| Revision as of 11:13, 9 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Latest revision as of 09:39, 4 February 2024 edit undoVaccinationist (talk | contribs)Extended confirmed users4,732 editsNo edit summaryTag: 2017 wikitext editor |
| (32 intermediate revisions by 23 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Unreferenced stub|auto=yes|date=December 2009}} |
|
|
{{Drugbox| verifiedrevid = 415518969 |
|
{{Drugbox |
|
|
| verifiedrevid = 443853293 |
|
⚫ |
| IUPAC_name = 5-cyclohept-1-en-1-yl-5-ethylpyrimidine-2,4,6(1''H'',3''H'',5''H'')-trione |
|
| |
|
|
|
| image = Heptabarbital structure.svg |
| ⚫ |
|IUPAC_name = 5-cyclohept-1-en-1-yl-5-ethylpyrimidine-2,4,6(1''H'',3''H'',5''H'')-trione |
|
|
⚫ |
| width = 135 |
|
| image = heptabarbital.svg |
|
|
|
<!--Clinical data--> |
| ⚫ |
| width=180 |
|
|
|
| tradename = |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_status = |
|
|
| legal_CA = Schedule IV |
|
|
| routes_of_administration = Oral<ref name="pmid9299">{{cite journal |vauthors=Breimer DD, de Boer AG | title = Pharmacokinetics and relative bioavailability of heptabarbital and heptabarbital sodium after oral administration to man | journal = European Journal of Clinical Pharmacology | volume = 9 | issue = 2–3 | pages = 169–78 |date=December 1975 | pmid = 9299 | doi = 10.1007/bf00614014| s2cid = 32380531 }}</ref> |
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = 83%<ref name="pmid9299" /> |
|
⚫ |
| metabolism = ] |
|
|
| elimination_half-life = 6.1-11.2 hours<ref name="pmid9299" /> |
|
⚫ |
| excretion = ]<ref name="pmid9299" /> |
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 509-86-4 |
|
⚫ |
| ATC_prefix = N05 |
|
⚫ |
| ATC_suffix = CA11 |
|
⚫ |
| PubChem = 10518 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = DB01354 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 10081 |
|
| ChemSpiderID = 10081 |
| Line 11: |
Line 29: |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C17725 |
|
| KEGG = C17725 |
|
| InChI = 1/C13H18N2O3/c1-2-13(9-7-5-3-4-6-8-9)10(16)14-12(18)15-11(13)17/h7H,2-6,8H2,1H3,(H2,14,15,16,17,18) |
|
| ⚫ |
| smiles = O=C1NC(=O)NC(=O)C1(/C2=C/CCCCC2)CC |
|
|
| InChIKey = PAZQYDJGLKSCSI-UHFFFAOYAO |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 468837 |
|
| ChEMBL = 468837 |
|
|
| synonyms = G-475 |
|
|
<!--Chemical data--> |
|
⚫ |
| C=13 | H=18 | N=2 | O=3 |
|
⚫ |
| smiles = O=C1NC(=O)NC(=O)C1(/C2=C/CCCCC2)CC |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C13H18N2O3/c1-2-13(9-7-5-3-4-6-8-9)10(16)14-12(18)15-11(13)17/h7H,2-6,8H2,1H3,(H2,14,15,16,17,18) |
|
| StdInChI = 1S/C13H18N2O3/c1-2-13(9-7-5-3-4-6-8-9)10(16)14-12(18)15-11(13)17/h7H,2-6,8H2,1H3,(H2,14,15,16,17,18) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PAZQYDJGLKSCSI-UHFFFAOYSA-N |
|
| StdInChIKey = PAZQYDJGLKSCSI-UHFFFAOYSA-N |
| ⚫ |
| CAS_number=509-86-4 |
|
| ⚫ |
| ATC_prefix=N05 |
|
| ⚫ |
| ATC_suffix=CA11 |
|
|
| ATC_supplemental= |
|
| ⚫ |
| PubChem=10518 |
|
| ⚫ |
| DrugBank = DB01354 |
|
| ⚫ |
| C=13 | H=18 | N=2 | O=3 |
|
|
| molecular_weight = 250.294 |
|
| ⚫ |
| bioavailability= ? |
|
| ⚫ |
| metabolism = ] |
|
|
| elimination_half-life= ? |
|
| ⚫ |
| excretion = ] |
|
| ⚫ |
| pregnancy_category = ? |
|
| ⚫ |
| legal_status = ? |
|
|
| routes_of_administration= Oral |
|
|
}} |
|
}} |
|
'''Heptabarbital''' is a drug which is a ] derivative. |
|
|
|
|
|
|
|
'''Heptabarb''' (]; '''Eudan''', '''Medapan''', '''Medomin''', '''Noctyn'''), also known as '''heptabarbitone''' (]) or '''heptabarbital''', is a ] and ] ] of the ] family.<ref name="GanellinTriggle1997">{{cite book | vauthors = Ganellin CR, Triggle DJ, Macdonald F | title = Dictionary of pharmacological agents | url = https://books.google.com/books?id=A0THacd46ZsC&pg=PA1003 | access-date = 26 November 2011 | year = 1997 | publisher = CRC Press | isbn = 978-0-412-46630-4 | page = 1003}}</ref><ref name="Index nominum 2000: international drug directory">{{cite book | title = Index nominum 2000: international drug directory | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA513 | access-date = 26 November 2011 | year = 2000 | publisher = Taylor & Francis US | isbn = 978-3-88763-075-1 | page = 513}}</ref> It was used in ] for the treatment of ] from the 1950s onwards, but has since been discontinued.<ref name="GanellinTriggle1997" /><ref name="Index nominum 2000: international drug directory" /> |
| ⚫ |
{{Barbiturates}} |
|
| ⚫ |
{{Hypnotics and sedatives}} |
|
|
|
|
|
|
|
== See also == |
| ⚫ |
] |
|
|
|
* ] |
|
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
⚫ |
{{Hypnotics and sedatives}} |
| ⚫ |
{{sedative-stub}} |
|
|
|
{{GABAAR PAMs}} |
|
|
|
|
|
⚫ |
] |
|
] |
|
|
⚫ |
] |
|
] |
|
|
|
] |
|
|
] |
|
|
] |
|
⚫ |
{{sedative-stub}} |