| Revision as of 05:20, 29 May 2011 editWikitanvirBot (talk | contribs)144,145 editsm r2.7.1) (robot Adding: zh:五氟化铱← Previous edit |
Latest revision as of 15:23, 20 June 2024 edit undoAnDeargMor (talk | contribs)Extended confirmed users798 edits Added tetramer structure as described in articleTag: Visual edit |
| (25 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{Chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 414397129 |
|
| verifiedrevid = 431440582 |
|
| ImageFile = |
|
|
|
| ImageFile1 = PtF5solid.tif |
|
| ImageSize = |
|
|
|
| ImageFile2 = Unit_cell__of_OsF5.png |
|
| IUPACName = |
|
|
| OtherNames = Iridium pentafluoride |
|
| IUPACName = |
|
|
| OtherNames = Iridium pentafluoride |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 14568-19-5 |
|
| CASNo = 14568-19-5 |
|
| PubChem = |
|
| PubChem = |
|
| SMILES = }} |
|
| SMILES = F(F)(F)(F)F |
|
|
| SMILES_Comment = monomer |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| SMILES1 = F1(F)(F)(F)(F)(F)(F)(F)(F)(F)(F)(F)(F)(F)(F)(F)1 |
|
|
| SMILES1_Comment = tetramer |
|
|
| StdInChI=1S/5FH.Ir/h5*1H;/q;;;;;+5/p-5 |
|
|
| StdInChIKey = AVEYGPFFIPYHQT-UHFFFAOYSA-I |
|
|
}} |
|
⚫ |
| Section2 = {{Chembox Properties |
|
| Formula = IrF<sub>5</sub> |
|
| Formula = IrF<sub>5</sub> |
|
| MolarMass = 287.209 g/mol |
|
| MolarMass = 287.209 g/mol |
|
| Appearance = yellow solid |
|
| Appearance = yellow solid |
|
| Density = |
|
| Density = |
|
| MeltingPt = 104.5°C |
|
| MeltingPtC = 104.5 |
|
|
| MeltingPt_notes = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = |
|
|
}} |
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition = }} |
|
|
|
}} |
|
| Section3 = {{Chembox Related |
|
| Section4 = {{Chembox Related |
|
| OtherCations = ], ], ] |
|
|
| OtherCpds = ], ] }} |
|
| OtherCations = ], ], ] |
|
|
| OtherCompounds = ], ] }} |
|
}} |
|
}} |
|
|
|
|
|
'''Iridium(V) fluoride''', IrF<sub>5</sub>, is a chemical compound of ] and ], first described by ] in 1965.<ref>{{cite journal |journal=Chem. Commun. |year=1965 |pages=252–253 |doi=10.1039/C19650000252 |title=Iridium pentafluoride |author=Neil Bartlett and P. R. Rao |issue=12}}</ref> A highly reactive yellow low melting solid, it has a tetrameric structure, Ir<sub>4</sub>F<sub>20</sub>, which contains octahedrally coordinated iridium atoms.<ref name = "Wiberg&Holleman">Egon Wiberg, Arnold Frederick Holleman (2001) ''Inorganic Chemistry'', Elsevier ISBN 0-12-352651-5</ref> This structure is shared with ] and ]. It can be prepared by the controlled decomposition of IrF<sub>6</sub><ref name = "Wiberg&Holleman"/>or the reduction of IrF<sub>6</sub> with ] powder or ] in anhydrous ]. |
|
'''Iridium(V) fluoride''', IrF<sub>5</sub>, is a chemical compound of ] and ]. A highly reactive yellow low melting solid, it has a tetrameric structure, Ir<sub>4</sub>F<sub>20</sub>, which contains octahedrally coordinated iridium atoms.<ref name = "Wiberg&Holleman">Egon Wiberg, Arnold Frederick Holleman (2001) ''Inorganic Chemistry'', Elsevier {{ISBN|0-12-352651-5}}</ref> This structure is shared with ] and ]. It can be prepared by the controlled decomposition of IrF<sub>6</sub><ref name = "Wiberg&Holleman"/> or the reduction of IrF<sub>6</sub> with ] powder or ] in anhydrous ].<ref>{{cite journal | title = Reductive syntheses of transition metal fluoride compounds. Synthesis of rhenium, osmium, and iridium pentafluorides and tetrafluorides | journal = Inorganic Chemistry| volume = 14 | issue = 5 | year = 1975 | pages = 1111–1113 | doi = 10.1021/ic50147a030 | last1 = Paine | first1 = Robert T. | last2 = Asprey | first2 = Larned B.}}</ref><ref>{{cite journal |journal=Chem. Commun. |year=1965 |pages=252–253 |doi=10.1039/C19650000252 |title=Iridium pentafluoride |first1=Neil|last1= Bartlett |first2= P. R.|last2=Rao|author1-link=Neil Bartlett (chemist)|issue=12}}</ref> |
|
|
|
|
<ref>{{cite journal | title = Reductive syntheses of transition metal fluoride compounds. Synthesis of rhenium, osmium, and iridium pentafluorides and tetrafluorides | journal = Robert T. Paine, Larned B. Asprey | volume = 14 | issue = 5 | year = 1975 | pages = 1111–1113 | doi = 10.1021/ic50147a030 | last1 = Paine | first1 = Robert T. | last2 = Asprey | first2 = Larned B.}}</ref> |
|
|
|
<chem>2IrF6 + H2 -> 2IrF5 + 2HF</chem><br/> |
|
|
<chem>4IrF6 + Si -> 4IrF5 + SiF4</chem> |
|
|
|
|
|
==See also== |
|
==See also== |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
|
|
|
|
==References== |
|
==References== |
| Line 38: |
Line 50: |
|
|
|
|
|
{{Iridium compounds}} |
|
{{Iridium compounds}} |
|
|
{{Fluorides}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
] |
|
|
] |
|