| Revision as of 08:41, 24 July 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm Ellagitannin temlate← Previous edit |
Latest revision as of 15:56, 29 August 2024 edit undoSmokefoot (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers, Rollbackers74,617 editsm →Occurrence: indent |
| (23 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Oxidatively coupled derivative of gallic acid}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 404634604 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 441140894 |
|
| Name = Hexahydroxydiphenic acid |
|
| Name = Hexahydroxydiphenic acid |
|
| ImageFile = HHDP.PNG |
|
| ImageFile = hexahydroxydiphenic acid.svg |
|
| ImageSize = 200px |
|
|
| ImageName = Chemical structure of hexahydroxydiphenic acid |
|
| ImageName = Chemical structure of hexahydroxydiphenic acid |
|
| ImageAlt = Chemical structure of hexahydroxydiphenic acid |
|
| ImageAlt = Chemical structure of hexahydroxydiphenic acid |
|
|
| PIN = 4,4′,5,5′,6,6′-Hexahydroxy-2,2′-dicarboxylic acid |
|
| IUPACName = 2-(6-carboxylato-2,3,4-trihydroxyphenyl)-3,4,5-trihydroxybenzoate |
|
|
| OtherNames = HHDP<br>3,4,5,3',4',5'-hexahydroxydiphenate<br>3,4,5,3',4',5'-hexahydroxydiphenic acid |
|
| OtherNames = HHDP<br />3,4,5,3′,4′,5′-Hexahydroxydiphenate<br />3,4,5,3′,4′,5′-Hexahydroxydiphenic acid |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = |
|
| CASNo = 128785-08-0 |
|
|
| CASNo_Ref = <ref>{{cite web |title=MetaCyc hexahydroxydiphenic acid |url=https://biocyc.org/compound?orgid=META&id=CPD-17774 |website=biocyc.org}}</ref> |
|
| CASNo_Ref = |
|
|
| CASOther = |
|
| PubChem = 10315050 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| PubChem = 25203886 |
|
|
|
| ChemSpiderID = 8490515 |
|
| SMILES = C1=C(C(=C(C(=C1O)O)O)C2=C(C(=C(C=C2C(=O))O)O)O)C(=O) |
|
|
|
| SMILES = O=C(O)c2cc(O)c(O)c(O)c2c1c(O)c(O)c(O)cc1C(=O)O |
|
| InChI = |
|
|
|
| InChI = 1/C14H10O10/c15-5-1-3(13(21)22)7(11(19)9(5)17)8-4(14(23)24)2-6(16)10(18)12(8)20/h1-2,15-20H,(H,21,22)(H,23,24) |
|
|
| InChIKey = MFTSECOLKFLUSD-UHFFFAOYAZ |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C14H10O10/c15-5-1-3(13(21)22)7(11(19)9(5)17)8-4(14(23)24)2-6(16)10(18)12(8)20/h1-2,15-20H,(H,21,22)(H,23,24) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = MFTSECOLKFLUSD-UHFFFAOYSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>14</sub>H<sub>10</sub>O<sub>10</sub> |
|
| C=14 | H=10 | O=10 |
|
| MolarMass = 338.22 g/mol |
|
|
| ExactMass = 338.027396 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Hexahydroxydiphenic acid''' is a component of some ]s.<ref>Ellagitannin Chemistry. Studies on the Stability and Reactivity of 2,4-HHDP-Containing Glucopyranose Systems. Ken S. Feldman, Malliga R. Iyer and Yanze Liu, J. Org. Chem., 2003, 68 (19), pp. 7433–7438, {{doi|10.1021/jo034495x}}</ref> ] is the di] of hexahydroxydiphenic acid. |
|
|
|
|
|
|
|
'''Hexahydroxydiphenic acid''' is an organic compound with the formula <sub>2</sub>. It is the oxidatively coupled derivative of ]<ref name=Haslam_and_Cai>{{Cite journal | last1 = Haslam | first1 = E. | last2 = Cai | first2 = Y. | doi = 10.1039/NP9941100041 | title = Plant polyphenols (vegetable tannins): Gallic acid metabolism | journal = Natural Product Reports | volume = 11 | issue = 1 | pages = 41–66 | year = 1994 | pmid = 15206456}}</ref> It is a white solid, although samples are typically brown owing to oxidation. |
| ⚫ |
==References== |
|
|
|
|
|
|
==Occurrence== |
|
|
].]] |
|
|
] and ] are the mono- and di] of hexahydroxydiphenic acid, respectively. Hexahydroxydiphenic acid is a component of some ]s,<ref>{{cite journal | doi = 10.1021/jo034495x| pmid = 12968897| title = Ellagitannin Chemistry. Studies on the Stability and Reactivity of 2,4-HHDP-Containing Glucopyranose Systems| journal = The Journal of Organic Chemistry| volume = 68| issue = 19| pages = 7433–7438| year = 2003| last1 = Feldman| first1 = Ken S.| last2 = Iyer| first2 = Malliga R.| last3 = Liu| first3 = Yanze}}</ref> such as ]. |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
|
|
⚫ |
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
| Line 37: |
Line 51: |
|
{{DEFAULTSORT:Hexahydroxydiphenic Acid}} |
|
{{DEFAULTSORT:Hexahydroxydiphenic Acid}} |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{phenol-stub}} |