Revision as of 22:19, 26 December 2010 editYobot (talk | contribs)Bots4,733,870 editsm WP:CHECKWIKI error fixes + general fixes, References after punctuation per WP:REFPUNC and WP:PAIC, added wikify tag using AWB (7510)← Previous edit |
Latest revision as of 03:07, 24 December 2024 edit undoCitation bot (talk | contribs)Bots5,428,472 edits Added bibcode. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | Category:O-methylated flavones | #UCB_Category 15/18 |
(38 intermediate revisions by 26 users not shown) |
Line 1: |
Line 1: |
|
{{Wikify|date=December 2010}} |
|
|
|
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 404360484 |
|
| Name = Genkwanin |
|
| Name = Genkwanin |
|
| ImageFile = Genkwanin.svg |
|
| ImageFile = Genkwanin v2.svg |
|
| ImageSize = 250px |
|
| ImageSize = 200 |
|
| ImageName = Chemical structure of genkwanin |
|
| ImageAlt = Skeletal formula of genkwanin |
|
|
| ImageFile1 = Genkwanin molecule ball.png |
⚫ |
| IUPACName = 5-hydroxy-2-(4-hydroxyphenyl)-7-methoxychromen-4-one |
|
|
|
| ImageSize1 = 220 |
⚫ |
| OtherNames = Gengkwanin<br>Apigenin 7-methyl ether<br>4',5-Dihydroxy-7-methoxyflavone<br>4',5-dihydroxy-7-methoxy flavone<br>5,4'-Dihydroxy-7-methoxyflavone |
|
|
|
| ImageAlt1 = Ball-and-stick model of genkwanin |
⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| IUPACName = 4′,5-Dihydroxy-7-methoxyflavone |
|
⚫ |
| SystematicName = 5-Hydroxy-2-(4-hydroxyphenyl)-7-methoxy-4''H''-1-benzopyran-4-one |
|
⚫ |
| OtherNames = Gengkwanin<br>Apigenin 7-methyl ether<br>4′,5-dihydroxy-7-methoxy flavone<br>5,4′-Dihydroxy-7-methoxyflavone<br>5-Hydroxy-2-(4-hydroxyphenyl)-7-methoxychromen-4-one |
|
⚫ |
|Section1={{Chembox Identifiers |
|
| CASNo = 437-64-9 |
|
| CASNo = 437-64-9 |
|
| CASNo_Ref = |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASOther = |
|
| CASNoOther = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| PubChem = 5281617 |
|
|
|
| UNII = 5K3I5D6B2B |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 210635 |
|
| SMILES = COC1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=C(C=C3)O)O |
|
| SMILES = COC1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=C(C=C3)O)O |
|
| InChI = |
|
| PubChem = 5281617 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4444936 |
|
|
| SMILES2 = COc1cc(c2c(=O)cc(oc2c1)c3ccc(cc3)O)O |
|
|
| InChI = 1/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
|
|
| InChIKey = JPMYFOBNRRGFNO-UHFFFAOYAO |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = JPMYFOBNRRGFNO-UHFFFAOYSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>5</sub> |
|
| C = 16 | H = 12 | O = 5 |
|
| MolarMass = 284.27 g/mol |
|
|
| ExactMass = 284.068473 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Genkwanin''' is a ], a type of flavonoid. It can be found in the seeds of '']''.<ref></ref> |
|
|
|
|
|
|
|
'''Genkwanin''' is an ], a type of flavonoid. It can be found in the seeds of '']'',<ref>{{cite journal | title=Hirsutanonol, oregonin and genkwanin from the seeds of Alnus glutinosa (Betulaceae) | last1=O'Rourke | first1=Ciara | last2=Byres | first2=Maureen | last3=Delazar | first3=Abbas | last4=Kumarasamy | first4=Yashodharan | last5=Nahar | first5=Lutfun | last6=Stewart | first6=Fiona | last7=Sarker | first7=Satyajit D. | journal=Biochemical Systematics and Ecology | year=2005 | volume=33 | issue=7 | pages=749–752 | url=http://cat.inist.fr/?aModele=afficheN&cpsidt=16859150 | doi=10.1016/j.bse.2004.10.005 | bibcode=2005BioSE..33..749O | access-date=2010-02-23 | archive-date=2012-08-23 | archive-url=https://web.archive.org/web/20120823070915/http://cat.inist.fr/?aModele=afficheN&cpsidt=16859150 | url-status=dead }}</ref> in the leaves of the ferns '']'' and '']'',<ref>{{cite journal | title=Flavonoid distribution in asplenioid ferns | first1=Yusuf | last1=UmiKalsom | first2=Jeffrey B. | last2=Harborne | journal=Pertanika | year=1991 | volume=14 | issue=3 | pages=297–300}}</ref> and in the leaves of trees in the genus '']''.<ref> {{cite book | last1 = Kakino | first1 = Mamoru |last2 = Hara | first2 = Hideaki| title = Agarwood | chapter = Pharmacological Effects of Aquilaria SPP. Leaves and Their Chemical Constituents | series = Tropical Forestry | year = 2016 | pages = 125–136 | doi = 10.1007/978-981-10-0833-7_8 | isbn = 978-981-10-0832-0 | chapter-url=https://link.springer.com/chapter/10.1007/978-981-10-0833-7_8}} </ref> |
⚫ |
==References== |
|
|
|
|
|
⚫ |
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{flavone}} |
|
{{flavone}} |
|
|
|
|
|
] |
|
] |
|
⚫ |
{{aromatic-stub}} |
|
] |
|
|
|
|
|
|
|
⚫ |
{{polyphenol-stub}} |
|
|
|
|
|
] |
|