| Revision as of 22:17, 19 June 2011 editCitation bot 1 (talk | contribs)Bots130,044 editsm Add: author-separator, author2, author3, display-authors, last4, first4, last5, first5, last6, first6, last7, first7, last8, first8, last9, first9. Tweak: author, pages. Formatted dashes.← Previous edit |
Latest revision as of 14:46, 28 October 2022 edit undoJWBE (talk | contribs)Extended confirmed users10,129 edits removed Category:Furans using HotCat |
| (25 intermediate revisions by 21 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 400101562 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile = Geiparvarin.svg |
|
|
⚫ |
| verifiedrevid = 435168179 |
| ⚫ |
|ImageSize = |
|
|
⚫ |
| ImageFile = Geiparvarin.svg |
| ⚫ |
|IUPACName = 7-{oxy}-2''H''-chromen-2-one |
|
|
⚫ |
| ImageSize = |
| ⚫ |
|OtherNames= |
|
|
⚫ |
| PIN = 7-{oxy}-2''H''-1-benzopyran-2-one |
|
⚫ |
| OtherNames = |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 36413-91-9 |
|
|
| PubChem = 5910585 |
|
| CASNo = 36413-91-9 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES = CC(=CCOC1=CC2=C(C=C1)C=CC(=O)O2)C3=CC(=O)C(O3)(C)C |
|
|
|
| UNII = O0M5JB2L95 |
| ⚫ |
| MeSHName = Geiparvarin |
|
|
|
| PubChem = 5910585 |
| ⚫ |
}} |
|
|
⚫ |
| SMILES = CC(=CCOC1=CC2=C(C=C1)C=CC(=O)O2)C3=CC(=O)C(O3)(C)C |
|
⚫ |
| MeSHName = Geiparvarin |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4743982 |
|
|
| SMILES2 = O=C/3Oc2c(ccc(OC/C=C(/C=1OC(C(=O)C=1)(C)C)C)c2)\C=C\3 |
|
|
| InChI = 1/C19H18O5/c1-12(15-11-17(20)19(2,3)24-15)8-9-22-14-6-4-13-5-7-18(21)23-16(13)10-14/h4-8,10-11H,9H2,1-3H3/b12-8+ |
|
|
| InChIKey = OUTLLBZGJYDUQE-XYOKQWHBBW |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C19H18O5/c1-12(15-11-17(20)19(2,3)24-15)8-9-22-14-6-4-13-5-7-18(21)23-16(13)10-14/h4-8,10-11H,9H2,1-3H3/b12-8+ |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = OUTLLBZGJYDUQE-XYOKQWHBSA-N |
|
⚫ |
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>19</sub>H<sub>18</sub>O<sub>5</sub> |
|
| Formula = C<sub>19</sub>H<sub>18</sub>O<sub>5</sub> |
|
| MolarMass = 326.343 g/mol |
|
| MolarMass = 326.343 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = 1.242 g/mL |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPtC = 533 |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards = |
|
| FlashPt= |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Geiparvarin''' is a ] derivative found in the leaves of the Australian Willow ('']'').<ref>{{cite journal |author=Lahey FN, Macleod JK |title=The coumarins of ''Geijera parviflora'' Lindl |journal=Aust J Chem |volume=20 |issue=9 |pages=1943–55 |month=September |year=1967 |doi=10.1071/CH9671943}}</ref> It is a ].<ref name="pmid12443774">{{cite journal |author=Carotti A |title=Natural and synthetic geiparvarins are strong and selective MAO-B inhibitors. Synthesis and SAR studies |journal=Bioorg. Med. Chem. Lett. |volume=12 |issue=24 |pages=3551–3555 |year=2002 |month=December |pmid=12443774 |doi= 10.1016/S0960-894X(02)00798-9|url=http://linkinghub.elsevier.com/retrieve/pii/S0960894X02007989 |author-separator=, |author2=Carrieri A |author3=Chimichi S |display-authors=3 |last4=Boccalini |first4=M |last5=Cosimelli |first5=B |last6=Gnerre |first6=C |last7=Carotti |first7=A |last8=Carrupt |first8=PA |last9=Testa |first9=B}}</ref> |
|
