Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Iofendylate: Difference between pages - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 13:34, 22 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456603366 of page Iofendylate for the Chem/Drugbox validation project (updated: 'ChEMBL').  Latest revision as of 15:57, 7 September 2024 edit JWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Iodobenzene derivatives; added Category:4-Iodophenyl compounds using HotCat 
Line 1: Line 1:
{{Short description|Chemical compound}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 396496109 | verifiedrevid = 461935493
| IUPAC_name = ethyl 10-(4-iodophenyl)undecanoate | IUPAC_name = ethyl 10-(4-iodophenyl)undecanoate
| image = Iofendylate.png | image = Iofendylate.png
| drug_name = Iophendylate | drug_name = Iophendylate

<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename = Myodil, Pantopaque
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X -->
Line 19: Line 18:
| legal_status = | legal_status =
| routes_of_administration = | routes_of_administration =

<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = | bioavailability =
Line 26: Line 24:
| elimination_half-life = | elimination_half-life =
| excretion = | excretion =

<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}} | CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 99-79-6 | CAS_number = 99-79-6
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 2990I809YH
| ATC_prefix = V08 | ATC_prefix = V08
| ATC_suffix = AD04 | ATC_suffix = AD04
| PubChem = 7458 | PubChem = 7458
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01187 | DrugBank = DB01187
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 2301035 | ChemSpiderID = 7178
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 2990I809YH
| ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = <!-- blanked - oldvalue: 951 --> | ChEMBL = 951
<!--Chemical data-->
| chemical_formula = | chemical_formula =
| C=19 | H=29 | I=1 | O=2 | C=19 | H=29 | I=1 | O=2
| molecular_weight = 416.33683
| smiles = Ic1ccccc1C(CCCCCCCCC(=O)OCC)C | smiles = CCOC(=O)CCCCCCCCC(C)C1=CC=C(C=C1)I
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| InChI = 1/C19H29IO2/c1-3-22-19(21)15-9-7-5-4-6-8-12-16(2)17-13-10-11-14-18(17)20/h10-11,13-14,16H,3-9,12,15H2,1-2H3 | StdInChI = 1S/C19H29IO2/c1-3-22-19(21)11-9-7-5-4-6-8-10-16(2)17-12-14-18(20)15-13-17/h12-16H,3-11H2,1-2H3
| InChIKey = IWRUDYQZPTVTPA-UHFFFAOYAP
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = LAYLQVBQIBQVLL-UHFFFAOYSA-N
| StdInChI = 1S/C19H29IO2/c1-3-22-19(21)15-9-7-5-4-6-8-12-16(2)17-13-10-11-14-18(17)20/h10-11,13-14,16H,3-9,12,15H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = IWRUDYQZPTVTPA-UHFFFAOYSA-N
}} }}
'''Iofendylate''' is a molecule that was used as a ], typically for performing ] studies. It was marketed under the trade names '''Pantopaque''' (in North America) and '''Myodil''' (rest of the world).

Iofendylate is a highly ] (oily) substance and as such it was recommended that the physician remove it from the patient at the end of the myelography study, which was a difficult and painful part of the procedure. Moreover, because complete removal could not always be achieved (or even attempted by some physicians), iofendylate's persistence in the body might sometimes lead to ], a potentially painful and debilitating lifelong disorder of the spine.<ref>{{cite news| vauthors = Dunlevy S |title=Australians crippled and in chronic pain from dye used in toxic X-rays|url=http://www.dailytelegraph.com.au/lifestyle/health/australians-crippled-and-in-chronic-pain-from-dye-used-in-toxic-xrays/news-story/e35f258d50c2508c214809896673da88|access-date=27 October 2017|work=]|date=10 December 2016}}</ref><ref>{{cite book| vauthors = Dillon WP, Dowd CF |title=Aminoff's Neurology and General Medicine |pages=1089–1105 |edition=5th |chapter=Chapter 53 – Neurologic Complications of Imaging Procedures |date=2014 |publisher=] |isbn=978-0-12-407710-2 }}</ref> As a result, the substance, which was used extensively for over three decades, became the subject of multiple lawsuits filed around the world.<ref></ref>

Iofendylate's use ceased when water-soluble agents suitable for spinal imaging (such as ]) became available in the late 1970s. With those substances it was no longer necessary to manually remove the ] as it would eventually be removed by the body.<ref name="radioNeuroHist">{{cite journal | vauthors = Leeds NE, Kieffer SA | title = Evolution of diagnostic neuroradiology from 1904 to 1999 | journal = Radiology | volume = 217 | issue = 2 | pages = 309–318 | date = November 2000 | pmid = 11058623 | doi = 10.1148/radiology.217.2.r00nv45309 | url = https://pdfs.semanticscholar.org/8bfc/17f6ff7c70706ad0ad25b382558088463a2c.pdf | url-status = dead | s2cid = 14639546 | archive-url = https://web.archive.org/web/20180617220005/https://pdfs.semanticscholar.org/8bfc/17f6ff7c70706ad0ad25b382558088463a2c.pdf | archive-date = 2018-06-17 }}</ref> Also, with the advent of ], myelography studies are nowadays much less-frequently performed.

== References ==
{{Reflist}}

== External links ==
* (video segment from the 1990s)

{{Contrast media}}
]
]

{{pharmacology-stub}}