| Revision as of 21:11, 18 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 04:20, 5 November 2023 edit undoCitation bot (talk | contribs)Bots5,430,338 edits Add: title. Changed bare reference to CS1/2. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | Category:Sugar alcohols | #UCB_Category 17/21 |
| (17 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 313322808 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|Name=<small>D</small>-Iditol |
|
|
⚫ |
| verifiedrevid = 424749281 |
| ⚫ |
|ImageFile=iditol.png |
|
|
⚫ |
| Name={{sm|d}}-Iditol |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile=iditol.png |
| ⚫ |
|IUPACName=(2''R'',3''S'',4''S'',5''R'')-Hexane-1,2,3,4,5,6-hexol |
|
|
⚫ |
| ImageSize=200px |
|
|OtherNames= |
|
|
|
| IUPACName={{sm|d}}-Iditol<ref>{{cite web | url=https://iupac.qmul.ac.uk/2carb/19.html | title=2-Carb-19 }}</ref> |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| SystematicName=(2''R'',3''S'',4''S'',5''R'')-Hexane-1,2,3,4,5,6-hexol |
| ⚫ |
| SMILES=C(((((CO)O)O)O)O)O |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo = 25878-23-3 |
|
|
| CASNo_Ref = {{Cascite|changed|CAS}} |
|
|
| CASNo1 = 24557-79-7 |
|
|
| CASNo1_Ref = {{Cascite|changed|CAS}} |
|
|
| index1_label = DL |
|
|
| Beilstein = 1721905 |
|
|
| ChEBI = 17459 |
|
|
| EINECS = 246-314-3 |
|
|
| KEGG = C01489 |
|
|
| PubChem = 90540 |
|
|
| UNII = 82FOM4R7CD |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 81747 |
|
⚫ |
| SMILES = O((O)CO)(O)(O)CO |
|
|
| InChI = 1/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5+,6+/m1/s1 |
|
|
| InChIKey = FBPFZTCFMRRESA-ZXXMMSQZBT |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5+,6+/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = FBPFZTCFMRRESA-ZXXMMSQZSA-N |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=6 | H=14 | O=6 |
|
| Formula=C<sub>6</sub>H<sub>14</sub>O<sub>6</sub> |
|
|
|
| Appearance= |
|
| MolarMass=182.172g/mol |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Iditol''' is a ] which accumulates in ]. |
|
'''Iditol''' is a ]<ref>{{cite web | url = https://hmdb.ca/metabolites/HMDB0011632 | title = L-Iditol | work = Human Metabolome Database }}</ref> which accumulates in ].{{cn|reason=A Google search will provide only results that merely copy Misplaced Pages's unsourced claim word-for-word. Must find a source that predates the 2007 creation of this article.|date=February 2023}} |
|
|
|
|
|
==See also== |
|
==See also== |
|
* ] |
|
*] |
|
* ] |
|
*] |
|
* ] |
|
*] |
|
|
|
|
|
|
==References== |
| ⚫ |
] |
|
|
|
{{reflist}} |
|
|
|
|
|
|
==External links== |
|
|
*{{Commonscatinline}} |
|
|
|
|
|
|
{{Alcohols}} |
| ⚫ |
{{biochemistry-stub}} |
|
|
|
|
|
{{Fructose and galactose metabolic intermediates}} |
|
{{Fructose and galactose metabolic intermediates}} |
|
|
|
|
|
⚫ |
] |
|
] |
|
|
|
|
|
⚫ |
{{biochemistry-stub}} |