| Revision as of 09:39, 18 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 13:09, 18 July 2023 edit undoFadesga (talk | contribs)Autopatrolled, Extended confirmed users264,875 edits →References |
| (19 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 354478498 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Homocitric acid.png |
|
|
⚫ |
| verifiedrevid = 424661508 |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile=Homocitric acid.png |
| ⚫ |
|IUPACName=2-hydroxybutane-1,2,4-tricarboxylic acid |
|
|
⚫ |
| ImageSize=200px |
| ⚫ |
|OtherNames= Homocitric acid<br>Homocitrate |
|
|
⚫ |
| PIN=2-Hydroxybutane-1,2,4-tricarboxylic acid |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| OtherNames= Homocitric acid<br>Homocitrate |
| ⚫ |
| CASNo=3562-74-1 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| PubChem=28371 |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| SMILES=OC(=O)CCC(O)(CC(O)=O)C(O)=O |
|
|
⚫ |
| CASNo=3562-74-1 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 5883XD8HH4 |
|
⚫ |
| PubChem=28371 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 26392 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 17852 |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = C01251 |
|
⚫ |
| SMILES = O=C(O)CC(O)(C(=O)O)CCC(=O)O |
|
|
| InChI = 1/C7H10O7/c8-4(9)1-2-7(14,6(12)13)3-5(10)11/h14H,1-3H2,(H,8,9)(H,10,11)(H,12,13) |
|
|
| InChIKey = XKJVEVRQMLKSMO-UHFFFAOYAL |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C7H10O7/c8-4(9)1-2-7(14,6(12)13)3-5(10)11/h14H,1-3H2,(H,8,9)(H,10,11)(H,12,13) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = XKJVEVRQMLKSMO-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=7 | H=10 | O=7 |
|
| Formula=C<sub>7</sub>H<sub>10</sub>O<sub>7</sub> |
|
|
⚫ |
| Appearance=Colorless solid |
|
| MolarMass=206.15 g/mol |
|
|
|
| Density= |
| ⚫ |
| Appearance=colorless solid |
|
|
| Density= |
|
| MeltingPtC= |
|
| MeltingPtC= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Homocitric acid''' is an ] with the formula HOC(CO<sub>2</sub>H)(CH<sub>2</sub>CO<sub>2</sub>H)(C<sub>2</sub>H<sub>4</sub>CO<sub>2</sub>H). This tri] occurs naturally as a component of the iron-molybdenum cofactor of certain ] proteins.<ref>Douglas C. Rees "Great Metalloclusters in Enzymology" Annual Reviews of Biochemistry 2002, volume 71, pp. 221–46. {{DOI|10.1146/annurev.biochem.71.110601.135406}}</ref> Biochemists often refer to this cofactor as homocitrate, which is the conjugate bases that predominate in neutral aqueous solutions of this species. |
|
'''Homocitric acid''' is an ] with the formula HOC(CO<sub>2</sub>H)(CH<sub>2</sub>CO<sub>2</sub>H)(C<sub>2</sub>H<sub>4</sub>CO<sub>2</sub>H). This ] occurs naturally as a component of the ] of certain ] proteins.<ref>{{cite journal | doi = 10.1146/annurev.biochem.71.110601.135406 | title = Great Metalloclusters in Enzymology | year = 2002 | last1 = Rees | first1 = Douglas C. | journal = Annual Review of Biochemistry | volume = 71 | pages = 221–46 | pmid = 12045096| url = https://authors.library.caltech.edu/7659/1/REEarb02.pdf }}</ref> Biochemists often refer to this cofactor as homocitrate, which is the conjugate bases that predominate in neutral aqueous solutions of this species. |
|
|
|
|
|
The molecule is related to ] by the addition of one ] group, which is implied with the term "homo." Unlike citric acid, homocitric acid is ]. The acid exists in equilibrium with the ]. |
|
The molecule is related to ] by the addition of one ], hence the prefix "homo." Unlike citric acid, homocitric acid is ]. The acid exists in equilibrium with the ]. |
|
|
|
|
|
:]<br style="clear:left;"/> |
|
:]{{clear|left}} |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
==References== |
|
==References== |
|
<references/> |
|
<references/> |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
| Line 41: |
Line 60: |
|
|
|
|
|
{{biochem-stub}} |
|
{{biochem-stub}} |
|
|
{{acid-stub}} |