Misplaced Pages

Iodophenpropit: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 23:30, 5 December 2010 editCitation bot (talk | contribs)Bots5,427,458 editsm Citations: added: last1, first1, last2, first2, last3, first3, last4, first4, last5, first5, last6, first6, last7, first7, last8, first8, title, journal, volume, issue, pages, year, pmc. Rjwilmsi← Previous edit Latest revision as of 15:56, 7 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Iodobenzene derivatives; added Category:4-Iodophenyl compounds using HotCat 
(21 intermediate revisions by 17 users not shown)
Line 1: Line 1:
{{chembox {{chembox
| Verifiedfields = changed
|ImageFile=Iodophenpropit.png
| Watchedfields = changed
|ImageSize=220px
| verifiedrevid = 400753856
|IUPACName=3-(1''H''-imidazol-5-yl)propyl ''N'''-imidothiocarbamate
| ImageFile = Iodophenpropit.svg
|OtherNames=1--N'-formamidine
| ImageSize = 240
|Section1={{Chembox Identifiers
| IUPACName = 3-(1''H''-imidazol-5-yl)propyl ''N'''-imidothiocarbamate
| CASNo=143407-29-8
| OtherNames = 1--''N'''-formamidine
| PubChem=3035746

| SMILES=C1=CC(=CC=C1CCN=C(N)SCCCC2=CN=CN2)I
| Section1 = {{Chembox Identifiers
| MeSHName=Iodophenpropit
| CASNo_Ref = {{cascite|correct|??}}
| CASNo=145196-88-9
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 3SH45L9H3Z
| PubChem=3035746
| ChemSpiderID=2299913
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 498770
| SMILES=C1=CC(=CC=C1CCN=C(N)SCCCC2=CN=CN2)I
| MeSHName=Iodophenpropit
}} }}

|Section2={{Chembox Properties | Section2 = {{Chembox Properties
| Formula=C<sub>15</sub>H<sub>19</sub>IN<sub>4</sub>S | Formula = C<sub>15</sub>H<sub>19</sub>IN<sub>4</sub>S
| MolarMass=414.30763 | MolarMass = 414.30763 g/mol
| Appearance=
| Appearance =
| Density=
| Density =
| MeltingPt=
| MeltingPt =
| BoilingPt=
| BoilingPt =
| Solubility=
| Solubility =
}} }}

|Section3={{Chembox Hazards | Section3 = {{Chembox Hazards
| MainHazards=
| MainHazards =
| FlashPt=
| FlashPt =
| Autoignition=
| AutoignitionPt =
}} }}
}} }}

'''Iodophenpropit''' is a ] which binds selectively to the ] subtype. Its <sup>125</sup>I ] form is used for mapping the distribution of H<sub>3</sub> receptors in the body.<ref>{{cite journal | last1 = Jansen | first1 = FP | last2 = Wu | first2 = TS | last3 = Voss | first3 = HP | last4 = Steinbusch | first4 = HW | last5 = Vollinga | first5 = RC | last6 = Rademaker | first6 = B | last7 = Bast | first7 = A | last8 = Timmerman | first8 = H | title = Characterization of the binding of the first selective radiolabelled histamine H3-receptor antagonist, 125I-iodophenpropit, to rat brain | journal = British journal of pharmacology | volume = 113 | issue = 2 | pages = 355–62 | year = 1994 | pmid = 7834183 | pmc = 1510107 }}</ref><ref>{{cite journal | last1 = Jansen | first1 = FP | last2 = Mochizuki | first2 = T | last3 = Maeyama | first3 = K | last4 = Leurs | first4 = R | last5 = Timmerman | first5 = H | title = Characterization of histamine H3 receptors in mouse brain using the H3 antagonist 125Iiodophenpropit | journal = Naunyn-Schmiedeberg's archives of pharmacology | volume = 362 | issue = 1 | pages = 60–7 | year = 2000 | pmid = 10935534 }}</ref> '''Iodophenpropit''' is a ] which binds selectively to the ]. Its <sup>125</sup>I ] form has been used for mapping the distribution of H<sub>3</sub> receptors in animal studies.<ref>{{cite journal | last1 = Jansen | first1 = FP | last2 = Wu | first2 = TS | last3 = Voss | first3 = HP | last4 = Steinbusch | first4 = HW | last5 = Vollinga | first5 = RC | last6 = Rademaker | first6 = B | last7 = Bast | first7 = A | last8 = Timmerman | first8 = H | title = Characterization of the binding of the first selective radiolabelled histamine H3-receptor antagonist, 125I-iodophenpropit, to rat brain | journal = ] | volume = 113 | issue = 2 | pages = 355–62 | year = 1994 | pmid = 7834183 | pmc = 1510107 | doi=10.1111/j.1476-5381.1994.tb16995.x}}</ref><ref>{{cite journal | last1 = Jansen | first1 = FP | last2 = Mochizuki | first2 = T | last3 = Maeyama | first3 = K | last4 = Leurs | first4 = R | last5 = Timmerman | first5 = H | title = Characterization of histamine H3 receptors in mouse brain using the H3 antagonist 125Iiodophenpropit | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | volume = 362 | issue = 1 | pages = 60–7 | year = 2000 | pmid = 10935534 | doi = 10.1007/s002100000227 | s2cid = 21293180 }}</ref>


==References== ==References==
Line 34: Line 47:
] ]
] ]
] ]



{{pharm-stub}} {{pharm-stub}}