| Revision as of 06:14, 3 December 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 editsNo edit summary← Previous edit |
Latest revision as of 15:45, 14 June 2024 edit undoInternetArchiveBot (talk | contribs)Bots, Pending changes reviewers5,388,413 edits Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.9.5 |
| (42 intermediate revisions by 29 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Distinguish|Gossypol}} |
|
{{chembox |
|
|
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 400270518 |
|
| Name = Gossypetin |
|
| Name = Gossypetin |
|
| ImageFile = Gossypetin.svg |
|
| ImageFile = Gossypetin.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
|
| ImageAlt = Skeletal formula of gossypetin |
|
| IUPACName = 2-(3,4-dihydroxyphenyl)-3,5,7,8-tetrahydroxychromen-4-one |
|
|
|
| ImageFile1 = Gossypetin-3D-balls.png |
| ⚫ |
| OtherNames = Articulatidin<br>Equisporol<br>3,3',4',5,7,8-Hexahydroxyflavone<br>3,5,7,8,3',4'-Hexahydroxyflavone |
|
|
|
| ImageAlt1 = Ball-and-stick model of the gossypetin molecule |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| IUPACName = 3,3′,4′,5,7,8-Hexahydroxyflavone |
|
|
| SystematicName = 2-(3,4-Dihydroxyphenyl)-3,5,7,8-tetrahydroxy-4''H''-1-benzopyran-4-one |
|
⚫ |
| OtherNames = Articulatidin<br />Equisporol<br />3,5,7,8,3',4'-Hexahydroxyflavone |
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 489-35-0 |
|
| CASNo = 489-35-0 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = SET4M23ZTM |
|
| PubChem = 5280647 |
|
| PubChem = 5280647 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 253570 |
|
| SMILES = C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)O)O)O)O |
|
| SMILES = C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)O)O)O)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4444247 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 16400 |
|
|
| InChI = 1/C15H10O8/c16-6-2-1-5(3-7(6)17)14-13(22)12(21)10-8(18)4-9(19)11(20)15(10)23-14/h1-4,16-20,22H |
|
|
| InChIKey = YRRAGUMVDQQZIY-UHFFFAOYAI |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C15H10O8/c16-6-2-1-5(3-7(6)17)14-13(22)12(21)10-8(18)4-9(19)11(20)15(10)23-14/h1-4,16-20,22H |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = YRRAGUMVDQQZIY-UHFFFAOYSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>15</sub>H<sub>10</sub>O<sub>8</sub> |
|
| Formula = C<sub>15</sub>H<sub>10</sub>O<sub>8</sub> |
|
| MolarMass = 318.23 g/mol |
|
| MolarMass = 318.23 g/mol |
|
| ExactMass = 318.037567 |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 19: |
Line 41: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
'''Gossypetin''' (3,5,7,8,3,' 4'-hexahydroxy flavone), is a ], a type of flavonoid, that has been shown to exhibit strong antibacterial activity.<ref></ref> It can be found in the flowers, and the calyx of the ] plant. |
|
|
|
|
|
|
|
'''Gossypetin''', also known as '''3,5,7,8,3',4'-hexahydroxyflavone''', is a ], a type of ]. It has been isolated from the flowers and the calyx of '']'' (roselle) and exhibits a strong ] activity.<ref>{{Cite web |url=http://medind.nic.in/imvw/imvw289.html |title=Antibacterial activity of gossypetin isolated from hibiscus sabdariffa |access-date=2008-04-23 |archive-date=2007-12-05 |archive-url=https://web.archive.org/web/20071205051151/http://medind.nic.in/imvw/imvw289.html |url-status=dead }}</ref><ref>Amitava Khan, Krishnendu Manna, Chinchubose, Mahuya Sinha, Dipesh Kr Das, Swaraj Bandhu Kesh, Anindita Chakrabarty, Asoke Banerji & Sanjit Dey: Gossypetin, a naturally occurring hexahydroxy flavones ameliorates gamma radiation mediated DNA damage International Journal of Radiation Biology (2013):89(11): 965-975.</ref> The compound has also been found to act as an ] of ].<ref name="ObianyoYe2013">{{cite journal|last1=Obianyo|first1=Obiamaka|last2=Ye|first2=Keqiang|title=Novel small molecule activators of the Trk family of receptor tyrosine kinases|journal=Biochimica et Biophysica Acta (BBA) - Proteins and Proteomics|volume=1834|issue=10|year=2013|pages=2213–2218|issn=1570-9639|doi=10.1016/j.bbapap.2012.08.021|pmc=3602283|pmid=22982231}}</ref> Gossypetin has ] activity.{{Citation needed|date=November 2017}} |
|
==Metabolism== |
|
| ⚫ |
The enzyme ] uses S-adenosyl methionine and gossypetin to produce S-adenosylhomocysteine and ]. |
|
|
|
|
|
|
⚫ |
The enzyme ] uses ] and gossypetin to produce ] and 3,5,7,3',4'-pentahydroxy-8-methoxyflavone.{{Citation needed|date=November 2016}} |
| ⚫ |
==References== |
|
| ⚫ |
{{Reflist}} |
|
|
|
|
|
|
|
In 2022, a study in an animal model using intragastric administration suggested that the flavonoid gossypetin facilitated the clearance of beta-amyloid in the brain and is a promising target for the study of treatments for Alzheimer's Disease by enhancing microglial phagocytic activity against Aβ.<ref>Jo, K.W., Lee, D., Cha, D.G. et al., '''', Alzheimer's Research & Therapy, October 21, 2022 - Alz Res Therapy 14, 158 (2022)</ref> |
|
{{Flavonol}} |
|
|
|
|
|
|
|
== See also == |
| ⚫ |
] |
|
|
|
* ] |
|
|
|
|
⚫ |
== References == |
|
⚫ |
{{Reflist|2}} |
|
|
|
|
|
{{Flavonols}} |
|
|
{{Growth factor receptor modulators}} |
|
|
|
|
|
] |
|
] |
|
] |
|
⚫ |
] |
|
] |
|
] |
|
|
] |
|
|
|
|
| ⚫ |
{{Polyphenol-stub}} |
|
|
|
|
|
|
⚫ |
{{Aromatic-stub}} |
|
] |
|