Revision as of 12:09, 24 July 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm Gallagyldilactone; Terminalin← Previous edit |
Latest revision as of 07:50, 28 December 2024 edit undoGraeme Bartlett (talk | contribs)Administrators249,752 edits more ids; see also to related, as nothing to see |
(14 intermediate revisions by 11 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 414204628 |
|
| verifiedrevid = 441161150 |
|
| Name = Gallagic acid |
|
| Name = Gallagic acid |
|
| ImageFile = Gallagic acid.PNG |
|
| ImageFile = Gallagic acid.svg |
|
| ImageSize = 200px |
|
|
| ImageName = Chemical structure of gallagic acid |
|
| ImageName = Chemical structure of gallagic acid |
|
|
| PIN = 2,2′-(1,2,6,7-Tetrahydroxy-4,9-dioxo-4,9-dihydro-benzopyranobenzopyran-3,8-diyl)bis(3,4,5-trihydroxybenzoic acid) |
|
| IUPACName = |
|
|
| OtherNames = <!-- <br> --> |
|
| OtherNames = <!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 65995-62-2 |
|
| CASNo = 65995-62-2 |
|
|
| ChemSpiderID = 57568038 |
|
| CASNo_Ref = |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| CASOther = |
|
|
| PubChem = |
|
| UNII = TSN85LPS4R |
|
|
| PubChem = 14754405 |
|
|
| StdInChI=1S/C28H14O18/c29-5-1-3(25(39)40)7(17(33)15(5)31)9-13-11-12-14(28(44)46-23(11)21(37)19(9)35)10(20(36)22(38)24(12)45-27(13)43)8-4(26(41)42)2-6(30)16(32)18(8)34/h1-2,29-38H,(H,39,40)(H,41,42) |
|
|
| StdInChIKey = ZASJRRFAYSNSHU-UHFFFAOYSA-N |
|
| SMILES = Oc4c6c1c(c5c(=O)o6)c(oc(=O)c1c(c4O)-c(c(O)c2O)c(C(O)=O)cc2O)c(O)c(O)c5-c3c(C(O)=O)cc(O)c(O)c3O |
|
| SMILES = Oc4c6c1c(c5c(=O)o6)c(oc(=O)c1c(c4O)-c(c(O)c2O)c(C(O)=O)cc2O)c(O)c(O)c5-c3c(C(O)=O)cc(O)c(O)c3O |
|
| InChI = |
|
| InChI = |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>28</sub>H<sub>14</sub>O<sub>18</sub> |
|
| Formula = C<sub>28</sub>H<sub>14</sub>O<sub>18</sub> |
|
| MolarMass = 638.39 g/mol |
|
| MolarMass = 638.39 g/mol |
|
| ExactMass = 638.018013 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
|
|Section8={{Chembox Related |
⚫ |
}} |
|
|
⚫ |
| OtherCompounds = ]; ]; ] |
⚫ |
'''Gallagic acid''' is a polyphenolic chemical compound that can be found in the ellagitannins, a type of tannin, found in '']'' (pomegranate).<ref>Antioxidant, antimalarial and antimicrobial activities of tannin-rich fractions, ellagitannins and phenolic acids from Punica granatum L. Reddy Muntha K., Gupta Sashi K., Jacob Melissa R., Khan Shabana I. and Ferreira Daneel, Planta medica, 2007, vol. 73, no5, pp. 461-467, {{INIST|18773247}}</ref> It is a building block of the corresponding tannin ], ], ] and ]. |
|
|
⚫ |
}} |
|
|
}} |
|
⚫ |
'''Gallagic acid''' is a polyphenolic chemical compound that can be found in the ellagitannins, a type of tannin, found in '']'' (pomegranate).<ref>Antioxidant, antimalarial and antimicrobial activities of tannin-rich fractions, ellagitannins and phenolic acids from Punica granatum L. Reddy Muntha K., Gupta Sashi K., Jacob Melissa R., Khan Shabana I. and Ferreira Daneel, Planta medica, 2007, vol. 73, no5, pp. 461-467, {{INIST|18773247}}</ref> It is a building block of the corresponding tannin ], ], ] and ]. |
|
|
|
|
|
==See also== |
|
⚫ |
* ] (a.k.a. ] or ]) |
|
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{Ellagitannin}} |
|
{{Ellagitannin}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
{{natural-phenol-stub}} |
|
{{aromatic-stub}} |