| Revision as of 10:29, 2 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wik← Previous edit |
Latest revision as of 10:17, 24 October 2023 edit undoBoghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,964 edits consistent citation formatting |
| (23 intermediate revisions by 21 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 448017530 |
|
| verifiedrevid = 448018348 |
|
| IUPAC_name = A: (19''E'',21''E'',23''E'',25''E'',27''E'',29''E'',31''E'')-33-{oxy}-17--1,3,5,9,11,37-hexahydroxy-18-methyl-13,15-dioxo-16,39-dioxabicyclononatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid<br />B: (19''E'',21''E'',23''E'',25''E'',27''E'',29''E'',31''E'')-33-{oxy}-17--1,5,7,9,11,37-hexahydroxy-18-methyl-13,15-dioxo-16,39-dioxabicyclononatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid |
|
| IUPAC_name = (4E,6E,8E,10E,12E,14E,16E)-3-oxy-19--25,27,31,33,35,37-hexahydroxy-18-methyl-21,23-dioxo-20,39-dioxabicyclononatriaconta-4,6,8,10,12,14,16-heptaene-38-carboxylic acid;(4E,6E,8E,10E,12E,14E,16E)-3-oxy-19--27,29,31,33,35,37-hexahydroxy-18-methyl-21,23-dioxo-20,39-dioxabicyclononatriaconta-4,6,8,10,12,14,16-heptaene-38-carboxylic acid |
|
| image = Hachimycin.svg |
|
| image = Hachimycin.svg |
|
| width = 300 |
|
| width = 300 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = |
|
| CAS_number = 1394-02-1 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 7073J025LS |
|
| ATC_prefix = D01 |
|
| ATC_prefix = D01 |
|
| ATC_suffix = AA03 |
|
| ATC_suffix = AA03 |
| Line 35: |
Line 39: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = RZWQQZWPVPHLSY-UGMBPVHXSA-N |
|
| StdInChIKey = RZWQQZWPVPHLSY-UGMBPVHXSA-N |
|
|
| SMILES = CC1C=CC=CC=CC=CC=CC=CC=CC(CC2C(C(CC(O2)(CC(CC(CC(CC(CCCC(=O)CC(=O)OC1C(C)CCC(CC(=O)C3=CC=C(C=C3)N)O)O)O)O)O)O)O)C(=O)O)OC4C(C(C(C(O4)C)O)N)O.CC1C=CC=CC=CC=CC=CC=CC=CC(CC2C(C(CC(O2)(CC(CC(CCCC(CC(CC(=O)CC(=O)OC1C(C)CCC(CC(=O)C3=CC=C(C=C3)N)O)O)O)O)O)O)O)C(=O)O)OC4C(C(C(C(O4)C)O)N)O |
|
| PubChem = 11979956 |
|
| PubChem = 11979956 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=58 | H=84 | N=2 | O=18 |
|
| C=116 | H=168 | N=4 | O=36 |
|
| molecular_weight = 1097.2902 g/mol |
|
|
}} |
|
}} |
|
|
'''Hachimycin''', also known as '''trichomycin''',<ref name="pubchem">{{cite web | url=https://pubchem.ncbi.nlm.nih.gov/compound/11979956 | title=Trichomycin - C116H168N4O36 | work = PubChem | publisher = U.S. National Library of Medicine | access-date=July 7, 2016 }}</ref> is a ] ],<ref name="j-antibiotics-1">{{cite journal | vauthors = Mechlinski W, Schaffner CP | title = Characterization of aromatic heptaene macrolide antibiotics by high performance liquid chromatography | journal = The Journal of Antibiotics | volume = 33 | issue = 6 | pages = 591–599 | date = June 1980 | pmid = 6893446 | doi = 10.7164/antibiotics.33.591 | doi-access = free }}</ref> antiprotozoal,<ref name="Nakano_1956">{{Cite journal | vauthors = Nakano H, Hattori K, Seki M, Hirata Y |date=1956 |title=Studies on Trichomycin. III |journal=The Journal of Antibiotics, Series A |volume=9 |issue=5 |pages=172–175 |doi=10.11554/antibioticsa.9.5_172}}</ref> and antifungal derived from ].<ref name="j-antibiotics-2">{{cite journal | vauthors = Komori T | title = Trichomycin B, a polyene macrolide from Streptomyces | journal = The Journal of Antibiotics | volume = 43 | issue = 7 | pages = 778–782 | date = July 1990 | pmid = 2387771 | doi = 10.7164/antibiotics.43.778 | doi-access = free }}</ref> It was first described in 1950, and in most research cases have been used for gynecological infections.<ref name="Nakano_1956" /> |
|
'''Hachimycin''' is a ] ]. |
|
|
|
|
|
|
|
== References == |
| ⚫ |
{{Gynecological anti-infectives and antiseptics}} |
|
|
|
{{reflist}} |
|
|
|
|
⚫ |
{{Gynecological anti-infectives and antiseptics|state=collapsed}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{antiinfective-drug-stub}} |
|
{{antibiotic-stub}} |
|
{{genito-urinary-drug-stub}} |
|