Misplaced Pages

Glisoxepide: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 08:56, 9 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validati← Previous edit Latest revision as of 10:04, 13 November 2022 edit undoDMacks (talk | contribs)Edit filter managers, Autopatrolled, Administrators186,452 editsm General rollback of evasion, that also generally fails WP:RS and sometimes WP:OR on its own meritsTag: Rollback 
(23 intermediate revisions by 19 users not shown)
Line 1: Line 1:
{{chembox {{chembox
| Verifiedfields = changed
| verifiedrevid = 443836213
| Watchedfields = changed
|ImageFile=Glisoxepide.png
| verifiedrevid = 443837353
|ImageSize=200px
| ImageFile = Glisoxepide.svg
|IUPACName=
| ImageSize = 275
|OtherNames=
| ImageFile1 = Glisoxepide molecule ball.png
|Section1={{Chembox Identifiers
| ImageSize1 = 275
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| PIN = ''N''-sulfamoyl}phenyl)ethyl]-5-methyl-1,2-oxazole-3-carboxamide
| OtherNames =

| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 30380 | ChemSpiderID = 30380
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
Line 17: Line 22:
| StdInChIKey = ZKUDBRCEOBOWLF-UHFFFAOYSA-N | StdInChIKey = ZKUDBRCEOBOWLF-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=25046-79-1 | CASNo = 25046-79-1
| PubChem=32778 | PubChem = 32778
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2106618
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07118 | KEGG = D07118
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01289 | DrugBank = DB01289
| SMILES = O=C(NCCc1ccc(cc1)S(=O)(=O)NC(=O)NN2CCCCCC2)c3noc(c3)C | SMILES = O=C(NCCc1ccc(cc1)S(=O)(=O)NC(=O)NN2CCCCCC2)c3noc(c3)C
}} }}

|Section2={{Chembox Properties | Section2 = {{Chembox Properties
| Formula=C<sub>20</sub>H<sub>27</sub>N<sub>5</sub>O<sub>5</sub>S | Formula = C<sub>20</sub>H<sub>27</sub>N<sub>5</sub>O<sub>5</sub>S
| MolarMass=449.52388 | MolarMass = 449.52388 g/mol
| Appearance=
| Appearance =
| Density=
| Density =
| MeltingPt=
| MeltingPt =
| BoilingPt=
| BoilingPt =
| Solubility=
| Solubility =
}} }}

|Section3={{Chembox Hazards
|Section6 = {{Chembox Pharmacology
| MainHazards=
| ATCCode_prefix = A10
| FlashPt=
| ATCCode_suffix = BB11
| Autoignition=
}}

|Section7={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}} }}
}} }}

'''Glisoxepide''' (]) is a ].<ref>{{cite journal |author=Haupt E, Köberich W, Beyer J, Schöffling K |title=Pharmacodynamic aspects of tolbutamide, glibenclamide, glibornuride and glisoxepide. I. Dose response relations and repeated administration in diabetic subjects |journal=Diabetologia |volume=7 |issue=6 |pages=449–54 |year=1971 |month=December |pmid=5004178}}</ref> '''Glisoxepide''' (]) is an orally available ] from the group of ]s.<ref>{{cite journal |vauthors=Haupt E, Köberich W, Beyer J, Schöffling K |title=Pharmacodynamic aspects of tolbutamide, glibenclamide, glibornuride and glisoxepide. I. Dose response relations and repeated administration in diabetic subjects |journal=Diabetologia |volume=7 |issue=6 |pages=449–54 |date=December 1971 |pmid=5004178 |doi=10.1007/bf01212061|doi-access=free }}</ref> It belongs to second-generation sulfonylureas.<ref>{{cite journal|last1=Loubatières|first1=A|last2=Ribes|first2=G|last3=Mariani|first3=MM|last4=Alric|first4=R|title=Pharmacological Comparison Between Tolbutamide and Two Second Generation Hypoglycemic Sulfonylureas (Glibenclamide and Glisoxepide)|journal=Acta Diabetologica Latina|volume=10|issue=2|pages=261–82|pmid=4200420|doi=10.1007/bf02590661|year=1973}}</ref>


==References== ==References==
{{Reflist}} {{Reflist}}


{{Oral hypoglycemics and insulin analogs}}
{{pharmacology-stub}}
{{Ion channel modulators}}


] ]
]
]
] ]
] ]
]
]

{{gastrointestinal-drug-stub}}