| Revision as of 11:03, 6 April 2011 editWikitanvirBot (talk | contribs)144,145 editsm r2.7.1) (robot Adding: hu:Imiprotrin← Previous edit |
Latest revision as of 14:32, 9 July 2024 edit undoOld Man Consequences (talk | contribs)Extended confirmed users43,717 edits Stub sort |
| (31 intermediate revisions by 26 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 396495200 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|Reference=<ref> at ]</ref><ref name=EPA>, ]</ref> |
|
|
⚫ |
| verifiedrevid = 422676078 |
| ⚫ |
|ImageFile=Imiprothrin.svg |
|
|
|
| Name = |
|
|ImageSize=200px |
|
|
⚫ |
| Reference = <ref> at ]</ref><ref name="EPA">, ], March 1998.</ref> |
| ⚫ |
|IUPACName=(2,5-Dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
|
|
⚫ |
| ImageFile = Imiprothrin.svg |
| ⚫ |
|OtherNames=Pralle; Multicide |
|
|
⚫ |
| PIN = methyl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropane-1-carboxylate |
| ⚫ |
|Section1={{Chembox Identifiers |
|
|
⚫ |
| OtherNames = Pralle; Multicide |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
| ⚫ |
| ChemSpiderID = 11677252 |
|
| ⚫ |
| InChI = 1/C16H20N2O4/c1-6-7-17-9-12(19)18(15(17)21)22-14(20)13-11(8-10(2)3)16(13,4)5/h1,8,11,13H,7,9H2,2-5H3 |
|
|
| InChIKey = LCSQQWBCNOLPHM-UHFFFAOYAJ |
|
| ⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C16H20N2O4/c1-6-7-17-9-12(19)18(15(17)21)22-14(20)13-11(8-10(2)3)16(13,4)5/h1,8,11,13H,7,9H2,2-5H3 |
|
| ⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| ⚫ |
| StdInChIKey = LCSQQWBCNOLPHM-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=72963-72-5 |
|
| CASNo = 72963-72-5 |
|
|
| ChEBI = 39389 |
| ⚫ |
| PubChem=123622 |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| SMILES = O=C2N(OC(=O)C1C(/C=C(\C)C)C1(C)C)C(=O)CN2CC#C |
|
|
⚫ |
| ChemSpiderID = 110211 |
| ⚫ |
}} |
|
|
|
| EC_number = 615-873-9 |
|
|Section2={{Chembox Properties |
|
|
|
| KEGG = D01889 |
| ⚫ |
| C=17|H=22|N=2|O=4 |
|
|
⚫ |
| PubChem = 123622 |
|
| Appearance= |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| Density=0.979 g/mL |
|
|
|
| UNII = 73OFA861WY |
| ⚫ |
| MeltingPt= |
|
|
⚫ |
| SMILES = O=C(OCN1C(=O)CN(C1=O)CC#C)C2C(\C=C(/C)C)C2(C)C |
| ⚫ |
| BoilingPt= |
|
|
⚫ |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| Solubility= |
|
|
⚫ |
| StdInChI = 1S/C17H22N2O4/c1-6-7-18-9-13(20)19(16(18)22)10-23-15(21)14-12(8-11(2)3)17(14,4)5/h1,8,12,14H,7,9-10H2,2-5H3 |
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
⚫ |
| StdInChIKey = VPRAQYXPZIFIOH-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
| Section2 = {{Chembox Properties |
|
⚫ |
| C=17 | H=22 | N=2 | O=4 |
| ⚫ |
| MainHazards= |
|
|
|
| Appearance=Golden yellow liquid |
|
| FlashPt=110 °C |
|
|
|
| Odor=Slightly sweet |
|
| Autoignition= |
|
|
⚫ |
| Density=0.979 g/mL |
|
| RPhrases = {{R22}} {{R50}} |
|
|
⚫ |
| MeltingPt= |
|
| SPhrases = {{S61}} |
|
|
⚫ |
| BoilingPt= |
|
⚫ |
| Solubility= |
|
}} |
|
}} |
|
|
| Section3 = {{Chembox Hazards |
|
⚫ |
| MainHazards= |
|
|
| FlashPtC = 110 |
|
|
| AutoignitionPtC = |
|
|
| GHSPictograms = {{GHS07}}{{GHS09}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|302|410}} |
|
|
| PPhrases = {{P-phrases|264|270|273|301+312|330|391|501}} |
|
⚫ |
}} |
|
|
| Section4 = |
|
|
| Section5 = |
|
|
| Section6 = |
|
}} |
|
}} |
|
|
|
|
|
'''Imiprothrin''' is a synthetic ] ]. It is an ingredient in some insecticide products for indoor use.<ref name=EPA/> It has low acute toxicity to humans,<ref name=EPA/> but to insects it acts as a ] causing ]. |
|
'''Imiprothrin''' is a synthetic ] ]. It is an ingredient in some commercial and consumer insecticide products for indoor use. It has low acute toxicity to humans through the ] and ] routes, but to insects it acts as a ] causing ]. It is effective against ]es, ], ]s, ], ] and ]s, among others.<ref name="EPA"/> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
|
|
{{insecticides}} |
|
{{insecticides}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{hydrocarbon-stub}} |
|
] |
|
|
] |
|
|
] |
|