| Revision as of 14:29, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456533638 of page Homatropine for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL', 'CAS_number'). |
Latest revision as of 06:52, 26 October 2024 edit Citation bot (talk | contribs)Bots5,429,201 edits Add: doi-access, page. Removed parameters. | Use this bot. Report bugs. | Suggested by Jay8g | #UCB_toolbar |
| Line 1: |
Line 1: |
|
|
{{Short description|Medication}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
{{more citations needed|date=October 2021}} |
|
{{Drugbox |
|
|
|
{{Infobox drug |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 402148773 |
|
| verifiedrevid = 461770217 |
|
⚫ |
| image = Homatropine.svg |
| ⚫ |
| IUPAC_name = (''N''-methyl-8-azabicyclooct-3-yl) 2-hydroxy-2-phenylacetate |
|
|
| image = HomatropineNEW.png |
|
| ⚫ |
| drug_name = Homatropine |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|monograph|glycopyrrolate}} |
|
| Drugs.com = {{drugs.com|monograph|homatropine}} |
|
| MedlinePlus = a601006 |
|
| MedlinePlus = a601006 |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_status = |
|
| legal_status = Rx only |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
| Line 21: |
Line 18: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = 80-49-9 |
|
| CAS_number = 87-00-3 |
|
| ATC_prefix = A02 |
|
| ATC_prefix = S01 |
|
| ATC_suffix = BX03 |
|
| ATC_suffix = FA05 |
|
| ATC_supplemental = {{ATC|S01|FA05}} |
|
| ATC_supplemental = |
|
| PubChem = 6321423 |
|
| PubChem = 6321423 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
| DrugBank = <!-- blanked - oldvalue: APRD01017 --> |
|
| DrugBank = DB00725 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 16498795 |
|
| ChemSpiderID = 16498795 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 8QS6WCL55Z |
|
| UNII = 8QS6WCL55Z |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 1233442 --> |
|
| ChEMBL = 1233442 |
|
|
<!--Chemical data--> |
| ⚫ |
| C=16 | H=21 | N=1 | O=3 |
|
|
⚫ |
| IUPAC_name = (''N''-Methyl-8-azabicyclooct-3-yl) 2-hydroxy-2-phenylacetate |
|
| molecular_weight = 356.26 g/mol |
|
|
⚫ |
| C=16 | H=21 | N=1 | O=3 |
|
| smiles = CN31CC3C(C1)OC(=O)C(O)c2ccccc2 |
|
| smiles = CN31CC3C(C1)OC(=O)C(O)c2ccccc2 |
|
| InChI = 1/C16H21NO3/c1-17-12-7-8-13(17)10-14(9-12)20-16(19)15(18)11-5-3-2-4-6-11/h2-6,12-15,18H,7-10H2,1H3/t12-,13+,14+,15? |
|
|
| InChIKey = ZTVIKZXZYLEVOL-HCYNLOQUSA-N |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C16H21NO3/c1-17-12-7-8-13(17)10-14(9-12)20-16(19)15(18)11-5-3-2-4-6-11/h2-6,12-15,18H,7-10H2,1H3/t12-,13+,14+,15? |
|
| StdInChI = 1S/C16H21NO3/c1-17-12-7-8-13(17)10-14(9-12)20-16(19)15(18)11-5-3-2-4-6-11/h2-6,12-15,18H,7-10H2,1H3/t12-,13+,14+,15? |
| Line 48: |
Line 42: |
|
| StdInChIKey = ZTVIKZXZYLEVOL-MCOXGKPRSA-N |
|
| StdInChIKey = ZTVIKZXZYLEVOL-MCOXGKPRSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Homatropine''' ('''Equipin''', '''Isopto Homatropine''') is an ] ] that is an antagonist at ]s and thus the ]. It is used in ]s as a ] (to temporarily paralyze ]), and as a ] (to dilate the ]). |
|
|
|
|
|
The related chemical compound ] (methylhomatropine) is a different medication. Homatropine is less ] than ] and has a shorter duration of action. It is available as the ] ]. Homatropine is also given as an atropine substitute,<ref>{{cite journal | vauthors = Scharer LL, Burhenne HJ | title = Megacolon associated with administration of an anticholinergic drug in a patient with ulcerative colitis | journal = The American Journal of Digestive Diseases | volume = 9 | issue = 4 | pages = 268–274 | date = April 1964 | pmid = 14142388 | doi = 10.1007/bf02232133 | s2cid = 19169565 }}</ref> given to reverse the muscarinic and ] effects associated with indirect ] (anti-AChase) administration. |
|
|
|
|
|
Homatropine hydrobromide is on the ].<ref name="WHO23rd">{{cite book | vauthors = ((World Health Organization)) | title = The selection and use of essential medicines 2023: web annex A: World Health Organization model list of essential medicines: 23rd list (2023) | year = 2023 | hdl = 10665/371090 | author-link = World Health Organization | publisher = World Health Organization | location = Geneva | id = WHO/MHP/HPS/EML/2023.02 | hdl-access=free }}</ref> |
|
|
|
|
|
It is an antagonist of all five muscarinic acetylcholine receptors.<ref name="LavradorCabralVeríssimo2023">{{cite journal | vauthors = Lavrador M, Cabral AC, Veríssimo MT, Fernandez-Llimos F, Figueiredo IV, Castel-Branco MM | title = A Universal Pharmacological-Based List of Drugs with Anticholinergic Activity | journal = Pharmaceutics | volume = 15 | issue = 1 | date = January 2023 | page = 230 | pmid = 36678858 | pmc = 9863833 | doi = 10.3390/pharmaceutics15010230 | doi-access = free | url = }}</ref> |
|
|
|
|
|
==Side effects== |
|
|
* Blurred vision |
|
|
* ] |
|
|
|
|
|
==Contraindications== |
|
|
* Untreated ] |
|
|
* ] |
|
|
* Severe ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Mydriatics and cycloplegics}} |
|
|
{{Muscarinic acetylcholine receptor modulators}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{gastrointestinal-drug-stub}} |