| Revision as of 20:19, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 16:05, 2 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name |
| (21 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 411674667 |
|
| verifiedrevid = 428814014 |
|
|ImageFile=Glycochenodeoxycholic acid.png |
|
| ImageFile = Glycochenodeoxycholic acid.png |
|
|ImageSize=200px |
|
|
|
| IUPACName = ''N''-(3α,7α-Dihydroxy-5β-cholan-24-oyl)glycine |
|
|IUPACName= <small>2-<nowiki>phenanthren-17-yl]pentanoyl]amino]acetic acid</small> |
|
| SystematicName = {(4''R'')-4-phenanthren-1-yl]pentanamido}acetic acid |
|
|OtherNames= |
|
| OtherNames = |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| IUPHAR_ligand = 4545 |
| ⚫ |
| CASNo=640-79-9 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| PubChem=12544 |
|
|
⚫ |
| CASNo = 640-79-9 |
| ⚫ |
| SMILES=C(CCC(=O)NCC(=O)O)1CC21(CC32(C43(CC(C4)O)C)O)C |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
}} |
|
|
|
| UNII = 451ZNJ667Y |
|
⚫ |
| PubChem = 12544 |
|
⚫ |
| SMILES = C(CCC(=O)NCC(=O)O)1CC21(CC32(C43(CC(C4)O)C)O)C |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 12027 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C26H43NO5/c1-15(4-7-22(30)27-14-23(31)32)18-5-6-19-24-20(9-11-26(18,19)3)25(2)10-8-17(28)12-16(25)13-21(24)29/h15-21,24,28-29H,4-14H2,1-3H3,(H,27,30)(H,31,32)/t15-,16+,17-,18-,19+,20+,21-,24+,25+,26-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = GHCZAUBVMUEKKP-GYPHWSFCSA-N |
|
|
|
|
⚫ |
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>26</sub>H<sub>43</sub>NO<sub>5</sub> |
|
| Formula = C<sub>26</sub>H<sub>43</sub>NO<sub>5</sub> |
|
| MolarMass=449.62 g/mol |
|
| MolarMass = 449.62 g/mol |
|
| Appearance= |
|
| Appearance = |
|
| Density= |
|
| Density = |
|
| MeltingPt= |
|
| MeltingPt = |
|
| BoilingPt= |
|
| BoilingPt = |
|
| Solubility= |
|
| Solubility = |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards = |
|
| FlashPt= |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Glycochenodeoxycholic acid''' is a ] formed in the liver from ] and ], usually found as the ] ]. It acts as a detergent to solubilize fats for absorption. |
|
'''Glycochenodeoxycholic acid''' is a ] formed in the liver from ] and ], usually found as the ] ].<ref>{{cite journal |title = DrugBank 3.0: a comprehensive resource for omics research on drugs |vauthors=Knox C, Law V, Jewison T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS |journal = Nucleic Acids Res. |year = 2011 |volume = 39 |issue = Database issue |pages = D1035–41 | pmid =21059682 |doi=10.1093/nar/gkq1126 |pmc=3013709}}</ref><ref>{{cite journal |title = DrugBank: a knowledgebase for drugs, drug actions and drug targets |journal=Nucleic Acids Research|author1-link=David S. Wishart |author1=Wishart DS |author2=Knox C |author3=Guo AC |author4=Cheng D |author5=Shrivastava S |author6=Tzur D |author7=Gautam B |author8=Hassanali M <!-- | = Nucleic Acids Res -->|year = 2008 |volume = 36 |issue = Database issue |pages = D901–6 |pmid = 18048412 |doi=10.1093/nar/gkm958 |pmc=2238889}}</ref> It acts as a detergent to solubilize fats for absorption.{{cn|date=March 2022}} |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|