'''Geiparvarin''' is a ] derivative found in the leaves of the Australian Willow ('']'').<ref>{{cite journal |vauthors=Lahey FN, Macleod JK |title=The coumarins of ''Geijera parviflora'' Lindl |journal=] |volume=20 |issue=9 |pages=1943–55 |date=September 1967 |doi=10.1071/CH9671943}}</ref> It is a ].<ref name="pmid12443774">{{cite journal |author=Carotti A |title=Natural and synthetic geiparvarins are strong and selective MAO-B inhibitors. Synthesis and SAR studies |journal=Bioorg. Med. Chem. Lett. |volume=12 |issue=24 |pages=3551–3555 |date=December 2002 |pmid=12443774 |doi= 10.1016/S0960-894X(02)00798-9|name-list-style=vanc|author2=Carrieri A |author3=Chimichi S |display-authors=3 |last4=Boccalini |first4=M |last5=Cosimelli |first5=B |last6=Gnerre |first6=C |last7=Carotti |first7=A |last8=Carrupt |first8=PA |last9=Testa |first9=B}}</ref> |
|
|
|
|
|
Several ]s of geiparvarin have been studied for antitumor properties.<ref>{{cite journal |author=Baraldi PG, Guarneri M, Manfredini S, Simoni D, Balzarini J, De Clercq E |title=Synthesis and cytostatic activity of geiparvarin analogues |journal=] |volume=32 |issue=2 |pages=284–288 |year=1989 |month=February |pmid=2913291 |doi= 10.1021/jm00122a002|url=}}</ref><ref>{{cite journal |author=Valenti P |title=Synthesis, cytotoxicity and SAR of simple geiparvarin analogues |journal=Anticancer Drug Des |volume=12 |issue=6 |pages=443–51 |year=1997 |month=September |pmid=9311554 |doi= |url= |author-separator=, |author2=Rampa A |author3=Recanatini M |display-authors=3 |last4=Bisi |first4=A |last5=Belluti |first5=F |last6=Da Re |first6=P |last7=Carrara |first7=M |last8=Cima |first8=L}}</ref><ref>{{cite journal |author=Viola G |title=Synthesis, cytotoxicity, and apoptosis induction in human tumor cells by geiparvarin analogues |journal=Chem Biodivers |volume=1 |issue=9 |pages=1265–1280 |year=2004 |month=September |pmid=17191904 |doi=10.1002/cbdv.200490089 |url= |author-separator=, |author2=Vedaldi D |author3=dall'Acqua F |display-authors=3 |last4=Basso |first4=Giuseppe |last5=Disarò |first5=Silvia |last6=Spinelli |first6=Monica |last7=Cosimelli |first7=Barbara |last8=Boccalini |first8=Marco |last9=Chimichi |first9=Stefano}}</ref> |
|
Several ]s of geiparvarin have been studied for antitumor properties.<ref>{{cite journal |vauthors=Baraldi PG, Guarneri M, Manfredini S, Simoni D, Balzarini J, De Clercq E |title=Synthesis and cytostatic activity of geiparvarin analogues |journal=] |volume=32 |issue=2 |pages=284–288 |date=February 1989 |pmid=2913291 |doi= 10.1021/jm00122a002}}</ref><ref>{{cite journal |author=Valenti P |title=Synthesis, cytotoxicity and SAR of simple geiparvarin analogues |journal=Anticancer Drug Des |volume=12 |issue=6 |pages=443–51 |date=September 1997 |pmid=9311554 |name-list-style=vanc|author2=Rampa A |author3=Recanatini M |display-authors=3 |last4=Bisi |first4=A |last5=Belluti |first5=F |last6=Da Re |first6=P |last7=Carrara |first7=M |last8=Cima |first8=L}}</ref><ref>{{cite journal |author=Viola G |title=Synthesis, cytotoxicity, and apoptosis induction in human tumor cells by geiparvarin analogues |journal=Chemistry & Biodiversity |volume=1 |issue=9 |pages=1265–1280 |date=September 2004 |pmid=17191904 |doi=10.1002/cbdv.200490089 |name-list-style=vanc|author2=Vedaldi D |author3=dall'Acqua F |display-authors=3 |last4=Basso |first4=Giuseppe |last5=Disarò |first5=Silvia |last6=Spinelli |first6=Monica |last7=Cosimelli |first7=Barbara |last8=Boccalini |first8=Marco |last9=Chimichi |first9=Stefano|s2cid=22355393 }}</ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{heterocyclic-stub}} |
|
{{heterocyclic-stub}} |
|
{{Natural-phenol-stub}} |
|
{{Aromatic-stub}} |