| Revision as of 02:45, 11 April 2011 editGrutness (talk | contribs)Autopatrolled, Administrators316,498 editsmNo edit summary← Previous edit |
Latest revision as of 19:50, 17 August 2022 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,572 editsm Added UNII |
| (8 intermediate revisions by 8 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 405873974 |
|
| verifiedrevid = 423446532 |
|
| Name = Guibourtinidin (chloride) |
|
| Name = Guibourtinidin (chloride) |
|
| ImageFile = Guibourtinidin.svg |
|
| ImageFile = Guibourtinidin.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| IUPACName = 2-(4-hydroxyphenyl)chromenylium-3,7-diol |
|
| IUPACName = 2-(4-hydroxyphenyl)chromenylium-3,7-diol |
|
| OtherNames = Guibourtinidin chloride<br>3,7,4'-Trihydroxyflavylium chloride |
|
| OtherNames = Guibourtinidin chloride<br>3,7,4'-Trihydroxyflavylium chloride |
|
| Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = |
|
| CASNo = 23130-31-6 |
|
|
| CASNo_Ref = {{Cascite|changed|CAS}} |
| ⚫ |
| PubChem = 20481741 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES = C1=CC(=CC=C1C2=C(C=C3C=CC(=CC3=2)O)O)O |
|
|
|
| UNII = 5K4V6C6T6B |
|
⚫ |
| PubChem = 20481741 |
|
⚫ |
| SMILES = C1=CC(=CC=C1C2=C(C=C3C=CC(=CC3=2)O)O)O |
|
|
| StdInChI=1S/C15H10O4/c16-11-4-1-9(2-5-11)15-13(18)7-10-3-6-12(17)8-14(10)19-15/h1-8H,(H2-,16,17,18)/p+1 |
|
|
| StdInChIKey = ZGQPDIBIQDDUNF-UHFFFAOYSA-O |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>15</sub>H<sub>11</sub>O<sub>4</sub>+ Cl<sup>-</sup> |
|
| Formula = C<sub>15</sub>H<sub>11</sub>O<sub>4</sub>+ Cl<sup>−</sup> |
|
| MolarMass = 255.24 g/mol |
|
| MolarMass = 255.24 g/mol |
|
|
| Appearance = |
|
| ExactMass = 255.065733 u |
|
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Guibourtinidin''' is a <!-- water soluble, bluish red plant dye -->]. |
|
'''Guibourtinidin''' is an <!-- water soluble, bluish red plant dye -->]. |
|
|
|
|
|
==Tannins== |
|
==Tannins== |
| Line 42: |
Line 46: |
|
] |
|
] |
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{Aromatic-stub}} |