| Revision as of 05:35, 10 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drug← Previous edit |
Latest revision as of 15:46, 7 June 2024 edit undoInternetArchiveBot (talk | contribs)Bots, Pending changes reviewers5,384,350 edits Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.9.5 |
| (35 intermediate revisions by 23 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 444003955 |
|
⚫ |
| ImageFile = Glibornuride.svg |
|
⚫ |
| ImageSize = 250 |
|
|
| IUPACName = ''N''-{carbamoyl}-4-methylbenzene-1-sulfonamide |
|
|
| SystematicName = ''N''-{heptan-2-yl]carbamoyl}-4-methylbenzene-1-sulfonamide |
|
⚫ |
| OtherNames = |
|
|
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = VP83E7434R |
|
| UNII = VP83E7434R |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| verifiedrevid = 437203158 |
|
|
⚫ |
| CASNo=26944-48-9 |
| ⚫ |
|ImageFile=Glibornuride.png |
|
|
⚫ |
| PubChem=33649 |
| ⚫ |
|ImageSize=200px |
|
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|IUPACName=1-(6-hydroxy-1,7,7-trimethyl-5-bicycloheptanyl)-3-(4-methylphenyl)sulfonylurea |
|
|
|
| DrugBank = DB08962 |
| ⚫ |
|OtherNames= |
|
| ⚫ |
|Section1={{Chembox Identifiers |
|
| ⚫ |
| CASNo=26944-48-9 |
|
| ⚫ |
| PubChem=33649 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D02427 |
|
| KEGG = D02427 |
|
| SMILES=CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2C3CCC(C2O)(C3(C)C)C |
|
| SMILES=CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2C3CCC(C2O)(C3(C)C)C |
|
|
| InChI = 1/C18H26N2O4S/c1-11-5-7-12(8-6-11)25(23,24)20-16(22)19-14-13-9-10-18(4,15(14)21)17(13,2)3/h5-8,13-15,21H,9-10H2,1-4H3,(H2,19,20,22)/t13-,14+,15+,18+/m1/s1 |
|
|
| InChIKey = RMTYNAPTNBJHQI-LLDVTBCEBZ |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C18H26N2O4S/c1-11-5-7-12(8-6-11)25(23,24)20-16(22)19-14-13-9-10-18(4,15(14)21)17(13,2)3/h5-8,13-15,21H,9-10H2,1-4H3,(H2,19,20,22)/t13-,14+,15+,18+/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = RMTYNAPTNBJHQI-LLDVTBCESA-N |
|
|
| RTECS = |
|
|
| MeSHName = C073323 |
|
|
| EINECS = 248-124-6 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 16735831 |
|
}} |
|
}} |
|
|
|
|
|Section2={{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula=C<sub>18</sub>H<sub>26</sub>N<sub>2</sub>O<sub>4</sub>S |
|
| Formula = C<sub>18</sub>H<sub>26</sub>N<sub>2</sub>O<sub>4</sub>S |
|
| MolarMass=366.48 g/mol |
|
| MolarMass = 366.48 g/mol |
|
| Appearance= |
|
|
|
| Appearance = |
|
| Density= |
|
|
|
| Density = |
|
| MeltingPt= |
|
|
|
| MeltingPt = |
|
| BoilingPt= |
|
|
|
| BoilingPt = |
|
| Solubility= |
|
|
|
| Solubility = |
|
}} |
|
}} |
|
|
|
| ⚫ |
|Section3={{Chembox Hazards |
|
|
|
| Section6 = {{Chembox Pharmacology |
|
| MainHazards= |
|
|
|
| ATCCode_prefix = A10 |
|
| FlashPt= |
|
|
|
| ATCCode_suffix = BB04 |
|
| Autoignition= |
|
|
|
}} |
|
|
|
|
⚫ |
| Section7 = {{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Glibornuride''' (]) is a ].<ref>{{cite journal |author=Haupt E, Köberich W, Beyer J, Schöffling K |title=Pharmacodynamic aspects of tolbutamide, glibenclamide, glibornuride and glisoxepide. I. Dose response relations and repeated administration in diabetic subjects |journal=Diabetologia |volume=7 |issue=6 |pages=449–54 |year=1971 |month=December |pmid=5004178}}</ref> |
|
'''Glibornuride''' (]) is an ] from the group of ]s.<ref>{{cite journal |vauthors=Haupt E, Köberich W, Beyer J, Schöffling K |title=Pharmacodynamic aspects of tolbutamide, glibenclamide, glibornuride and glisoxepide. I. Dose response relations and repeated administration in diabetic subjects |journal=Diabetologia |volume=7 |issue=6 |pages=449–54 |date=December 1971 |pmid=5004178 |doi=10.1007/bf01212061|doi-access=free }}</ref> It is manufactured by ] and sold in ] under the brand name '''Glutril'''.<ref>{{cite web|title=Glutril — Drugs.com|url=https://www.drugs.com/international/glutril.html|website=Drugs.com|access-date=12 July 2016|archive-date=14 September 2016|archive-url=https://web.archive.org/web/20160914204342/https://www.drugs.com/international/glutril.html|url-status=live}}</ref> |
|
|
|
|
|
== Synthesis == |
|
|
] |
|
|
Gliburnide is an endo-endo derivative made from camphor-3-carboxamide by borohydride reduction (exo approach), followed by ] to ], followed by displacement with sodium tosylamide. |
|
|
|
|
|
==References== |
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
{{Oral hypoglycemics and insulin analogs}} |
|
|
{{Ion channel modulators}} |
|
|
|
|
|
|
] |
|
{{pharmacology-stub}} |
|
|
⚫ |
] |
|
|
] |
|
⚫ |
] |
|
|
|
|
|
|
{{gastrointestinal-drug-stub}} |
| ⚫ |
] |
|
| ⚫ |
] |
|