| Revision as of 06:53, 2 February 2011 edit72.199.145.236 (talk) →External links← Previous edit |
Latest revision as of 07:26, 6 June 2024 edit undoSunsetside (talk | contribs)Extended confirmed users1,416 editsm minor copy editTag: Visual edit |
| (28 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
| ⚫ |
{{drugbox | verifiedrevid = 400102572 |
|
|
|
{{Drugbox |
|
| |
|
|
⚫ |
| verifiedrevid = 411533590 |
|
| IUPAC_name = (3''R'',5''R'')-5-(3-(cyclopentyloxy)-4-methoxyphenyl)-3-(3-methylbenzyl)piperidin-2-one |
|
| IUPAC_name = (3''S'',5''S'')-5-(3-(Cyclopentyloxy)-4-methoxyphenyl)-3-(3-methylbenzyl)piperidin-2-one |
|
| image = HT-0712.png |
|
| image = HT-0712.svg |
|
| width = 160 |
|
|
|
| width = 250 |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- Schedule I --> |
|
⚫ |
| legal_UK = <!-- Class A --> |
|
⚫ |
| legal_US = <!-- Schedule I --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 617720-02-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 2O43FXG9IG |
|
⚫ |
| ATC_prefix = None |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 9865375 |
|
⚫ |
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 8041067 |
|
| ChemSpiderID = 8041067 |
|
|
|
|
| InChI = 1/C25H31NO3/c1-17-6-5-7-18(12-17)13-20-14-21(16-26-25(20)27)19-10-11-23(28-2)24(15-19)29-22-8-3-4-9-22/h5-7,10-12,15,20-22H,3-4,8-9,13-14,16H2,1-2H3,(H,26,27)/t20-,21-/m1/s1 |
|
|
|
<!--Chemical data--> |
|
| InChIKey = ABEJDMOBAFLQNJ-NHCUHLMSBI |
|
|
⚫ |
| C=25 | H=31 | N=1 | O=3 |
|
| smiles = O=C3NC(c2cc(OC1CCCC1)c(OC)cc2)C3Cc4cccc(c4)C |
|
| smiles = O=C3NC(c2cc(OC1CCCC1)c(OC)cc2)C3Cc4cccc(c4)C |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 13: |
Line 43: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ABEJDMOBAFLQNJ-NHCUHLMSSA-N |
|
| StdInChIKey = ABEJDMOBAFLQNJ-NHCUHLMSSA-N |
|
⚫ |
| synonyms = HT-0712, IPL 455,903 |
| ⚫ |
| CAS_number = 617720-02-2 |
|
| ⚫ |
| synonyms = HT-0712, IPL 455,903 |
|
| ⚫ |
| ATC_prefix = |
|
| ⚫ |
| ATC_suffix = |
|
| ⚫ |
| PubChem = 9865375 |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| C = 25 | H = 31 | N = 1 | O = 3 |
|
|
| molecular_weight = 393.53 g/mol |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| ⚫ |
| legal_CA = <!-- Schedule I --> |
|
| ⚫ |
| legal_UK = <!-- Class A --> |
|
| ⚫ |
| legal_US = <!-- Schedule I --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''HT-0712''' is an experimental ] enhancing ] (]) which is currently undergoing ]. It is currently being licensed by Helicon Therapeutics in San Diego, California. It was originally discovered and tested as part of a preclinical anti-inflammatory program by Inflazyme Pharmaceuticals. |
|
'''HT-0712''', also known as IPL-455903,<ref name="pmid18660832">{{cite journal | vauthors = Giembycz MA | title = Can the anti-inflammatory potential of PDE4 inhibitors be realized: guarded optimism or wishful thinking? | journal = British Journal of Pharmacology | volume = 155 | issue = 3 | pages = 288–290 | date = October 2008 | pmid = 18660832 | pmc = 2567889 | doi = 10.1038/bjp.2008.297 }}</ref> is an experimental ] enhancing ] (]) which is currently undergoing ]. It is currently being licensed by Helicon Therapeutics in San Diego, California. It was originally discovered and tested as part of a preclinical anti-inflammatory program by Inflazyme Pharmaceuticals.<ref name="pmid17823313">{{cite journal | vauthors = MacDonald E, Van der Lee H, Pocock D, Cole C, Thomas N, VandenBerg PM, Bourtchouladze R, Kleim JA | display-authors = 6 | title = A novel phosphodiesterase type 4 inhibitor, HT-0712, enhances rehabilitation-dependent motor recovery and cortical reorganization after focal cortical ischemia | journal = Neurorehabilitation and Neural Repair | volume = 21 | issue = 6 | pages = 486–496 | year = 2007 | pmid = 17823313 | doi = 10.1177/1545968307305521 | doi-access = free }}</ref> |
|
|
|
|
|
==Mechanism of action== |
|
==Mechanism of action== |
|
HT-0712 appears to act as a ], thereby increasing ] levels. When cAMP levels are increased in neurons, this may trigger activation of cAMP response element-binding proteins (]). CREBs are ]s involved in the formation of ]. |
|
HT-0712 appears to act as a ], thereby increasing ] levels. When cAMP levels are increased in neurons, this may trigger the activation of cAMP response element-binding proteins (]). CREBs are ]s involved in the formation of ].<ref name="pmid17823313"/> |
|
|
|
|
|
The side effects of the drug are not yet fully known. |
|
The side effects of the drug are not yet fully known. |
|
|
|
|
|
==Medical use== |
|
==Research== |
|
|
A 2014 study found that HT-0712 significantly boosted memory formation in mice. Data also indicated that HT-0712 may be effective to treat age-associated memory impairment in humans.<ref>{{cite journal | vauthors = Peters M, Bletsch M, Stanley J, Wheeler D, Scott R, Tully T | title = The PDE4 inhibitor HT-0712 improves hippocampus-dependent memory in aged mice | journal = Neuropsychopharmacology | volume = 39 | issue = 13 | pages = 2938–2948 | date = December 2014 | pmid = 24964813 | pmc = 4229572 | doi = 10.1038/npp.2014.154 }}</ref> |
|
Middle-aged people, seniors, and possibly those suffering from dementia, who have a hard time remembering everyday events, can possibly benefit from this drug. |
|
|
|
|
|
|
⚫ |
== References == |
|
==Performance enhancing use== |
|
|
|
{{reflist}} |
|
Many students may be inclined to use ] for school and college life for exams and finals. This could also be an effective alternative or adjunctive to the use of ] as a study aid. |
|
|
|
|
|
|
⚫ |
== External links == |
| ⚫ |
==References== |
|
|
|
|
* |
|
⚫ |
* |
|
|
|
| ⚫ |
==External links== |
|
|
* |
|
| ⚫ |
* |
|
|
* |
|
|
|
|
|
|
|
|
{{pharm-stub}} |
|
|
|
|
|
|
{{Phosphodiesterase inhibitors}} |
|
{{Phosphodiesterase inhibitors}} |
|
|
|
|
| ⚫ |
] |
|
| ⚫ |
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
⚫ |
] |
|
|
] |
|
⚫ |
] |