Revision as of 03:17, 7 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to verified fields - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drugbox validation← Previous edit |
Latest revision as of 15:22, 9 December 2024 edit undoCitation bot (talk | contribs)Bots5,460,523 edits Added date. | Use this bot. Report bugs. | Suggested by Dominic3203 | Linked from User:Marbletan/sandbox | #UCB_webform_linked 61/2664 |
(43 intermediate revisions by 29 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 443977394 |
⚫ |
| UNII = V72H9867WB |
|
|
⚫ |
| IUPAC_name = 1-Cyclopropyl-8-(difluoromethoxy)-7--4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
⚫ |
| verifiedrevid = 407869175 |
|
|
⚫ |
| image = Garenoxacin.svg |
⚫ |
| IUPAC_name = 1-cyclopropyl-8-(difluoromethoxy)-7--4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
|
|
|
|
⚫ |
| image = Garenoxacin.svg |
|
|
|
<!--Clinical data--> |
⚫ |
| CAS_number = 91421-42-0 |
|
|
|
| tradename = |
⚫ |
| ATC_prefix = J01 |
|
⚫ |
| ATC_suffix = MA19 |
|
⚫ |
| PubChem = 124093 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = D04031 |
|
⚫ |
| C = 23 |H = 20 |F = 2 |N = 2 |O = 4 |
|
|
| molecular_weight = 426.412 ]/] |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = Oral |
|
| routes_of_administration = Oral |
⚫ |
}} |
|
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
'''Garenoxacin''' (]) is a quinolone antibiotic for the treatment of gram-positive and gram-negative bacterial infections. |
|
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
|
<!--Identifiers--> |
⚫ |
It was discovered by Toyama Chemical Co., Ltd. of Tokyo, Japan, and is currently being marketed in ] under the tradename Geninax. ] holds worldwide rights for garenoxacin, except for Japan, ], and ]. |
|
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
⚫ |
| CAS_number = 194804-75-6 |
|
⚫ |
| ATC_prefix = J01 |
|
⚫ |
| ATC_suffix = MA19 |
|
⚫ |
| PubChem = 124093 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = V72H9867WB |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = D04031 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 131716 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 110579 |
|
|
| smiles = FC(F)Oc1c(ccc2c1N(/C=C(\C2=O)C(=O)O)C3CC3)c4ccc5c(c4)CN5C |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C23H20F2N2O4/c1-11-15-5-2-12(8-13(15)9-26-11)16-6-7-17-19(21(16)31-23(24)25)27(14-3-4-14)10-18(20(17)28)22(29)30/h2,5-8,10-11,14,23,26H,3-4,9H2,1H3,(H,29,30)/t11-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = NJDRXTDGYFKORP-LLVKDONJSA-N |
|
|
|
|
|
|
<!--Chemical data--> |
⚫ |
On February 13, 2006, Schering-Plough announced that the ] ] has accepted the New Drug Application (NDA) for garenoxacin, and has been granted a 10-month review.<ref>{{cite web |url=http://www.drugs.com/nda/garenoxacin_060213.html |title=Drugs.com, Schering-Plough Reports Garenoxacin NDA Accepted for FDA Review |accessdate=2008-03-25 |format= |work= }}</ref> |
|
|
⚫ |
| C=23 | H=20 | F=2 | N=2 | O=4 |
|
⚫ |
}} |
|
|
|
|
|
|
'''Garenoxacin''' (]) is a ] ] for the treatment of ] and ] bacterial infections.<ref name="pmid18790608">{{cite journal | vauthors = Takagi H, Tanaka K, Tsuda H, Kobayashi H | title = Clinical studies of garenoxacin | journal = International Journal of Antimicrobial Agents | volume = 32 | issue = 6 | pages = 468–74 | date = December 2008 | pmid = 18790608 | doi = 10.1016/j.ijantimicag.2008.06.032 | doi-access = free }}</ref> |
⚫ |
Schering-Plough later withdrew its application to the United States Food and Drug Administration, FDA, (August 20, 2006) for approval of the antibiotic Garenoxacin.<ref>http://www.fiercebiotech.com/story/schering-plough-pulls-its-garenoxacin-app/2006-08-21</ref> |
