Revision as of 09:46, 23 July 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm dihydroisocoumarin← Previous edit |
Latest revision as of 02:37, 12 January 2023 edit undoPashihiko (talk | contribs)Extended confirmed users3,559 editsNo edit summary |
(25 intermediate revisions by 19 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 442971440 |
|
| Name = Hydrangenol |
|
| Name = Hydrangenol |
|
| ImageFile = Hydrangenol.png |
|
| ImageFile = Hydrangenol.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| ImageName = Chemical structure of hydrangenol |
|
| ImageName = Chemical structure of hydrangenol |
|
| ImageAlt = Chemical structure of hydrangenol |
|
| ImageAlt = Chemical structure of hydrangenol |
|
| IUPACName = 8-hydroxy-3-(4-hydroxyphenyl)-3,4-dihydroisochromen-1-one |
|
| PIN = 8-Hydroxy-3-(4-hydroxyphenyl)-1''H''-2-benzopyran-1-one |
|
| OtherNames = <!-- <br> --> |
|
| OtherNames = <!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 480-47-7 |
|
| CASNo = 480-47-7 |
|
| CASNo_Ref = |
|
| CASNoOther = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| CASOther = |
|
|
|
| UNII = TL8PI7PHV1 |
|
| PubChem = 119199 |
|
| PubChem = 119199 |
|
|
| KEGG = C10262 |
|
| SMILES = C1C(OC(=O)C2=C1C=CC=C2O)C3=CC=C(C=C3)O |
|
| SMILES = C1C(OC(=O)C2=C1C=CC=C2O)C3=CC=C(C=C3)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| InChI = |
|
|
|
| ChemSpiderID = 106486 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 5776 |
|
|
| InChI = 1/C15H12O4/c16-11-6-4-9(5-7-11)13-8-10-2-1-3-12(17)14(10)15(18)19-13/h1-7,13,16-17H,8H2 |
|
|
| InChIKey = DGKDFNDHPXVXHW-UHFFFAOYAS |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C15H12O4/c16-11-6-4-9(5-7-11)13-8-10-2-1-3-12(17)14(10)15(18)19-13/h1-7,13,16-17H,8H2 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = DGKDFNDHPXVXHW-UHFFFAOYSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>15</sub>H<sub>12</sub>O<sub>4</sub> |
|
| Formula = C<sub>15</sub>H<sub>12</sub>O<sub>4</sub> |
|
| MolarMass = 256.25 g/mol |
|
| MolarMass = 256.25 g/mol |
|
| ExactMass = 256.073559 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. --> |
|
| GHS_ref =<!-- no GHS data in PubChem Dec2021 --> |
|
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. --> |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Hydrangenol''' is an ]. It can found in '']'', as well as its 8-O-glucoside.<ref>Effects of ], hydrangenol, and their 8-O-glucosides, and ] and ] from Hydrangea macrophylla SERINGE var. thunbergii MAKINO on passive cutaneous anaphylaxis reaction in rats. Matsuda H., Shimoda H., Yamahara J. and Yoshikawa M., Biological & pharmaceutical bulletin, 1999, vol. 22, no8, pp. 870-872, {{INIST|1959604}}</ref> (-)-hydrangenol 4'-O-glucoside<ref>Thunberginols C, D, and E, new antiallergic and antimicrobial dihydroisocoumarins, and thunberginol G 3'-O-glucoside and (-)-hydrangenol 4'-O-glucoside, new dihydroisocoumarin glycosides, from Hydrangeae Dulcis Folium. Yoshikawa M, Uchida E, Chatani N, Kobayashi H, Naitoh Y, Okuno Y, Matsuda H, Yamahara J and Murakami N. Chem Pharm Bull (Tokyo). 1992 Dec;40(12), pp. 3352-3354, {{PMID|1363465}}</ref> and (+)-hydrangenol 4'-O-glucoside<ref>Development of bioactive functions in hydrangeae dulcis folium. V. On the antiallergic and antimicrobial principles of hydrangeae dulcis folium. (2). Thunberginols C, D, and E, thunberginol G 3'-O-glucoside, (-)-hydrangenol 4'-o-glucoside, and (+)-hydrangenol 4'-O-glucoside. Yoshikawa M, Matsuda H, Shimoda H, Shimada H, Harada E, Naitoh Y, Miki A, Yamahara J and Murakami N, Chem Pharm Bull (Tokyo). 1996 Aug;44(8), pp. 1440-1447, {{PMID|8795265}}, {{INIST|3226693}}</ref>can be found in ''Hydrangeae Dulcis Folium'', the processed leaves of ''H. macrophylla var. thunbergii''. |
|
'''Hydrangenol''' is a ]. It can be found in '']'', as well as its 8-''O''-glucoside.<ref>{{Cite journal|title=Effects of phyllodulcin, hydrangenol, and their 8-''O''-glucosides, and thunberginols A and F from ''Hydrangea macrophylla'' Seringe var. ''thunbergii'' Makino on passive cutaneous anaphylaxis reaction in rats|journal= Biological & Pharmaceutical Bulletin|year= 1999|volume=22|issue=8|pages= 870–872|id={{INIST|1959604}}|doi=10.1248/bpb.22.870|last1=Matsuda|first1=Hisashi|last2=Simoda|first2=Hiroshi|last3=Yamahara|first3=Johji|last4=Yoshikawa|first4=Masayuki|pmid=10480329|doi-access=free}}</ref> (−)-Hydrangenol 4′-''O''-glucoside<ref>{{Cite journal|pmid=1363465|year=1992|last1=Yoshikawa|first1=M|last2=Uchida|first2=E|last3=Chatani|first3=N|last4=Kobayashi|first4=H|last5=Naitoh|first5=Y|last6=Okuno|first6=Y|last7=Matsuda|first7=H|last8=Yamahara|first8=J|last9=Murakami|first9=N|title=Thunberginols C, D, and E, new antiallergic and antimicrobial dihydroisocoumarins, and thunberginol G 3′-O-glucoside and (−)-hydrangenol 4′-O-glucoside, new dihydroisocoumarin glycosides, from Hydrangeae Dulcis Folium|volume=40|issue=12|pages=3352–3354|journal=Chemical & Pharmaceutical Bulletin|doi=10.1248/cpb.40.3352|doi-access=free}}</ref> and (+)-hydrangenol 4′-''O''-glucoside<ref>{{Cite journal|pmid=8795265|id= {{INIST|3226693}}|year=1996|last1=Yoshikawa|first1=M|last2=Matsuda|first2=H|last3=Shimoda|first3=H|last4=Shimada|first4=H|last5=Harada|first5=E|last6=Naitoh|first6=Y|last7=Miki|first7=A|last8=Yamahara|first8=J|last9=Murakami|first9=N|title=Development of bioactive functions in Hydrangeae Dulcis Folium. V. On the antiallergic and antimicrobial principles of Hydrangeae Dulcis Folium. (2). Thunberginols C, D, and E, thunberginol G 3′-''O''-glucoside, (−)-hydrangenol 4′-''O''-glucoside, and (+)-hydrangenol 4′-''O''-glucoside|volume=44|issue=8|pages=1440–1447|journal=Chemical & Pharmaceutical Bulletin|doi=10.1248/cpb.44.1440 |doi-access=free}}</ref> can be found in Hydrangeae Dulcis Folium, the processed leaves of ''H. macrophylla'' var. ''thunbergii''. |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{Isocoumarin}} |
|
{{Isocoumarin}} |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
|
|
{{aromatic-stub}} |