Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Glabridin: Difference between pages - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 17:41, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 476864376 of page Glabridin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').  Latest revision as of 07:55, 18 May 2024 edit GreenLipstickLesbian (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers, Pending changes reviewers16,153 edits fixing attribution for text copied in https://en.wikipedia.org/search/?diff=1116247095&oldid=1024342174 from https://www.mdpi.com/1422-0067/23/19/11372#:~:text=Thus%2C%20glabridin%20effectively%20inhibits%20the,therapeutic%20agent%20for%20thromboembolic%20disorders.Tag: 2017 wikitext editor 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477396557
| ImageFile = Glabridin.svg | ImageFile = Glabridin.svg
| IUPACName = (3''R'')-6′′,6′′-Dimethyl-6′′''H''-pyranoisoflavan-2′,4′-diol
| ImageSize = 200px
| IUPACName = 4-chromen-3-yl]-1,3-benzenediol | SystematicName = 4-dipyran)-3-yl]benzene-1,3-diol
| OtherNames = | OtherNames =
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = <!-- blanked - oldvalue: 59870-68-7 -->
| ChEMBL = 480477 | CASNo = 59870-68-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = HOC5567T41
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 480477
| PubChem = 124052 | PubChem = 124052
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 110560 | ChemSpiderID = 110560
| SMILES = O4c2c1\C=C/C(Oc1ccc2C(c3ccc(O)cc3O)C4)(C)C
| ChEBI_Ref = {{ebicite|changed|EBI}}
| InChI = 1/C20H20O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1
| ChEBI = 5369
| InChIKey = LBQIJVLKGVZRIW-ZDUSSCGKBA
| SMILES = O4c2c1\C=C/C(Oc1ccc2C(c3ccc(O)cc3O)C4)(C)C
| StdInChI = 1S/C20H20O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1
| InChI = 1/C20H20O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1
| StdInChIKey = LBQIJVLKGVZRIW-ZDUSSCGKSA-N
| InChIKey = LBQIJVLKGVZRIW-ZDUSSCGKBA
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H20O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LBQIJVLKGVZRIW-ZDUSSCGKSA-N
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| C=20|H=20|O=4 | C=20 | H=20 | O=4
| Appearance = Yellowish-brown powder | Appearance = Yellowish-brown powder
| Density = | Density =
| MeltingPtCL = 156 | MeltingPtC = 238-240
| MeltingPt_ref = <ref>] Record for CAS#59870-68-7</ref>
| MeltingPtCH = 158
| BoilingPt = | BoilingPt =
| Solubility = | Solubility =
}} }}
| Section3 = {{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards = | MainHazards =
| FlashPt = | FlashPt =
| Autoignition = | AutoignitionPt =
}} }}
}} }}

'''Glabridin''' is a chemical compound that is found in the root extract of ] (''Glycyrrhiza glabra'').<ref>{{Cite journal | vauthors = Kinoshita T, Kajiyama K, Hiraga Y, Takahashi K, Tamura Y, Mizutani K | journal = Heterocycles | title = Isoflavan derivatives from Glycyrrhiza glabra (licorice) | date = 1996 | volume = 43 | issue = 3 | pages = 581–588}}</ref> Glabridin is an ], a type of isoflavonoid. This product is part of a larger family of plant-derived molecules, the ]s. Glabridin effectively inhibits platelet activation, so it might become therapeutic agent for thromboembolic disorders.<ref name="pmid">{{cite journal | vauthors = Chung CL, Chen JH, Huang WC, Sheu JR, Hsia CW, Jayakumar T, Hsia CH, Chiou KR, Hou SM | title = Glabridin, a Bioactive Flavonoid from Licorice, Effectively Inhibits Platelet Activation in Humans and Mice | journal = International Journal of Molecular Sciences | volume = 23 | issue = 19 | date = September 2022 | page = 11372 | pmid = 36232674| pmc = 9570097 | doi = 10.3390/ijms231911372 | doi-access = free }}{{Creative Commons text attribution notice|cc=by4|from this source=yes}}</ref>

It is used as an ingredient in cosmetics and is listed in ] (INCI).

Glabridin is yellowish-brown powder. It is insoluble in water, but soluble in organic solvents such as ].

==See also==
* ]
* ]
* ]

==References==
<references />

{{Isoflavane}}

]