| Revision as of 08:56, 9 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validati← Previous edit |
Latest revision as of 10:04, 13 November 2022 edit undoDMacks (talk | contribs)Edit filter managers, Autopatrolled, Administrators186,452 editsm General rollback of evasion, that also generally fails WP:RS and sometimes WP:OR on its own meritsTag: Rollback |
| (23 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 443836213 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Glisoxepide.png |
|
|
⚫ |
| verifiedrevid = 443837353 |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile = Glisoxepide.svg |
|
|IUPACName= |
|
|
⚫ |
| ImageSize = 275 |
| ⚫ |
|OtherNames= |
|
|
|
| ImageFile1 = Glisoxepide molecule ball.png |
| ⚫ |
|Section1={{Chembox Identifiers |
|
|
|
| ImageSize1 = 275 |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| PIN = ''N''-sulfamoyl}phenyl)ethyl]-5-methyl-1,2-oxazole-3-carboxamide |
|
⚫ |
| OtherNames = |
|
|
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 30380 |
|
| ChemSpiderID = 30380 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| Line 17: |
Line 22: |
|
| StdInChIKey = ZKUDBRCEOBOWLF-UHFFFAOYSA-N |
|
| StdInChIKey = ZKUDBRCEOBOWLF-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=25046-79-1 |
|
| CASNo = 25046-79-1 |
|
| PubChem=32778 |
|
| PubChem = 32778 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2106618 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07118 |
|
| KEGG = D07118 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB01289 |
|
| DrugBank = DB01289 |
|
| SMILES = O=C(NCCc1ccc(cc1)S(=O)(=O)NC(=O)NN2CCCCCC2)c3noc(c3)C |
|
| SMILES = O=C(NCCc1ccc(cc1)S(=O)(=O)NC(=O)NN2CCCCCC2)c3noc(c3)C |
|
}} |
|
}} |
|
|
|
|
|Section2={{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula=C<sub>20</sub>H<sub>27</sub>N<sub>5</sub>O<sub>5</sub>S |
|
| Formula = C<sub>20</sub>H<sub>27</sub>N<sub>5</sub>O<sub>5</sub>S |
|
| MolarMass=449.52388 |
|
| MolarMass = 449.52388 g/mol |
|
| Appearance= |
|
|
|
| Appearance = |
|
| Density= |
|
|
|
| Density = |
|
| MeltingPt= |
|
|
|
| MeltingPt = |
|
| BoilingPt= |
|
|
|
| BoilingPt = |
|
| Solubility= |
|
|
|
| Solubility = |
|
}} |
|
}} |
|
|
|
| ⚫ |
|Section3={{Chembox Hazards |
|
|
|
|Section6 = {{Chembox Pharmacology |
|
| MainHazards= |
|
|
|
| ATCCode_prefix = A10 |
|
| FlashPt= |
|
|
|
| ATCCode_suffix = BB11 |
|
| Autoignition= |
|
|
|
}} |
|
|
|
|
⚫ |
|Section7={{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
'''Glisoxepide''' (]) is a ].<ref>{{cite journal |author=Haupt E, Köberich W, Beyer J, Schöffling K |title=Pharmacodynamic aspects of tolbutamide, glibenclamide, glibornuride and glisoxepide. I. Dose response relations and repeated administration in diabetic subjects |journal=Diabetologia |volume=7 |issue=6 |pages=449–54 |year=1971 |month=December |pmid=5004178}}</ref> |
|
'''Glisoxepide''' (]) is an orally available ] from the group of ]s.<ref>{{cite journal |vauthors=Haupt E, Köberich W, Beyer J, Schöffling K |title=Pharmacodynamic aspects of tolbutamide, glibenclamide, glibornuride and glisoxepide. I. Dose response relations and repeated administration in diabetic subjects |journal=Diabetologia |volume=7 |issue=6 |pages=449–54 |date=December 1971 |pmid=5004178 |doi=10.1007/bf01212061|doi-access=free }}</ref> It belongs to second-generation sulfonylureas.<ref>{{cite journal|last1=Loubatières|first1=A|last2=Ribes|first2=G|last3=Mariani|first3=MM|last4=Alric|first4=R|title=Pharmacological Comparison Between Tolbutamide and Two Second Generation Hypoglycemic Sulfonylureas (Glibenclamide and Glisoxepide)|journal=Acta Diabetologica Latina|volume=10|issue=2|pages=261–82|pmid=4200420|doi=10.1007/bf02590661|year=1973}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
{{Oral hypoglycemics and insulin analogs}} |
|
{{pharmacology-stub}} |
|
|
|
{{Ion channel modulators}} |
|
|
|
|
|
] |
|
] |
| ⚫ |
] |
|
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
⚫ |
] |
|
|
] |
|
|
|
|
|
{{gastrointestinal-drug-stub}} |