Misplaced Pages

Impromidine: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 07:52, 13 August 2010 editSnubcube (talk | contribs)Extended confirmed users638 edits Replace png with svg← Previous edit Latest revision as of 17:37, 11 January 2023 edit undoFfffrr (talk | contribs)Extended confirmed users99,452 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper 
(22 intermediate revisions by 14 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox| {{Drugbox
|IUPAC_name = ''N''--''N'''-(2-{thio}ethyl)guanidine
| Verifiedfields = changed
| image=Impromidine.svg
| Watchedfields = changed
| CAS_number=55273-05-7
| verifiedrevid = 378676793
| ATC_prefix=none
| IUPAC_name = 2--1-ethyl]guanidine
| ATC_suffix=
| image = Impromidine.svg
| PubChem= 41376
| width = 260
| image2 = Impromidine 3D.png

<!--Clinical data-->
| tradename =
| routes_of_administration =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 55273-05-7
| ATC_prefix = none
| PubChem = 41376
| IUPHAR_ligand = 1226 | IUPHAR_ligand = 1226
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank=
| UNII_Ref = {{fdacite|changed|FDA}}
| smiles = Cc2ncnc2CSCCNC(N)=NCCCc1cncn1
| UNII = 931L4X5WMM
| C=14 | H=23 | N=7 | S=1
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| molecular_weight = 321.44 g/mol
| ChEMBL = 12608
| bioavailability=
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| metabolism =
| ChemSpiderID = 37757
| elimination_half-life=
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| excretion =
| StdInChI = 1S/C14H23N7S/c1-11-13(21-10-19-11)8-22-6-5-18-14(15)17-4-2-3-12-7-16-9-20-12/h7,9-10H,2-6,8H2,1H3,(H,16,20)(H,19,21)(H3,15,17,18)
| pregnancy_category =
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| legal_status =
| StdInChIKey = MURRAGMMNAYLNA-UHFFFAOYSA-N
| routes_of_administration=

<!--Chemical data-->
| C=14 | H=23 | N=7 | S=1
| smiles = Cc1cnc1CSCCNC(=N)NCCCc2ccn2
}} }}

'''Impromidine''' (]) is a highly potent and specific ] H<sub>2</sub> receptor ].<ref>{{cite journal |author=Durant G, Duncan W, Ganellin C, Parsons M, Blakemore R, Rasmussen A |title=Impromidine (SK&F 92676) is a very potent and specific agonist for histamine H2 receptors |url=http://www.nature.com/nature/journal/v276/n5686/abs/276403a0.html |journal=] |volume=276 |issue=5686 |pages=403–5 |year=1978 |pmid=714166 |doi=10.1038/276403a0}}</ref> '''Impromidine''' (]) is a highly potent and specific histamine ] ].<ref>{{cite journal |vauthors=Durant G, Duncan W, Ganellin C, Parsons M, Blakemore R, Rasmussen A |title=Impromidine (SK&F 92676) is a very potent and specific agonist for histamine H2 receptors |journal=] |volume=276 |issue=5686 |pages=403–5 |year=1978 |pmid=714166 |doi=10.1038/276403a0|s2cid=4242863 }}</ref>


It has been used diagnostically as a gastric secretion indicator. It has been used diagnostically as a gastric secretion indicator.


See ]. == See also ==
* ]


==References== ==References==
<references/> <references/>


{{pharma-stub}}
{{Histaminergics}} {{Histaminergics}}


Line 34: Line 51:
] ]
] ]


{{gastrointestinal-drug-stub}}