Revision as of 07:52, 13 August 2010 editSnubcube (talk | contribs)Extended confirmed users638 edits Replace png with svg← Previous edit |
Latest revision as of 17:37, 11 January 2023 edit undoFfffrr (talk | contribs)Extended confirmed users99,452 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
(22 intermediate revisions by 14 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox| |
|
{{Drugbox |
⚫ |
|IUPAC_name = ''N''--''N'''-(2-{thio}ethyl)guanidine |
|
|
|
| Verifiedfields = changed |
⚫ |
| image=Impromidine.svg |
|
|
|
| Watchedfields = changed |
⚫ |
| CAS_number=55273-05-7 |
|
|
|
| verifiedrevid = 378676793 |
⚫ |
| ATC_prefix=none |
|
|
⚫ |
| IUPAC_name = 2--1-ethyl]guanidine |
|
| ATC_suffix= |
|
|
⚫ |
| image = Impromidine.svg |
⚫ |
| PubChem= 41376 |
|
|
|
| width = 260 |
|
|
| image2 = Impromidine 3D.png |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 55273-05-7 |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| PubChem = 41376 |
|
| IUPHAR_ligand = 1226 |
|
| IUPHAR_ligand = 1226 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank= |
|
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| smiles = Cc2ncnc2CSCCNC(N)=NCCCc1cncn1 |
|
|
|
| UNII = 931L4X5WMM |
⚫ |
| C=14 | H=23 | N=7 | S=1 |
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| molecular_weight = 321.44 g/mol |
|
|
|
| ChEMBL = 12608 |
|
| bioavailability= |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| metabolism = |
|
|
|
| ChemSpiderID = 37757 |
|
| elimination_half-life= |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| excretion = |
|
|
|
| StdInChI = 1S/C14H23N7S/c1-11-13(21-10-19-11)8-22-6-5-18-14(15)17-4-2-3-12-7-16-9-20-12/h7,9-10H,2-6,8H2,1H3,(H,16,20)(H,19,21)(H3,15,17,18) |
|
| pregnancy_category = |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| legal_status = |
|
|
|
| StdInChIKey = MURRAGMMNAYLNA-UHFFFAOYSA-N |
⚫ |
| routes_of_administration= |
|
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=14 | H=23 | N=7 | S=1 |
|
|
| smiles = Cc1cnc1CSCCNC(=N)NCCCc2ccn2 |
|
}} |
|
}} |
|
|
|
|
'''Impromidine''' (]) is a highly potent and specific ] H<sub>2</sub> receptor ].<ref>{{cite journal |author=Durant G, Duncan W, Ganellin C, Parsons M, Blakemore R, Rasmussen A |title=Impromidine (SK&F 92676) is a very potent and specific agonist for histamine H2 receptors |url=http://www.nature.com/nature/journal/v276/n5686/abs/276403a0.html |journal=] |volume=276 |issue=5686 |pages=403–5 |year=1978 |pmid=714166 |doi=10.1038/276403a0}}</ref> |
|
'''Impromidine''' (]) is a highly potent and specific histamine ] ].<ref>{{cite journal |vauthors=Durant G, Duncan W, Ganellin C, Parsons M, Blakemore R, Rasmussen A |title=Impromidine (SK&F 92676) is a very potent and specific agonist for histamine H2 receptors |journal=] |volume=276 |issue=5686 |pages=403–5 |year=1978 |pmid=714166 |doi=10.1038/276403a0|s2cid=4242863 }}</ref> |
|
|
|
|
|
It has been used diagnostically as a gastric secretion indicator. |
|
It has been used diagnostically as a gastric secretion indicator. |
|
|
|
|
|
See ]. |
|
== See also == |
|
|
* ] |
|
|
|
|
|
==References== |
|
==References== |
|
<references/> |
|
<references/> |
|
|
|
|
|
{{pharma-stub}} |
|
|
{{Histaminergics}} |
|
{{Histaminergics}} |
|
|
|
|
Line 34: |
Line 51: |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{gastrointestinal-drug-stub}} |