| Revision as of 07:42, 29 July 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 15:00, 2 February 2023 edit undoSmokefoot (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers, Rollbackers75,032 editsm Reverted edits by Mplanine (talk) to last version by GlycongTag: Rollback |
| (21 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 438565931 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 442001779 |
|
| ImageFile = Heme o structure.svg |
|
| ImageFile = Heme o structure.svg |
|
| ImageSize = |
|
| ImageSize = |
|
| IUPACName = |
|
| IUPACName = |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 137397-56-9 |
|
| CASNo = 137397-56-9 |
|
| PubChem = 6323367 |
|
|
| SMILES = |
|
| PubChem = 15719509 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| MeSHName = heme+O |
|
|
|
| ChemSpiderID = 3571849 |
|
|
| SMILES = OC(=O)CC/c6c(\C)c3n7c6cc2c(/CCC(O)=O)c(/C)c1cc5n8c(cc4n(78n12)c(c=3)c(C=C)c4c)c(\C(O)CC\C=C(/C)CC\C=C(/C)CC\C=C(C)/C)c5\C |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C49H60N4O5.Fe/c1-10-35-31(6)40-26-45-49(46(54)19-13-18-30(5)17-12-16-29(4)15-11-14-28(2)3)34(9)41(53-45)24-38-32(7)36(20-22-47(55)56)43(51-38)27-44-37(21-23-48(57)58)33(8)39(52-44)25-42(35)50-40;/h10,14,16,18,24-27,46,54H,1,11-13,15,17,19-23H2,2-9H3,(H4,50,51,52,53,55,56,57,58);/q;+2/p-2/b29-16+,30-18+,38-24-,39-25-,40-26-,41-24-,42-25-,43-27-,44-27-,45-26-; |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = FISPASSVCDRERW-KVGORYHISA-L |
|
⚫ |
| MeSHName = heme+O |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>49</sub>H<sub>58</sub>O<sub>5</sub>N<sub>4</sub>Fe |
|
| Formula = C<sub>49</sub>H<sub>58</sub>O<sub>5</sub>N<sub>4</sub>Fe |
|
| MolarMass = 838.854 g/mol |
|
| MolarMass = 838.854 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| Solubility = |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| AutoignitionPt = |
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Heme O''' (or '''haem O''') differs from the closely related ] by having a ] at ring position 8 instead of the ]. The ] chain at position 2 is the same. |
|
'''Heme O''' (or '''haem O''') differs from the closely related ] by having a ] at ring position 8 instead of the ]. The ] chain at position 2 is the same. |
|
|
|
|
|
Heme O, found in the bacterium '']'', functions in a similar manner to heme A in mammalian oxygen reduction. |
|
Heme O, found in the bacterium '']'',<ref>{{cite journal |title = The Nature of the Exchange Coupling between High-Spin Fe(III) Heme o3 and CuB(II) in Escherichia coli Quinol Oxidase, Cytochrome bo3: MCD and EPR Studies |author1=Myles R. Cheesman |author2=Vasily S. Oganesyan |author3=Nicholas J. Watmough |author4=Clive S. Butler |author5=Andrew J. Thomson |journal = J. Am. Chem. Soc. |date = 2004 |volume = 126 |issue=13 |pages = 4157–4166 |doi = 10.1021/ja038858m |pmid=15053605}}</ref> functions in a similar manner to heme A in mammalian oxygen reduction. |
|
|
|
|
|
==See also== |
|
==See also== |
|
* ] |
|
* ] |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Enzyme cofactors}} |
|
{{Enzyme cofactors}} |
|
|
|
|
] |
|
] |
|
] |
|
] |