| Revision as of 22:12, 14 January 2011 editChristian75 (talk | contribs)Extended confirmed users, New page reviewers, Pending changes reviewers, Rollbackers114,680 edits General fixes, added orphan tag using AWB← Previous edit |
Latest revision as of 16:11, 2 June 2021 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move PIN |
| (11 intermediate revisions by 7 users not shown) |
| Line 1: |
Line 1: |
|
{{Orphan|date=January 2011}} |
|
|
|
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
|
| verifiedrevid = 407914996 |
|
| ImageFile = Isobutyramide group.svg |
|
|
| PIN = Isobutyramide |
|
| ImageFile = Isobutyramide.svg |
|
|
| ImageSize = 150px |
|
| SystematicName = 2-Methylpropan-1-oylazanide |
|
|
|
| PIN = 2-Methylpropanamide |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| OtherNames = |
| ⚫ |
| SMILES = CC(C)C(=O |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| InChI = 1S/C4H9NO/c1-3(2)4(5)6/h3H,1-2H3,(H2,5,6)/p-1 |
|
|
|
| CASNo = 563-83-7 |
|
| InChIKey = WFKAJVHLWXSISD-UHFFFAOYSA-M}} |
|
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
|
| PubChem = 68424 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 352219 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 61707 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 82UOE7B38Z |
|
⚫ |
| SMILES = O=C(N)C(C)C |
|
⚫ |
| InChI = InChI=1S/C4H9NO/c1-3(2)4(5)6/h3H,1-2H3,(H2,5,6) |
|
|
}} |
|
|
|Section2={{Chembox Properties |
|
|
| C=4 | H=9 | N=1 | O=1 |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = |
|
|
| BoilingPt = |
|
|
| Solubility = |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Isobutyramide''' in chemistry is a ] with the following chemical formula: -NH-CO-CH(CH<sub>3</sub>)<sub>2</sub> |
|
'''Isobutyramide''' in chemistry is an ] with the molecular formula C<sub>4</sub>H<sub>9</sub>NO. |
|
|
|
|
|
Isobutyramide can also refer to the ] with the following chemical formula: R-NH-CO-CH(CH<sub>3</sub>)<sub>2</sub>. |
|
|
:]{{clear-left}} |
|
|
|
|
|
== See also == |
|
== See also == |
|
*] |
|
* ] |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|
|
{{chem-stub}} |
|
{{organic-compound-stub}} |