Misplaced Pages

Iopydol: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 02:04, 10 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation← Previous edit Latest revision as of 04:28, 25 March 2024 edit undoDMacks (talk | contribs)Edit filter managers, Autopatrolled, Administrators186,448 edits auto mw 
(12 intermediate revisions by 11 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 443978653
| IUPAC_name = 1-(2,3-dihydroxypropyl)-3,5-diiodo-1,4-dihydropyridin-4-one
| image = Iopydol.png

<!--Clinical data-->
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 5579-92-0
| ATC_prefix = V08
| ATC_suffix = AD02
| PubChem = 21751
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB13389
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = T4661K682A | UNII = T4661K682A
| verifiedrevid = 443781119
| IUPAC_name = 1-(2,3-dihydroxypropyl)-3,5-diiodo-1,4-dihydropyridin-4-one
| image = Iopydol.png
| CAS_number =
| ATC_prefix = V08
| ATC_suffix = AD02
| PubChem = 21751
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D04586 | KEGG = D04586
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| chemical_formula =
| ChemSpiderID = 20443
|C=8|H=9|I=2|N=1|O=3

| molecular_weight = 420.9709
<!--Chemical data-->
| bioavailability =
| chemical_formula =
| protein_bound =
| metabolism = | C=8 | H=9 | I=2 | N=1 | O=3
| smiles = C1=C(C(=O)C(=CN1CC(CO)O)I)I
| elimination_half-life =
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| excretion =
| StdInChI = 1S/C8H9I2NO3/c9-6-2-11(1-5(13)4-12)3-7(10)8(6)14/h2-3,5,12-13H,1,4H2
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| pregnancy_US = <!-- A / B / C / D / X -->
| StdInChIKey = TZADDXVKYWMEHX-UHFFFAOYSA-N
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}} }}
'''Iopydol''' is a pharmaceutical drug used as a ] in ].<ref>{{DrugBank|DB13389}}</ref><ref>{{cite journal | vauthors = Bétrémieux P, Tréguier C, Pladys P, Bourdinière J, Leclech G, Lefrancois C | title = Tracheobronchography and balloon dilatation in acquired neonatal tracheal stenosis | journal = Archives of Disease in Childhood. Fetal and Neonatal Edition | volume = 72 | issue = 1 | pages = F3-7 | date = January 1995 | pmid = 7743281 | pmc = 2528410 | doi = 10.1136/fn.72.1.f3 }}</ref>
'''Iopydol''' is a ] used as a ].

== See also ==
* ]

== References ==
{{reflist}}


{{Contrast media}} {{Contrast media}}


] ]
] ]
] ]
] ]