|
|
|
|
|
|
⚫ |
Garenoxacin was discovered by Toyama Chemical Co., Ltd. of Tokyo, Japan, and is currently being marketed in ] under the tradename Geninax. ] holds worldwide rights for garenoxacin, except for Japan, ], and ].{{cn|date=January 2023}} |
|
The European Medicines Agency (EMEA) had also been formally notified by Schering-Plough Europe (July 28 2007) of its decision to withdraw the application for a centralized marketing authorization for Garenoxacin as well. |
|
|
<ref>http://www.medicalnewstoday.com/articles/78052.php</ref><ref>http://www.emea.europa.eu/humandocs/PDFs/EPAR/garenoxacinmesylate/34117407en.pdf</ref><ref>http://www.emea.europa.eu/humandocs/PDFs/EPAR/garenoxacinmesylate/H-747-WAR.pdf</ref> |
|
|
|
|
|
|
⚫ |
On February 13, 2006, ] announced that the ] ] had accepted the New Drug Application (NDA) for garenoxacin, and had been granted a 10-month review.<ref>{{cite web |url=https://www.drugs.com/nda/garenoxacin_060213.html |title=Drugs.com, Schering-Plough Reports Garenoxacin NDA Accepted for FDA Review |access-date=2008-03-25 }}</ref> As of 2015, however, it has not been approved in the US.{{cn|date=January 2023}} |
|
Based on the CHMP review of the data regarding safety and efficacy, (risk/benefit) the CHMP considered the application for Garenoxacin to be unapprovable. <ref> http://www.emea.europa.eu/humandocs/PDFs/EPAR/garenoxacinmesylate/H-747-WAR.pdf</ref> |
|
|
|
|
|
|
⚫ |
Schering-Plough later withdrew its application to the United States Food and Drug Administration, FDA, (August 20, 2006) for approval of the antibiotic Garenoxacin.<ref>{{Cite web | url=http://www.fiercebiotech.com/story/schering-plough-pulls-its-garenoxacin-app/2006-08-21 | title=Schering-Plough pulls its garenoxacin app| date=20 August 2006}}</ref> |
|
==See also== |
|
|
|
|
|
*] |
|
|
|
The ] (EMA) had also been formally notified by Schering-Plough Europe (July 25, 2007) of its decision to withdraw the application for a centralized marketing authorization for garenoxacin as well.<ref>{{Cite web |url=http://www.medicalnewstoday.com/articles/78052.php |title=Schering-Plough Europe Withdraws Its Marketing Authorisation Application For Garenoxacin Mesylate |access-date=2009-05-30 |archive-date=2007-08-08 |archive-url=https://web.archive.org/web/20070808183432/http://www.medicalnewstoday.com/articles/78052.php |url-status=dead | publisher = MediLexicon International Ltd | date = 28 July 2007 }}</ref><ref>{{cite web | title=Garenoxacin mesylate: Withdrawn application | website=] (EMA) | date=17 September 2018 | url= https://www.ema.europa.eu/en/medicines/human/withdrawn-applications/garenoxacin-mesylate | access-date=13 July 2020}}</ref><ref>{{cite press release | title=Schering-Plough Europe withdraws its marketing authorisation applicationfor Garenoxacin mesylate | website=] (EMA) | url=https://www.ema.europa.eu/en/news/schering-plough-europe-withdraws-its-marketing-authorisation-applicationfor-garenoxacin-mesylate | access-date=13 July 2020}}</ref> Based on the CHMP review of the data regarding safety and efficacy (risk/benefit), the CHMP considered the application for garenoxacin to be unapprovable.<ref>{{cite web | title = Withdrawal Assessment report for Garenoxacin Mesylate (garenoxacin) | url = https://www.ema.europa.eu/en/documents/withdrawal-report/withdrawal-assessment-report-garenoxacin-mesylate_en.pdf | publisher = European Medicines Agency | date = 18 October 2007 }}</ref> |
|
*] |
|
|
|
|
|
|
==References== |
|
==References== |
Line 48: |
Line 61: |
|
{{QuinoloneAntiBiotics}} |
|
{{QuinoloneAntiBiotics}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{antibiotic-stub}} |
|
{{antibiotic-stub}} |
|
|
|
|
] |
|
|
] |
|