| Revision as of 13:41, 18 May 2011 editCitation bot (talk | contribs)Bots5,428,421 editsm +: issue, pmid.← Previous edit |
Latest revision as of 16:46, 17 March 2023 edit undoCitation bot (talk | contribs)Bots5,428,421 edits Add: s2cid, pmid, authors 1-1. Removed parameters. Some additions/deletions were parameter name changes. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | #UCB_webform 557/3819 |
| (25 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 440126165 |
|
| Name = Hopeaphenol |
|
| Name = Hopeaphenol |
|
| ImageFile = Hopeaphenol.svg |
|
| ImageFile = Hopeaphenol.svg |
| Line 6: |
Line 9: |
|
| ImageAlt = Chemical structure of hopeaphenol |
|
| ImageAlt = Chemical structure of hopeaphenol |
|
| IUPACName = |
|
| IUPACName = |
|
| OtherNames = |
|
| OtherNames = (-)-hopeaphenol |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = 17912-85-5 |
|
| CASNo = 17912-85-5 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASOther = |
|
| CASNoOther = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 8K2E6922LC |
|
| PubChem = 495605 |
|
| PubChem = 495605 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1082601 |
|
| SMILES = OC(C=C1)=CC=C12OC3=CC(O)=CC4=C32()C(C=C(O)C=C5O)=C5(C6=CC=C(O)C=C6)4()7()(C8=CC=C(O)C=C8)C9=C(C=C(O)C=C9O)%10()C%11=C7C=C(O)C=C%11O%10C%12=CC=C(O)C=C%12 |
|
| SMILES = OC(C=C1)=CC=C12OC3=CC(O)=CC4=C32()C(C=C(O)C=C5O)=C5(C6=CC=C(O)C=C6)4()7()(C8=CC=C(O)C=C8)C9=C(C=C(O)C=C9O)%10()C%11=C7C=C(O)C=C%11O%10C%12=CC=C(O)C=C%12 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| InChI = |
|
|
|
| ChemSpiderID = 10277817 |
|
|
| InChI = 1/C56H42O12/c57-29-9-1-25(2-10-29)45-47-37(17-33(61)21-41(47)65)53-49-39(19-35(63)23-43(49)67-55(53)27-5-13-31(59)14-6-27)51(45)52-40-20-36(64)24-44-50(40)54(56(68-44)28-7-15-32(60)16-8-28)38-18-34(62)22-42(66)48(38)46(52)26-3-11-30(58)12-4-26/h1-24,45-46,51-66H/t45-,46-,51-,52-,53-,54-,55+,56+/m0/s1 |
|
|
| InChIKey = YQQUILZPDYJDQJ-QWJFNKQSBW |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C56H42O12/c57-29-9-1-25(2-10-29)45-47-37(17-33(61)21-41(47)65)53-49-39(19-35(63)23-43(49)67-55(53)27-5-13-31(59)14-6-27)51(45)52-40-20-36(64)24-44-50(40)54(56(68-44)28-7-15-32(60)16-8-28)38-18-34(62)22-42(66)48(38)46(52)26-3-11-30(58)12-4-26/h1-24,45-46,51-66H/t45-,46-,51-,52-,53-,54-,55+,56+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = YQQUILZPDYJDQJ-QWJFNKQSSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=56|H=42|O=12 |
|
| C=56 | H=42 | O=12 |
|
| ExactMass = 906.267627 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| RPhrases = |
|
|
| SPhrases = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
⚫ |
'''Hopeaphenol''' is a ]. It is a ] ]. It has been first isolated from ]<ref>The structure of hopeaphenol. P. Coggon, T. J. King and S. C. Wallwork, Chem. Commun. (London), 1966, pages 439-440, {{doi|10.1039/C19660000439}}</ref> like '']''.<ref>The Isolation of Hopeaphenol, a Tetramer Stilbene, from Shorea ovalis Blume. Advances in Natural & Applied Sciences, January–April 2009, Volume 3, Issue 1, page 107 ()</ref> It has also been isolated from ]s from North Africa.<ref>{{cite journal | title = Hopeaphenol: The First Resveratrol Tetramer in Wines from North Africa |author1=Habiba Amira Guebailia |author2=Kleopatra Chira |author3=Tristan Richard |author4=Teguiche Mabrouk |author5=Aurélie Furiga |author6=Xavier Vitrac |author7=Jean-Pierre Monti |author8=Jean-Claude Delaunay |author9=Jean-Michel Mérillon | journal = J. Agric. Food Chem. | year = 2006 | volume = 54 | pages = 9559–9564 | doi = 10.1021/jf062024g | issue = 25 | pmid = 17147446}}</ref> |
|
|
|
|
|
|
It shows an opposite effect to ] on apoptosis of myocytes isolated from adult rat heart.<ref>{{cite journal | last1=Seya | first1=Kazuhiko | last2=Kanemaru | first2=Kouta | last3=Sugimoto | first3=Chiharu | last4=Suzuki | first4=Megumi | last5=Takeo | first5=Teruko | last6=Motomura | first6=Shigeru | last7=Kitahara | first7=Haruo | last8=Niwa | first8=Masatake | last9=Oshima | first9=Yoshiteru | last10=Furukawa | first10=Ken-Ichi |display-authors=5| title=Opposite Effects of Two Resveratrol (trans-3,5,4′-Trihydroxystilbene) Tetramers, Vitisin A and Hopeaphenol, on Apoptosis of Myocytes Isolated from Adult Rat Heart | journal=Journal of Pharmacology and Experimental Therapeutics | publisher=American Society for Pharmacology & Experimental Therapeutics (ASPET) | volume=328 | issue=1 | date=2008-10-16 | issn=0022-3565 | doi=10.1124/jpet.108.143172 | pages=90–98| pmid=18927354 | s2cid=22844861 }}</ref> |
| ⚫ |
'''Hopeaphenol''' is a ]. It is a ] ] isolated from wines.<ref>{{cite journal | title = Hopeaphenol: The First Resveratrol Tetramer in Wines from North Africa | author = Habiba Amira Guebailia, Kleopatra Chira, Tristan Richard, Teguiche Mabrouk, Aurélie Furiga, Xavier Vitrac, Jean-Pierre Monti, Jean-Claude Delaunay and Jean-Michel Mérillon | journal = J. Agric. Food Chem. | year = 2006 | volume = 54 | pages = 9559–9564 | doi = 10.1021/jf062024g | issue = 25 | pmid = 17147446}}</ref> |
|
|
|
|
|
|
==See also== |
|
== See also == |
|
* ] |
|
* ] |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{stilbenoid}} |
|
{{Oligostilbenoid}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
{{Natural-phenol-stub}} |
|