallacetophenone''' is the ] derivative of ]. It can be synthesized from pyrogallol using ] and ].<ref>{{cite web |url=http://talkchem.com/synthetic-chemistry/gallacetophenone-synthesis-synthesis-of-gallacetophenone.html |title= |website=talkchem.com |archive-url=https://web.archive.org/web/20100116013814/http://talkchem.com/synthetic-chemistry/gallacetophenone-synthesis-synthesis-of-gallacetophenone.html |archive-date=January 16, 2010}}</ref> |
|
|
|
|
|
|
==References== |
|
==Properties and Uses== |
|
|
|
{{reflist}} |
|
Antiseptic; skin affections (psoriasis, etc.), in 10 p. c. solutions or ointments, being a good substitute for pyrogallol, as it does not stain nor poison so easily. |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Ketone-stub}} |
|
{{Ketone-stub}} |